Difference between revisions of "Very-Long-Chain-3-Hydroxyacyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1065 == * common-name: ** aminopropylcadaverine * smiles: ** c(cc[n+]ccccc[n+])[n+] * inchi-key: ** qzbyoyprovgoge-uhfffaoysa-q * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10254 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (9z,12z)-hexadeca-9,12-dienoyl-coa |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqxsjfxwargobe-pcrjdaltsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 997.883 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9616]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=997.883}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-10254
- common-name:
- (9z,12z)-hexadeca-9,12-dienoyl-coa
- smiles:
- cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cqxsjfxwargobe-pcrjdaltsa-j
- molecular-weight:
- 997.883
