Difference between revisions of "Very-Long-Chain-Alcohols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-D-FRUCTOSE == * common-name: ** β-d-fructofuranose * smiles: ** c(o)c1(oc(o)(co)c(c1o)o) * inchi-key: ** rfsuneuaizkajo-arqdhwq...") |
(Created page with "Category:metabolite == Metabolite CPD-9897 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9897 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate |
* smiles: | * smiles: | ||
| − | ** c(o)c1 | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wcqcnoikxgndlx-rdsvhmiisa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 848.323 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9282]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wcqcnoikxgndlx-rdsvhmiisa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=848.323}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-9897
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- wcqcnoikxgndlx-rdsvhmiisa-m
- molecular-weight:
- 848.323
