Difference between revisions of "Very-long-chain-fatty-acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13855 == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])...")
(Created page with "Category:metabolite == Metabolite Very-long-chain-fatty-acids == * common-name: ** a very-long-chain fatty acid == Reaction(s) known to consume the compound == * RXN-164...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13855 ==
+
== Metabolite Very-long-chain-fatty-acids ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-diphosphate
+
** a very-long-chain fatty acid
* smiles:
 
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
 
* inchi-key:
 
** sbasprrecyvbrf-kqynxxcusa-l
 
* molecular-weight:
 
** 455.214
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12817]]
+
* [[RXN-16415]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12817]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
+
{{#set: common-name=a very-long-chain fatty acid}}
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
 
{{#set: molecular-weight=455.214}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Very-long-chain-fatty-acids

  • common-name:
    • a very-long-chain fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality