Difference between revisions of "Very-long-chain-fatty-acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13855 == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])...")
(Created page with "Category:metabolite == Metabolite 3-oxo-petroselinoyl-ACPs == * common-name: ** a 3-oxo-petroselinoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9552...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13855 ==
+
== Metabolite 3-oxo-petroselinoyl-ACPs ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-diphosphate
+
** a 3-oxo-petroselinoyl-[acp]
* smiles:
 
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
 
* inchi-key:
 
** sbasprrecyvbrf-kqynxxcusa-l
 
* molecular-weight:
 
** 455.214
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12817]]
+
* [[RXN-9552]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12817]]
+
* [[RXN-8391]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
+
{{#set: common-name=a 3-oxo-petroselinoyl-[acp]}}
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
 
{{#set: molecular-weight=455.214}}
 

Revision as of 13:12, 14 January 2021

Metabolite 3-oxo-petroselinoyl-ACPs

  • common-name:
    • a 3-oxo-petroselinoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-petroselinoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.