Difference between revisions of "Workflow"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...") |
(Created page with "=Workflow command history= ==Command sequence== ==Downloads== You can download the command log file here") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | + | =Workflow command history= | |
| − | + | ||
| − | + | ==Command sequence== | |
| − | + | ==Downloads== | |
| − | + | You can download the [[MEDIA:log.txt|command log file here]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
