Difference between revisions of "Workflow"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4702 == * common-name: ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(...") |
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite G3P == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phospho-d-glycerate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** osjppgntcrnqqc-uwtatzphsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 183.034 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3PGAREARR-RXN]] |
+ | * [[PGLYCDEHYDROG-RXN]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | * [[RXN-15511]] | ||
+ | * [[RXN-15513]] | ||
+ | * [[RXN-17276]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3PGAREARR-RXN]] |
− | * [[RXN- | + | * [[GLY3KIN-RXN]] |
− | * [[RXN- | + | * [[PGLYCDEHYDROG-RXN]] |
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
+ | * [[RXN-15511]] | ||
+ | * [[RXN-15513]] | ||
+ | * [[RXN-17274]] | ||
+ | * [[RXN-3443]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phospho-d-glycerate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=183.034}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite G3P
- common-name:
- 3-phospho-d-glycerate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(=o)[o-]
- inchi-key:
- osjppgntcrnqqc-uwtatzphsa-k
- molecular-weight:
- 183.034
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3PGAREARR-RXN
- GLY3KIN-RXN
- PGLYCDEHYDROG-RXN
- PHOSGLYPHOS-RXN
- RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN
- RXN-15511
- RXN-15513
- RXN-17274
- RXN-3443