Difference between revisions of "Wound-RNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...") |
(Created page with "Category:metabolite == Metabolite Wound-RNA == * common-name: ** wound rna == Reaction(s) known to consume the compound == * RXN-11109 == Reaction(s) known to produce...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Wound-RNA == |
* common-name: | * common-name: | ||
− | ** | + | ** wound rna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11109]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=wound rna}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Wound-RNA
- common-name:
- wound rna