Difference between revisions of "XANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D7-tetradecenoyl-ACPs == * common-name: ** a trans-δ3-cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite XANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** xanthine |
| + | * smiles: | ||
| + | ** c12(nc(=o)nc(c=1n=cn2)=o) | ||
| + | * inchi-key: | ||
| + | ** lrfvtywoqmyalw-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 152.112 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RXN0-901]] |
| + | * [[XANTHINE-OXIDASE-RXN]] | ||
| + | * [[XNDH]] | ||
| + | * [[XPPRT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[GUANINE-DEAMINASE-RXN]] |
| + | * [[RXN-7682]] | ||
| + | * [[RXN0-363]] | ||
| + | * [[RXN0-901]] | ||
| + | * [[XANDH]] | ||
| + | * [[XANTHOSINEPHOSPHORY-RXN]] | ||
| + | * [[XPPRT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=xanthine}} |
| + | {{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=152.112}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite XANTHINE
- common-name:
- xanthine
- smiles:
- c12(nc(=o)nc(c=1n=cn2)=o)
- inchi-key:
- lrfvtywoqmyalw-uhfffaoysa-n
- molecular-weight:
- 152.112
