Difference between revisions of "XANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09304 == * transcription-direction: ** positive * right-end-position: ** 11937 * left-end-position: ** 11332 * centisome-position: ** 26.903444...") |
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite XANTHINE == |
| − | * | + | * common-name: |
| − | ** | + | ** xanthine |
| − | * | + | * smiles: |
| − | ** | + | ** c12(nc(=o)nc(c=1n=cn2)=o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** lrfvtywoqmyalw-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 152.112 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-901]] |
| − | == Reaction(s) | + | * [[XANTHINE-OXIDASE-RXN]] |
| − | * [[ | + | * [[XNDH]] |
| − | ** | + | * [[XPPRT]] |
| − | *** | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[GUANINE-DEAMINASE-RXN]] |
| − | {{#set: | + | * [[RXN-7682]] |
| − | + | * [[RXN0-363]] | |
| − | {{#set: | + | * [[RXN0-901]] |
| − | + | * [[XANDH]] | |
| − | + | * [[XANTHOSINEPHOSPHORY-RXN]] | |
| + | * [[XPPRT]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=xanthine}} | ||
| + | {{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=152.112}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite XANTHINE
- common-name:
- xanthine
- smiles:
- c12(nc(=o)nc(c=1n=cn2)=o)
- inchi-key:
- lrfvtywoqmyalw-uhfffaoysa-n
- molecular-weight:
- 152.112
