Difference between revisions of "XANTHOSINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.6.4.4-RXN 1.6.4.4-RXN] == * direction: ** reversible * common-name: ** protein-disulfide reductas...")
 
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key:...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.6.4.4-RXN 1.6.4.4-RXN] ==
+
== Metabolite XANTHOSINE-5-PHOSPHATE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** protein-disulfide reductase
+
** xmp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.8.1.8 ec-1.8.1.8]
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[Protein-Dithiols]][c] '''<=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Protein-Disulfides]][c]
+
** dctlyfzhfgencw-uuokfmhzsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 362.192
−
* Gene: [[SJ09093]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[GMP-SYN-GLUT-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GMP-SYN-NH3-RXN]]
−
* Gene: [[SJ16658]]
+
* [[IMP-DEHYDROG-RXN]]
−
** Category: [[annotation]]
+
* [[X5NT]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[XMPXAN-RXN]]
−
* Gene: [[SJ12278]]
+
* [[XPPRT]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[IMP-DEHYDROG-RXN]]
−
* Gene: [[SJ03044]]
+
* [[NTPD]]
−
** Category: [[annotation]]
+
* [[RXN0-1603]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[XPPRT]]
−
* Gene: [[SJ01778]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=xmp}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}}
−
* Gene: [[SJ00931]]
+
{{#set: molecular-weight=362.192}}
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ08960]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06874]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ00760]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03913 R03913]
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03914 R03914]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=protein-disulfide reductase}}
 
−
{{#set: ec-number=ec-1.8.1.8}}
 
−
{{#set: nb gene associated=9}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite XANTHOSINE-5-PHOSPHATE

  • common-name:
    • xmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • dctlyfzhfgencw-uuokfmhzsa-l
  • molecular-weight:
    • 362.192

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=XANTHOSINE-5-PHOSPHATE&oldid=139727"