Difference between revisions of "XANTHOSINE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10911 RXN-10911] == * direction: ** left-to-right * common-name: ** 3,4-dihydroxyphenylglycolal...")
(Created page with "Category:metabolite == Metabolite ADENOSYL-HOMO-CYS == * common-name: ** s-adenosyl-l-homocysteine * smiles: ** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10911 RXN-10911] ==
+
== Metabolite ADENOSYL-HOMO-CYS ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3,4-dihydroxyphenylglycolaldehyde reductase
+
** s-adenosyl-l-homocysteine
−
** alcohol dehydrogenase (nad)
+
* smiles:
−
* ec-number:
+
** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+]
−
** [http://enzyme.expasy.org/EC/1.1.1.1 ec-1.1.1.1]
+
* inchi-key:
−
* synonymous:
+
** zjuktbdsgofhsh-wfmpwkqpsa-n
−
** 3,4-dihydroxyphenylglycol dehydrogenase
+
* molecular-weight:
−
== Reaction formula ==
+
** 384.409
−
* 1 [[DIHYDROXYPHENYLGLYCOLALDEHYDE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-11878]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to consume the compound ==
−
== Gene(s) associated with this reaction  ==
+
* [[2.1.1.135-RXN]]
−
* Gene: [[SJ14768]]
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
−
** Category: [[annotation]]
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[AMETt2h]]
−
* Gene: [[SJ07759]]
+
* [[AMETt2m]]
−
** Category: [[annotation]]
+
* [[RXN-17120]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17121]]
−
* Gene: [[SJ21601]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
−
** Category: [[orthology]]
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.1.1.100-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.1.1.113-RXN]]
−
== Pathway(s)  ==
+
* [[2.1.1.114-RXN]]
−
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
+
* [[2.1.1.115-RXN]]
−
** '''8''' reactions found over '''13''' reactions in the full pathway
+
* [[2.1.1.124-RXN]]
−
== Reconstruction information  ==
+
* [[2.1.1.125-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[2.1.1.126-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[2.1.1.127-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.1.1.128-RXN]]
−
== External links  ==
+
* [[2.1.1.137-RXN]]
−
* RHEA:
+
* [[2.1.1.138-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31149 31149]
+
* [[2.1.1.140-RXN]]
−
* LIGAND-RXN:
+
* [[2.1.1.143-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R04880 R04880]
+
* [[2.1.1.17-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[2.1.1.34-RXN]]
−
{{#set: common-name=alcohol dehydrogenase (nad)|3,4-dihydroxyphenylglycolaldehyde reductase}}
+
* [[2.1.1.57-RXN]]
−
{{#set: ec-number=ec-1.1.1.1}}
+
* [[2.1.1.62-RXN]]
−
{{#set: synonymous=3,4-dihydroxyphenylglycol dehydrogenase}}
+
* [[2.1.1.64-RXN]]
−
{{#set: nb gene associated=3}}
+
* [[2.1.1.71-RXN]]
−
{{#set: nb pathway associated=1}}
+
* [[2.1.1.72-RXN]]
−
{{#set: reconstruction category=annotation|orthology}}
+
* [[2.1.1.77-RXN]]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* [[2.1.1.79-RXN]]
−
{{#set: reconstruction comment=n.a}}
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
+
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
 +
* [[AMETt2h]]
 +
* [[AMETt2m]]
 +
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 +
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[DHHB-METHYLTRANSFER-RXN]]
 +
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 +
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
 +
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 +
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
 +
* [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
 +
* [[RXN-1104]]
 +
* [[RXN-11046]]
 +
* [[RXN-11241]]
 +
* [[RXN-11267]]
 +
* [[RXN-11268]]
 +
* [[RXN-11370]]
 +
* [[RXN-11373]]
 +
* [[RXN-11374]]
 +
* [[RXN-1143]]
 +
* [[RXN-11475]]
 +
* [[RXN-11574]]
 +
* [[RXN-11578]]
 +
* [[RXN-11586]]
 +
* [[RXN-11592]]
 +
* [[RXN-11596]]
 +
* [[RXN-11598]]
 +
* [[RXN-11601]]
 +
* [[RXN-11602]]
 +
* [[RXN-11633]]
 +
* [[RXN-11634]]
 +
* [[RXN-11637]]
 +
* [[RXN-11638]]
 +
* [[RXN-11754]]
 +
* [[RXN-11757]]
 +
* [[RXN-11758]]
 +
* [[RXN-11855]]
 +
* [[RXN-11856]]
 +
* [[RXN-11860]]
 +
* [[RXN-11865]]
 +
* [[RXN-11866]]
 +
* [[RXN-11868]]
 +
* [[RXN-12160]]
 +
* [[RXN-12374]]
 +
* [[RXN-12375]]
 +
* [[RXN-12376]]
 +
* [[RXN-12377]]
 +
* [[RXN-12378]]
 +
* [[RXN-12379]]
 +
* [[RXN-12380]]
 +
* [[RXN-12381]]
 +
* [[RXN-12382]]
 +
* [[RXN-12458]]
 +
* [[RXN-12459]]
 +
* [[RXN-12461]]
 +
* [[RXN-12466]]
 +
* [[RXN-12469]]
 +
* [[RXN-12477]]
 +
* [[RXN-12478]]
 +
* [[RXN-12479]]
 +
* [[RXN-12889]]
 +
* [[RXN-12890]]
 +
* [[RXN-13224]]
 +
* [[RXN-13225]]
 +
* [[RXN-13226]]
 +
* [[RXN-13227]]
 +
* [[RXN-13228]]
 +
* [[RXN-13327]]
 +
* [[RXN-13403]]
 +
* [[RXN-13404]]
 +
* [[RXN-13405]]
 +
* [[RXN-13406]]
 +
* [[RXN-13588]]
 +
* [[RXN-13725]]
 +
* [[RXN-13726]]
 +
* [[RXN-13727]]
 +
* [[RXN-13935]]
 +
* [[RXN-14177]]
 +
* [[RXN-14326]]
 +
* [[RXN-14481]]
 +
* [[RXN-14517]]
 +
* [[RXN-14520]]
 +
* [[RXN-14528]]
 +
* [[RXN-14539]]
 +
* [[RXN-14540]]
 +
* [[RXN-14549]]
 +
* [[RXN-14550]]
 +
* [[RXN-14917]]
 +
* [[RXN-14918]]
 +
* [[RXN-14919]]
 +
* [[RXN-14992]]
 +
* [[RXN-15775]]
 +
* [[RXN-15842]]
 +
* [[RXN-15843]]
 +
* [[RXN-15844]]
 +
* [[RXN-16889]]
 +
* [[RXN-16891]]
 +
* [[RXN-16892]]
 +
* [[RXN-17120]]
 +
* [[RXN-17121]]
 +
* [[RXN-2542]]
 +
* [[RXN-2562]]
 +
* [[RXN-2762]]
 +
* [[RXN-3422]]
 +
* [[RXN-4021]]
 +
* [[RXN-5141]]
 +
* [[RXN-7421]]
 +
* [[RXN-8675]]
 +
* [[RXN-9191]]
 +
* [[RXN-9205]]
 +
* [[RXN-9220]]
 +
* [[RXN-9225]]
 +
* [[RXN-9227]]
 +
* [[RXN-9229]]
 +
* [[RXN-9233]]
 +
* [[RXN-9235]]
 +
* [[RXN-9237]]
 +
* [[RXN-9240]]
 +
* [[RXN-9242]]
 +
* [[RXN-9280]]
 +
* [[RXN-9281]]
 +
* [[RXN-9282]]
 +
* [[RXN-9287]]
 +
* [[RXN-9361]]
 +
* [[RXN-9362]]
 +
* [[RXN-9363]]
 +
* [[RXN-9366]]
 +
* [[RXN-9679]]
 +
* [[RXN-9680]]
 +
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-5144]]
 +
* [[RXN0-5419]]
 +
* [[RXN0-6731]]
 +
* [[RXN0-6950]]
 +
* [[RXN1G-2544]]
 +
* [[RXN1G-3641]]
 +
* [[RXN3O-102]]
 +
* [[RXN3O-178]]
 +
* [[RXN3O-54]]
 +
* [[RXN4FS-2]]
 +
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
 +
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 +
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 +
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 +
* [[UROPORIIIMETHYLTRANSA-RXN]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=s-adenosyl-l-homocysteine}}
 +
{{#set: inchi-key=inchikey=zjuktbdsgofhsh-wfmpwkqpsa-n}}
 +
{{#set: molecular-weight=384.409}}

Revision as of 20:38, 18 December 2020

Metabolite ADENOSYL-HOMO-CYS

  • common-name:
    • s-adenosyl-l-homocysteine
  • smiles:
    • c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+]
  • inchi-key:
    • zjuktbdsgofhsh-wfmpwkqpsa-n
  • molecular-weight:
    • 384.409

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=XANTHOSINE-5-PHOSPHATE&oldid=48543"