Difference between revisions of "XANTHOSINE-5-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-TOLUENECARBOXYLATE == * common-name: ** 4-toluenecarboxylate * smiles: ** cc1(c=cc(=cc=1)c(=o)[o-]) * inchi-key: ** lpnbbfkouusudb-uhff...") |
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key:...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite XANTHOSINE-5-PHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** xmp |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dctlyfzhfgencw-uuokfmhzsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 362.192 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[GMP-SYN-GLUT-RXN]] | ||
+ | * [[GMP-SYN-NH3-RXN]] | ||
+ | * [[IMP-DEHYDROG-RXN]] | ||
+ | * [[X5NT]] | ||
+ | * [[XMPXAN-RXN]] | ||
+ | * [[XPPRT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[IMP-DEHYDROG-RXN]] |
+ | * [[NTPD]] | ||
+ | * [[RXN0-1603]] | ||
+ | * [[XPPRT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=xmp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=362.192}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite XANTHOSINE-5-PHOSPHATE
- common-name:
- xmp
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- dctlyfzhfgencw-uuokfmhzsa-l
- molecular-weight:
- 362.192