Difference between revisions of "XLFG-Xyloglucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDRPHENYLAC-CPD == * common-name: ** (4-hydroxyphenyl)acetaldehyde * smiles: ** [ch](=o)cc1(c=cc(o)=cc=1) * inchi-key: ** iprppfiavhpvjh...")
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE == * common-name: ** 2-carboxy-d-arabinitol 1-phosphate * smiles: ** c(c(c(c(cop([o-])([o-])=o)(c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDRPHENYLAC-CPD ==
+
== Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE ==
 
* common-name:
 
* common-name:
** (4-hydroxyphenyl)acetaldehyde
+
** 2-carboxy-d-arabinitol 1-phosphate
 
* smiles:
 
* smiles:
** [ch](=o)cc1(c=cc(o)=cc=1)
+
** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** iprppfiavhpvjh-uhfffaoysa-n
+
** ujtmirnfexkgms-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 136.15
+
** 273.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-4113]]
+
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5821]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4-hydroxyphenyl)acetaldehyde}}
+
{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
{{#set: inchi-key=inchikey=iprppfiavhpvjh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
{{#set: molecular-weight=136.15}}
+
{{#set: molecular-weight=273.113}}

Revision as of 18:52, 14 January 2021

Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE

  • common-name:
    • 2-carboxy-d-arabinitol 1-phosphate
  • smiles:
    • c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
  • inchi-key:
    • ujtmirnfexkgms-uhfffaoysa-k
  • molecular-weight:
    • 273.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality