Difference between revisions of "XTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13394 == * common-name: ** glycyl-l-glutamine * smiles: ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** pnmuaggsdzxthx-bypyzucns...") |
(Created page with "Category:metabolite == Metabolite XTP == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite XTP == |
* common-name: | * common-name: | ||
| − | ** | + | ** xtp |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** caefewvyezabla-uuokfmhzsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 520.136 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN0- | + | * [[NTPD]] |
| + | * [[RXN0-1603]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=xtp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=caefewvyezabla-uuokfmhzsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=520.136}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite XTP
- common-name:
- xtp
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- caefewvyezabla-uuokfmhzsa-j
- molecular-weight:
- 520.136
