Difference between revisions of "XTP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09580 == * transcription-direction: ** negative * right-end-position: ** 290407 * left-end-position: ** 267963 * centisome-position: ** 65.18068...") |
(Created page with "Category:metabolite == Metabolite XTP == * common-name: ** xtp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite XTP == |
− | * | + | * common-name: |
− | ** | + | ** xtp |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** caefewvyezabla-uuokfmhzsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 520.136 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[NTPD]] |
− | == Reaction(s) | + | * [[RXN0-1603]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=xtp}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=caefewvyezabla-uuokfmhzsa-j}} |
− | {{#set: | + | {{#set: molecular-weight=520.136}} |
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite XTP
- common-name:
- xtp
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
- inchi-key:
- caefewvyezabla-uuokfmhzsa-j
- molecular-weight:
- 520.136