Difference between revisions of "XYLOSE"

Revision as of 08:26, 15 March 2021

smiles:
- c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
common-name:
- chlorophyllide b
molecular-weight:
- 626.95

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-458 ==
+== Metabolite CPD-7014 ==
+* smiles:
+** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 * common-name:
-** galactinol
+** chlorophyllide b
-* smiles:
-** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o
-* inchi-key:
-** vcwmrqdbpzkxkg-xidcdeprsa-n
 * molecular-weight:
-** 342.299
+** 626.95
 == Reaction(s) known to consume the compound ==
-* [[2.4.1.67-RXN]]
+* [[RXN-7673]]
-* [[2.4.1.82-RXN]]
+* [[RXN-7674]]
-* [[RXN-8281]]
 == Reaction(s) known to produce the compound ==
-* [[2.4.1.123-RXN]]
+* [[RXN-13398]]
-* [[2.4.1.67-RXN]]
+* [[RXN-7673]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=galactinol}}
+{{#set: common-name=chlorophyllide b}}
-{{#set: inchi-key=inchikey=vcwmrqdbpzkxkg-xidcdeprsa-n}}
+{{#set: molecular-weight=626.95}}
-{{#set: molecular-weight=342.299}}