Difference between revisions of "XYLULOSE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed-CPD-3 ExchangeSeed-CPD-3] == * direction: ** reversible == Reaction formula == * 1.0 [...")
 
(Created page with "Category:metabolite == Metabolite XYLULOSE-5-PHOSPHATE == * common-name: ** d-xylulose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co * inchi-key: ** fnzlkvnu...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed-CPD-3 ExchangeSeed-CPD-3] ==
+
== Metabolite XYLULOSE-5-PHOSPHATE ==
* direction:
+
* common-name:
** reversible
+
** d-xylulose 5-phosphate
== Reaction formula ==
+
* smiles:
* 1.0 [[CPD-3]][C-BOUNDARY] '''<=>''' 1.0 [[CPD-3]][e]
+
** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co
== Gene(s) associated with this reaction  ==
+
* inchi-key:
== Pathway(s)  ==
+
** fnzlkvnuwiipsj-rfzpgflssa-l
== Reconstruction information  ==
+
* molecular-weight:
* category: [[manual]]; source: [[import_from_medium]]; tool: [[unknown-tool]]; comment: added to manage seeds from boundary to extracellular compartment
+
** 228.095
== External links  ==
+
== Reaction(s) known to consume the compound ==
{{#set: direction=reversible}}
+
* [[1TRANSKETO-RXN]]
{{#set: nb gene associated=0}}
+
* [[2TRANSKETO-RXN]]
{{#set: nb pathway associated=0}}
+
* [[RIBULP3EPIM-RXN]]
{{#set: reconstruction category=manual}}
+
== Reaction(s) known to produce the compound ==
{{#set: reconstruction tool=unknown-tool}}
+
* [[1TRANSKETO-RXN]]
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
+
* [[2TRANSKETO-RXN]]
{{#set: reconstruction source=import_from_medium}}
+
* [[RIBULP3EPIM-RXN]]
 +
* [[XYLULOKIN-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=d-xylulose 5-phosphate}}
 +
{{#set: inchi-key=inchikey=fnzlkvnuwiipsj-rfzpgflssa-l}}
 +
{{#set: molecular-weight=228.095}}

Latest revision as of 11:17, 18 March 2021

Metabolite XYLULOSE-5-PHOSPHATE

  • common-name:
    • d-xylulose 5-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c(o)c(o)c(=o)co
  • inchi-key:
    • fnzlkvnuwiipsj-rfzpgflssa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality