Difference between revisions of "ZN+2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYSTINE == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi-key: ** levwyrkdkasidu-imjsidkusa-n *...") |
(Created page with "Category:metabolite == Metabolite ZN+2 == * common-name: ** zn2+ * smiles: ** [zn++] * inchi-key: ** ptfcdoflopiggs-uhfffaoysa-n * molecular-weight: ** 65.38 == Reaction(s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ZN+2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** zn2+ |
* smiles: | * smiles: | ||
| − | ** | + | ** [zn++] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ptfcdoflopiggs-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 65.38 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-ZN+2]] |
| − | * [[ | + | * [[TransportSeed-ZN+2]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ExchangeSeed-ZN+2]] | ||
| + | * [[TransportSeed-ZN+2]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=zn2+}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ptfcdoflopiggs-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=65.38}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ZN+2
- common-name:
- zn2+
- smiles:
- [zn++]
- inchi-key:
- ptfcdoflopiggs-uhfffaoysa-n
- molecular-weight:
- 65.38
