Difference between revisions of "ZYMOSTEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...") |
(Created page with "Category:metabolite == Metabolite ZYMOSTEROL == * common-name: ** zymosterol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34)))) * inchi-key: **...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ZYMOSTEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** zymosterol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cgsjxlikvbjvry-xtgbijofsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 384.644 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3O-178]] |
| + | * [[RXN66-320]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-319]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=zymosterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cgsjxlikvbjvry-xtgbijofsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=384.644}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite ZYMOSTEROL
- common-name:
- zymosterol
- smiles:
- cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34))))
- inchi-key:
- cgsjxlikvbjvry-xtgbijofsa-n
- molecular-weight:
- 384.644
