User contributions
Jump to navigation
Jump to search
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)
- 10:28, 15 June 2021 (diff | hist) (+524) N CPD0-1812 (Created page with "Category:metabolite == Metabolite CPD0-1812 == * common-name: ** 2-oleoylglycerol * molecular-weight: ** 356.545 * smiles: ** ccccccccc=ccccccccc(=o)oc(co)co * inchi-key:...") (current)
- 10:28, 15 June 2021 (diff | hist) (+1,237) N FERRICYTOCHROME-B5 (Created page with "Category:metabolite == Metabolite FERRICYTOCHROME-B5 == * common-name: ** a ferricytochrome b5 == Reaction(s) known to consume the compound == * CYTOCHROME-B5-REDUCTASE-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+493) N INDOLE-3-GLYCOL (Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * molecular-weight: ** 177.202 * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)co) * inchi-ke...") (current)
- 10:28, 15 June 2021 (diff | hist) (+332) N His-tRNA-2-O-MeAdenosine4 (Created page with "Category:metabolite == Metabolite His-tRNA-2-O-MeAdenosine4 == * common-name: ** a 2'-o-methyladenosine4 in trnahis == Reaction(s) known to consume the compound == == Reac...") (current)
- 10:28, 15 June 2021 (diff | hist) (+590) N CPD-13855 (Created page with "Category:metabolite == Metabolite CPD-13855 == * common-name: ** n7-methylguanosine 5'-diphosphate * molecular-weight: ** 455.214 * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1...") (current)
- 10:28, 15 June 2021 (diff | hist) (+574) N DTDP-D-GLUCOSE (Created page with "Category:metabolite == Metabolite DTDP-D-GLUCOSE == * common-name: ** dtdp-α-d-glucose * molecular-weight: ** 562.317 * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop...") (current)
- 10:28, 15 June 2021 (diff | hist) (+336) N Acetyl-CoA-carboxylases (Created page with "Category:metabolite == Metabolite Acetyl-CoA-carboxylases == * common-name: ** an acetyl-coa carboxylase == Reaction(s) known to consume the compound == * [[2.7.11.27-RXN]...") (current)
- 10:28, 15 June 2021 (diff | hist) (+344) N Trans-delta2-lignoceroyl-ACPs (Created page with "Category:metabolite == Metabolite trans-delta2-lignoceroyl-ACPs == * common-name: ** a trans-tetracos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN...") (current)
- 10:28, 15 June 2021 (diff | hist) (+525) N CPD-4127 (Created page with "Category:metabolite == Metabolite CPD-4127 == * common-name: ** isofucosterol * molecular-weight: ** 412.698 * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+571) N CPD-14133 (Created page with "Category:metabolite == Metabolite CPD-14133 == * common-name: ** (r)-nadphx * molecular-weight: ** 759.41 * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+535) N MALTOTRIOSE (Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * molecular-weight: ** 504.441 * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+517) N CPD-7234 (Created page with "Category:metabolite == Metabolite CPD-7234 == * common-name: ** 8'-hydroxyabscisate * molecular-weight: ** 279.312 * smiles: ** cc(=cc([o-])=o)c=cc1(o)(c(co)(c)cc(=o)c=c(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+1,167) N UTP (Created page with "Category:metabolite == Metabolite UTP == * common-name: ** utp * molecular-weight: ** 480.112 * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+481) N ARACHIDIC ACID (Created page with "Category:metabolite == Metabolite ARACHIDIC_ACID == * common-name: ** arachidate * molecular-weight: ** 311.527 * smiles: ** cccccccccccccccccccc(=o)[o-] * inchi-key: ** v...") (current)
- 10:28, 15 June 2021 (diff | hist) (+630) N CPD1G-332 (Created page with "Category:metabolite == Metabolite CPD1G-332 == * common-name: ** 2-carboxy-cerotoyl-coa * molecular-weight: ** 1185.185 * smiles: ** ccccccccccccccccccccccccc(c([o-])=o)c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+548) N CPD-14154 (Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * molecular-weight: ** 472.558 * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+1,026) N UMP (Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * molecular-weight: ** 322.168 * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+602) N CPD-15656 (Created page with "Category:metabolite == Metabolite CPD-15656 == * common-name: ** (3e)-undec-2-enoyl-coa * molecular-weight: ** 929.765 * smiles: ** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+467) N CPD-665 (Created page with "Category:metabolite == Metabolite CPD-665 == * common-name: ** 1-propanal * molecular-weight: ** 58.08 * smiles: ** cc[ch]=o * inchi-key: ** nbbjymsmwiiqgu-uhfffaoysa-n ==...") (current)
- 10:28, 15 June 2021 (diff | hist) (+299) N Thiopurines (Created page with "Category:metabolite == Metabolite Thiopurines == * common-name: ** a thiopurine == Reaction(s) known to consume the compound == * THIOPURINE-S-METHYLTRANSFERASE-RXN ==...") (current)
- 10:28, 15 June 2021 (diff | hist) (+773) N 3-METHYL-CROTONYL-COA (Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * molecular-weight: ** 845.604 * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+342) N Protein-Tyrosines (Created page with "Category:metabolite == Metabolite Protein-Tyrosines == * common-name: ** a [protein]-l-tyrosine == Reaction(s) known to consume the compound == * 2.7.10.1-RXN == React...") (current)
- 10:28, 15 June 2021 (diff | hist) (+508) N CPD-7649 (Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * molecular-weight: ** 233.239 * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+358) N 2E-7Z-hexadeca-2-7-dienoyl-ACPs (Created page with "Category:metabolite == Metabolite 2E-7Z-hexadeca-2-7-dienoyl-ACPs == * common-name: ** a (2e,7z)-hexadeca-2,7-dienoyl-[acp] == Reaction(s) known to consume the compound ==...") (current)
- 10:28, 15 June 2021 (diff | hist) (+624) N CPD-8082 (Created page with "Category:metabolite == Metabolite CPD-8082 == * common-name: ** 1-18:2-2-18:2-digalactosyldiacylglycerol * molecular-weight: ** 941.247 * smiles: ** cccccc=ccc=ccccccccc(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+379) N Poly-Gamma-Glutamylcysteine-Glycines (Created page with "Category:metabolite == Metabolite Poly-Gamma-Glutamylcysteine-Glycines == * common-name: ** a poly-[γ-glutamylcysteine]-glycine == Reaction(s) known to consume the c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+499) N CPD-13395 (Created page with "Category:metabolite == Metabolite CPD-13395 == * common-name: ** glycyl-l-asparagine * molecular-weight: ** 189.171 * smiles: ** c([n+])c(=o)nc(cc(n)=o)c([o-])=o * inchi-k...") (current)
- 10:28, 15 June 2021 (diff | hist) (+751) N 2-METHYL-ACETO-ACETYL-COA (Created page with "Category:metabolite == Metabolite 2-METHYL-ACETO-ACETYL-COA == * common-name: ** 2-methylacetoacetyl-coa * molecular-weight: ** 861.604 * smiles: ** cc(c(sccnc(=o)ccnc(=o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+680) N NA+ (Created page with "Category:metabolite == Metabolite NA+ == * common-name: ** na+ * molecular-weight: ** 22.99 * smiles: ** [na+] * inchi-key: ** fknqfgjonoiptf-uhfffaoysa-n == Reaction(s) k...") (current)
- 10:28, 15 June 2021 (diff | hist) (+554) N MEVALONATE (Created page with "Category:metabolite == Metabolite MEVALONATE == * common-name: ** (r)-mevalonate * molecular-weight: ** 147.15 * smiles: ** cc(o)(cco)cc(=o)[o-] * inchi-key: ** kjtlqquupv...") (current)
- 10:28, 15 June 2021 (diff | hist) (+705) N P-COUMAROYL-COA (Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * molecular-weight: ** 909.648 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+627) N D-RIBULOSE-15-P2 (Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * molecular-weight: ** 306.059 * smiles: ** c(op([o-])([o-])=o)c(o)c(o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+604) N CPD-11398 (Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * molecular-weight: ** 951.992 * smiles: ** c(=o)([o-])c([n+])cc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+357) N Dipeptides-With-Proline-Carboxy (Created page with "Category:metabolite == Metabolite Dipeptides-With-Proline-Carboxy == * common-name: ** a dipeptide with proline at the c-terminal == Reaction(s) known to consume the compo...") (current)
- 10:28, 15 June 2021 (diff | hist) (+772) N GLUTARYL-COA (Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * molecular-weight: ** 876.595 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+590) N D-MYO-INOSITOL-34-BISPHOSPHATE (Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == * common-name: ** d-myo-inositol (3,4)-bisphosphate * molecular-weight: ** 336.085 * smiles: ** c1(o)(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+312) N Oleoyl-ACPs (Created page with "Category:metabolite == Metabolite Oleoyl-ACPs == * common-name: ** an oleoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16077 * RXN-16629 == React...") (current)
- 10:28, 15 June 2021 (diff | hist) (+508) N CPD0-1107 (Created page with "Category:metabolite == Metabolite CPD0-1107 == * common-name: ** β-l-fucopyranose * molecular-weight: ** 164.158 * smiles: ** cc1(oc(c(c(c1o)o)o)o) * inchi-key: ** sh...") (current)
- 10:28, 15 June 2021 (diff | hist) (+588) N CPD1F-97 (Created page with "Category:metabolite == Metabolite CPD1F-97 == * common-name: ** gibberellin a15 (open lactone form) * molecular-weight: ** 346.422 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+556) N CPD0-2152 (Created page with "Category:metabolite == Metabolite CPD0-2152 == * common-name: ** 1-18:0-2-lysophosphatidylethanolamine * molecular-weight: ** 481.608 * smiles: ** cccccccccccccccccc(occ(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+717) N P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE (Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * molecular-weight:...") (current)
- 10:28, 15 June 2021 (diff | hist) (+582) N CPD-18550 (Created page with "Category:metabolite == Metabolite CPD-18550 == * common-name: ** quinoxaline-2-carboxyl adenylate * molecular-weight: ** 502.359 * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+572) N CPD-323 (Created page with "Category:metabolite == Metabolite CPD-323 == * common-name: ** cholest-4-en-3-one * molecular-weight: ** 384.644 * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+578) N CPDQT-4 (Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * molecular-weight: ** 258.121 * smiles: ** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-...") (current)
- 10:27, 15 June 2021 (diff | hist) (+362) N METHIONINE-SYNTHASE-METHYLCOBALAMIN (Created page with "Category:metabolite == Metabolite METHIONINE-SYNTHASE-METHYLCOBALAMIN == * common-name: ** a [methionine synthase]-methylcob(i)alamin == Reaction(s) known to consume the c...") (current)
- 10:27, 15 June 2021 (diff | hist) (+336) N Protein-phospho-L-histidines (Created page with "Category:metabolite == Metabolite Protein-phospho-L-histidines == * common-name: ** a [protein]-n-phospho-l-histidine == Reaction(s) known to consume the compound == == Re...") (current)
- 10:27, 15 June 2021 (diff | hist) (+539) N CPD-597 (Created page with "Category:metabolite == Metabolite CPD-597 == * common-name: ** n-carbamoylputrescine * molecular-weight: ** 132.185 * smiles: ** c(cccnc(n)=o)[n+] * inchi-key: ** yanfyyga...") (current)
- 10:27, 15 June 2021 (diff | hist) (+552) N CPD-15036 (Created page with "Category:metabolite == Metabolite CPD-15036 == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * molecular-weight: ** 254.168 * smiles: ** c(=o)c(os([o-])(=o)=...") (current)
- 10:27, 15 June 2021 (diff | hist) (+306) N CPD-17284 (Created page with "Category:metabolite == Metabolite CPD-17284 == * common-name: ** a [glycerolipid]-arachidonate == Reaction(s) known to consume the compound == * RXN-12755 == Reaction(...") (current)
- 10:27, 15 June 2021 (diff | hist) (+669) N GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core (Created page with "Category:metabolite == Metabolite GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core == * common-name: ** a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-&alph...") (current)
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)