User contributions
Jump to navigation
Jump to search
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)
- 10:28, 15 June 2021 (diff | hist) (+448) N Alkyl-acetyl-glycero-phosphocholines (Created page with "Category:metabolite == Metabolite Alkyl-acetyl-glycero-phosphocholines == * common-name: ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume...") (current)
- 10:28, 15 June 2021 (diff | hist) (+685) N CPD-18346 (Created page with "Category:metabolite == Metabolite CPD-18346 == * common-name: ** cis-vaccenoyl-coa * molecular-weight: ** 1027.953 * smiles: ** ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+542) N BENZALDEHYDE (Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * molecular-weight: ** 106.124 * smiles: ** c(=o)c1(=cc=cc=c1) * inchi-key: ** humnylrzrpp...") (current)
- 10:28, 15 June 2021 (diff | hist) (+10,094) N ATP (Created page with "Category:metabolite == Metabolite ATP == * common-name: ** atp * molecular-weight: ** 503.152 * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])op(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+732) N TRP (Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * molecular-weight: ** 204.228 * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+290) N Beta-Lactams (Created page with "Category:metabolite == Metabolite Beta-Lactams == * common-name: ** a β-lactam == Reaction(s) known to consume the compound == * BETA-LACTAMASE-RXN == Reaction(s)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+526) N CPD-14123 (Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * molecular-weight: ** 162.165 * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+587) N CPD-18666 (Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * molecular-weight: ** 606.677 * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+660) N CPD-13004 (Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * molecular-weight: ** 1296.491 * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+287) N PHE-tRNAs (Created page with "Category:metabolite == Metabolite PHE-tRNAs == * common-name: ** a trnaphe == Reaction(s) known to consume the compound == * PHENYLALANINE--TRNA-LIGASE-RXN == Reaction...") (current)
- 10:28, 15 June 2021 (diff | hist) (+358) N L-arginyl-L-Glutamyl-Peptides (Created page with "Category:metabolite == Metabolite L-arginyl-L-Glutamyl-Peptides == * common-name: ** an n-terminal l-arginiyl-l-glutamyl-[protein] == Reaction(s) known to consume the comp...") (current)
- 10:28, 15 June 2021 (diff | hist) (+676) N CPD0-2123 (Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * molecular-weight: ** 931.738 * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+43,945) N PROTON (Created page with "Category:metabolite == Metabolite PROTON == * common-name: ** h+ * molecular-weight: ** 1.008 * smiles: ** [h+] * inchi-key: ** gprlsgonyqirfk-uhfffaoysa-n == Reaction(s)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+612) N CPD-9090 (Created page with "Category:metabolite == Metabolite CPD-9090 == * common-name: ** phyta-2,14-dienyl bacteriochlorophyllide a * molecular-weight: ** 908.494 * smiles: ** ccc5(c(c)c9(n6([mg]2...") (current)
- 10:28, 15 June 2021 (diff | hist) (+328) N Charged-TRP-tRNAs (Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...") (current)
- 10:28, 15 June 2021 (diff | hist) (+536) N ENT-KAUR-16-EN-19-OL (Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-OL == * common-name: ** ent-kaurenol * molecular-weight: ** 288.472 * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+518) N CPD-257 (Created page with "Category:metabolite == Metabolite CPD-257 == * common-name: ** 4-sulfobenzoate * molecular-weight: ** 200.166 * smiles: ** c([o-])(=o)c1(c=cc(=cc=1)s([o-])(=o)=o) * inchi-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+621) N CPD-8089 (Created page with "Category:metabolite == Metabolite CPD-8089 == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * molecular-weight: ** 782.092 * smiles: ** ccc=ccc=ccc=c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+332) N CPD-17404 (Created page with "Category:metabolite == Metabolite CPD-17404 == * common-name: ** a [glycerolipid]-(11z)-eicosenoate == Reaction(s) known to consume the compound == * RXN-16158 == Reac...") (current)
- 10:28, 15 June 2021 (diff | hist) (+511) N CPD-8120 (Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * molecular-weight: ** 305.479 * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * in...") (current)
- 10:28, 15 June 2021 (diff | hist) (+505) N CPD-471 (Created page with "Category:metabolite == Metabolite CPD-471 == * common-name: ** (r)-3-amino-2-methylpropanoate * molecular-weight: ** 103.121 * smiles: ** cc(c[n+])c([o-])=o * inchi-key: *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+522) N CPD-591 (Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * molecular-weight: ** 285.232 * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+599) N NITRIC-OXIDE (Created page with "Category:metabolite == Metabolite NITRIC-OXIDE == * common-name: ** nitric oxide * molecular-weight: ** 30.006 * smiles: ** n=o * inchi-key: ** mwuxshhqayifbg-uhfffaoysa-n...") (current)
- 10:28, 15 June 2021 (diff | hist) (+298) N CYS-tRNAs (Created page with "Category:metabolite == Metabolite CYS-tRNAs == * common-name: ** a trnacys == Reaction(s) known to consume the compound == * CYSTEINE--TRNA-LIGASE-RXN == Reaction(s) k...") (current)
- 10:28, 15 June 2021 (diff | hist) (+605) N CPD-8163 (Created page with "Category:metabolite == Metabolite CPD-8163 == * common-name: ** 1-16:0-2-18:2-digalactosyldiacylglycerol * molecular-weight: ** 917.225 * smiles: ** cccccc=ccc=ccccccccc(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+634) N CPD-10809 (Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * molecular-weight: ** 353.228 * smiles: ** c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+514) N SN-GLYCEROL-1-PHOSPHATE (Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * molecular-weight: ** 170.058 * smiles: ** c(op([o-])(=o)[o-])c(o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+339) N R-3-hydroxycerotoyl-ACPs (Created page with "Category:metabolite == Metabolite R-3-hydroxycerotoyl-ACPs == * common-name: ** a (3r)-3-hydroxycerotoyl-[acp] == Reaction(s) known to consume the compound == * RXN-1006...") (current)
- 10:28, 15 June 2021 (diff | hist) (+698) N SIROHYDROCHLORIN (Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * molecular-weight: ** 854.779 * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+341) N MRNA-Containing-N1-Methyladenine (Created page with "Category:metabolite == Metabolite mRNA-Containing-N1-Methyladenine == * common-name: ** an n1-methyladenine in mrna == Reaction(s) known to consume the compound == * RXN...") (current)
- 10:28, 15 June 2021 (diff | hist) (+343) N Saturated-2-Lysophosphatidates (Created page with "Category:metabolite == Metabolite Saturated-2-Lysophosphatidates == * common-name: ** a 2,3,4-saturated 2-lysophosphatidate == Reaction(s) known to consume the compound ==...") (current)
- 10:28, 15 June 2021 (diff | hist) (+419) N 5-Phospho-terminated-DNAs (Created page with "Category:metabolite == Metabolite 5-Phospho-terminated-DNAs == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * [[DNA-LIGASE-ATP-RXN]...") (current)
- 10:28, 15 June 2021 (diff | hist) (+681) N CPD-11517 (Created page with "Category:metabolite == Metabolite CPD-11517 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa * molecular-weight: ** 1039.92 * smiles: ** ccc=ccc1...") (current)
- 10:28, 15 June 2021 (diff | hist) (+606) N CPD-8162 (Created page with "Category:metabolite == Metabolite CPD-8162 == * common-name: ** 1-18:3-2-16:0-digalactosyldiacylglycerol * molecular-weight: ** 915.209 * smiles: ** ccc=ccc=ccc=ccccccccc(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+320) N 2-hydroxyacyl-glutathiones (Created page with "Category:metabolite == Metabolite 2-hydroxyacyl-glutathiones == * common-name: ** s-(2-hydroxyacyl)glutathione == Reaction(s) known to consume the compound == * RXN-7919...") (current)
- 10:28, 15 June 2021 (diff | hist) (+417) N Beta-L-arabinosides (Created page with "Category:metabolite == Metabolite Beta-L-arabinosides == * common-name: ** an oligosaccharide with β-l-arabinopyranose at the non-reducing end == Reaction(s) known to...") (current)
- 10:28, 15 June 2021 (diff | hist) (+580) N BENZOYLCOA (Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * molecular-weight: ** 867.61 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+567) N CPD-193 (Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * molecular-weight: ** 336.085 * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+655) N CPD0-2117 (Created page with "Category:metabolite == Metabolite CPD0-2117 == * common-name: ** trans-hexadec-2-enoyl-coa * molecular-weight: ** 999.899 * smiles: ** cccccccccccccc=cc(=o)sccnc(=o)ccnc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+371) N 2-Me-Branched-234-Sat-FA (Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-FA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound...") (current)
- 10:28, 15 June 2021 (diff | hist) (+265) N RX (Created page with "Category:metabolite == Metabolite RX == * common-name: ** rx * smiles: ** [r]x == Reaction(s) known to consume the compound == * GSHTRAN-RXN == Reaction(s) known to pr...") (current)
- 10:28, 15 June 2021 (diff | hist) (+273) N D-Hexoses (Created page with "Category:metabolite == Metabolite D-Hexoses == * common-name: ** a d-hexose == Reaction(s) known to consume the compound == * HEXOKINASE-RXN == Reaction(s) known to pr...") (current)
- 10:28, 15 June 2021 (diff | hist) (+722) N Ox-Thioredoxin (Created page with "Category:metabolite == Metabolite Ox-Thioredoxin == * common-name: ** an oxidized thioredoxin == Reaction(s) known to consume the compound == * 1.8.4.12-RXN * 1.8.4....") (current)
- 10:28, 15 June 2021 (diff | hist) (+316) N N-Acetyl-Peptides (Created page with "Category:metabolite == Metabolite N-Acetyl-Peptides == * common-name: ** an n-acylated peptide == Reaction(s) known to consume the compound == * ACYLAMINOACYL-PEPTIDASE-...") (current)
- 10:27, 15 June 2021 (diff | hist) (+583) N CPD-11412 (Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * molecular-weight: ** 797.054 * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o...") (current)
- 10:27, 15 June 2021 (diff | hist) (+279) N ALLO-THR (Created page with "Category:metabolite == Metabolite ALLO-THR == * common-name: ** dl-allothreonine == Reaction(s) known to consume the compound == * RXN0-5234 == Reaction(s) known to pr...") (current)
- 10:27, 15 June 2021 (diff | hist) (+280) N Drugs (Created page with "Category:metabolite == Metabolite Drugs == * common-name: ** a drug == Reaction(s) known to consume the compound == * TRANS-RXN-311 == Reaction(s) known to produce the...") (current)
- 10:27, 15 June 2021 (diff | hist) (+641) N THIAMINE (Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * molecular-weight: ** 265.352 * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key...") (current)
- 10:27, 15 June 2021 (diff | hist) (+535) N CPD-9955 (Created page with "Category:metabolite == Metabolite CPD-9955 == * common-name: ** ubiquinol-7 * molecular-weight: ** 661.019 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") (current)
- 10:27, 15 June 2021 (diff | hist) (+350) N 2-Acyl-sn-glycerol-3-phosphates (Created page with "Category:metabolite == Metabolite 2-Acyl-sn-glycerol-3-phosphates == * common-name: ** a 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * [...") (current)
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)