User contributions
Jump to navigation
Jump to search
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)
- 10:27, 15 June 2021 (diff | hist) (+294) N Uridine32-in-tRNA (Created page with "Category:metabolite == Metabolite Uridine32-in-tRNA == * common-name: ** a uridine32 in trna == Reaction(s) known to consume the compound == * RXN-11842 == Reaction(s)...") (current)
- 10:27, 15 June 2021 (diff | hist) (+637) N OROTIDINE-5-PHOSPHATE (Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * molecular-weight: ** 365.17 * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o...") (current)
- 10:27, 15 June 2021 (diff | hist) (+994) N HOMO-CYS (Created page with "Category:metabolite == Metabolite HOMO-CYS == * common-name: ** l-homocysteine * molecular-weight: ** 135.181 * smiles: ** c(c(ccs)[n+])(=o)[o-] * inchi-key: ** fffhzydwpb...") (current)
- 10:27, 15 June 2021 (diff | hist) (+793) N CPD-7243 (Created page with "Category:metabolite == Metabolite CPD-7243 == * common-name: ** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa * molecular-weight: ** 1194.129 *...") (current)
- 10:27, 15 June 2021 (diff | hist) (+672) N CPD-506 (Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * molecular-weight: ** 492.013 * smiles: ** c1(o)(c(op([o-])(=o)[...") (current)
- 10:27, 15 June 2021 (diff | hist) (+557) N CPD-560 (Created page with "Category:metabolite == Metabolite CPD-560 == * common-name: ** s-methyl-5-thio-d-ribose * molecular-weight: ** 180.218 * smiles: ** cscc1(oc(c(c1o)o)o) * inchi-key: ** olv...") (current)
- 10:27, 15 June 2021 (diff | hist) (+599) N CPD-9866 (Created page with "Category:metabolite == Metabolite CPD-9866 == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * molecular-weight: ** 737.203 * smiles: ** cc(=cccc(=cccc(=cccc(=...") (current)
- 10:27, 15 June 2021 (diff | hist) (+622) N CPD-15676 (Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * molecular-weight: ** 971.802 * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)c...") (current)
- 10:27, 15 June 2021 (diff | hist) (+351) N Nonmethylated-Ribosomal-Protein-L11s (Created page with "Category:metabolite == Metabolite Nonmethylated-Ribosomal-Protein-L11s == * common-name: ** a non-methylated ribosomal protein l11 == Reaction(s) known to consume the comp...") (current)
- 10:27, 15 June 2021 (diff | hist) (+324) N 23S-rRNA-pseudouridine746 (Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine746 == * common-name: ** a pseudouridine746 in 23s rrna == Reaction(s) known to consume the compound == == Reaction...") (current)
- 10:27, 15 June 2021 (diff | hist) (+620) N 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP (Created page with "Category:metabolite == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == * common-name: ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate * molecular-weigh...") (current)
- 10:27, 15 June 2021 (diff | hist) (+487) N 4-METHYL-MYO-INOSITOL (Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * molecular-weight: ** 194.184 * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key...") (current)
- 10:27, 15 June 2021 (diff | hist) (+606) N Cytochromes-C-Reduced (Created page with "Category:metabolite == Metabolite Cytochromes-C-Reduced == * common-name: ** a reduced c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RXN...") (current)
- 10:27, 15 June 2021 (diff | hist) (+818) N DEOXY-D-RIBOSE-1-PHOSPHATE (Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * molecular-weight: ** 212.096 * smiles: ** c1(c(o)c...") (current)
- 10:27, 15 June 2021 (diff | hist) (+495) N CPD-9152 (Created page with "Category:metabolite == Metabolite CPD-9152 == * common-name: ** 4-chlorocatechol * molecular-weight: ** 144.557 * smiles: ** c1(c=c(c(=cc=1cl)o)o) * inchi-key: ** wwobypku...") (current)
- 10:27, 15 June 2021 (diff | hist) (+732) N CDP (Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * molecular-weight: ** 400.155 * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-]...") (current)
- 10:27, 15 June 2021 (diff | hist) (+509) N CPD-14873 (Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * molecular-weight: ** 152.129 * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inc...") (current)
- 10:27, 15 June 2021 (diff | hist) (+315) N Reduced-Rubredoxins (Created page with "Category:metabolite == Metabolite Reduced-Rubredoxins == * common-name: ** a reduced rubredoxin == Reaction(s) known to consume the compound == * ALKANE-1-MONOOXYGENASE-...") (current)
- 10:27, 15 June 2021 (diff | hist) (+502) N Ceramides (Created page with "Category:metabolite == Metabolite Ceramides == * common-name: ** a ceramide == Reaction(s) known to consume the compound == * 2.7.8.27-RXN * CERAMIDE-CHOLINEPHOSPHOT...") (current)
- 10:27, 15 June 2021 (diff | hist) (+1,345) N MET (Created page with "Category:metabolite == Metabolite MET == * common-name: ** l-methionine * molecular-weight: ** 149.207 * smiles: ** csccc([n+])c([o-])=o * inchi-key: ** ffearjckvfrzrr-byp...") (current)
- 10:27, 15 June 2021 (diff | hist) (+355) N 5-2-me-oxy-2-oxo-et-ur-34-tRNA (Created page with "Category:metabolite == Metabolite 5-2-me-oxy-2-oxo-et-ur-34-tRNA == * common-name: ** a 5-(2-methoxy-2-oxoethyl)uridine34 in trna == Reaction(s) known to consume the compo...") (current)
- 10:27, 15 June 2021 (diff | hist) (+327) N TRNAs-with-queuine (Created page with "Category:metabolite == Metabolite tRNAs-with-queuine == * common-name: ** a queuosine34 in trna == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") (current)
- 10:27, 15 June 2021 (diff | hist) (+357) N 23S-rRNA-pseudouridine1911-1915-1917 (Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine1911-1915-1917 == * common-name: ** a pseudouridine1911/1915/1917 in 23s rrna == Reaction(s) known to consume the c...") (current)
- 10:27, 15 June 2021 (diff | hist) (+642) N CPD0-1162 (Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * molecular-weight: ** 969.83 * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o...") (current)
- 10:27, 15 June 2021 (diff | hist) (+684) N 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON (Created page with "Category:metabolite == Metabolite 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON == * common-name: ** 4α-methyl-5α-cholest-7-en-3-one * molecular-weight: ** 398.671...") (current)
- 10:27, 15 June 2021 (diff | hist) (+364) N N-ACETYL-D-GLUCOSAMINE-16-BIS-P (Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P == * common-name: ** n-acetyl-d-glucosamine 1,6-bisphosphate == Reaction(s) known to consume the compound...") (current)
- 10:27, 15 June 2021 (diff | hist) (+526) N PWY-5081 (Created page with "Category:pathway == Pathway PWY-5081 == * common-name: ** l-tryptophan degradation viii (to tryptophol) * taxonomic-range: ** tax-4751 == Reaction(s) found == * TRYPTOPH...") (current)
- 10:27, 15 June 2021 (diff | hist) (+397) N PWY-5 (Created page with "Category:pathway == Pathway PWY-5 == * common-name: ** canavanine biosynthesis * taxonomic-range: ** tax-3803 == Reaction(s) found == * RXN-10 * RXN-22 * RXN-9...") (current)
- 10:27, 15 June 2021 (diff | hist) (+415) N PWY-6104 (Created page with "Category:pathway == Pathway PWY-6104 == * common-name: ** 3-chlorotoluene degradation ii * taxonomic-range: ** tax-2 == Reaction(s) found == * RXN-9910 == Reaction(s)...") (current)
- 10:27, 15 June 2021 (diff | hist) (+500) N PWY-3341 (Created page with "Category:pathway == Pathway PWY-3341 == * common-name: ** l-proline biosynthesis iii * taxonomic-range: ** tax-33090 == Reaction(s) found == * GLUTKIN-RXN * GLUTSEMI...") (current)
- 10:27, 15 June 2021 (diff | hist) (+400) N PWYDQC-4 (Created page with "Category:pathway == Pathway PWYDQC-4 == * common-name: ** indole-3-acetate biosynthesis i * taxonomic-range: ** tax-33090 == Reaction(s) found == * RXNDQC-2 == Reactio...") (current)
- 10:27, 15 June 2021 (diff | hist) (+970) N PWY-1121 (Created page with "Category:pathway == Pathway PWY-1121 == * common-name: ** suberin monomers biosynthesis * taxonomic-range: ** tax-58023 == Reaction(s) found == * 6.2.1.34-RXN * CAFF...") (current)
- 10:27, 15 June 2021 (diff | hist) (+467) N PWY-5738 (Created page with "Category:pathway == Pathway PWY-5738 == * common-name: ** gdp-6-deoxy-d-talose biosynthesis * taxonomic-range: ** tax-2 == Reaction(s) found == * GDPMANDEHYDRA-RXN ==...") (current)
- 10:27, 15 June 2021 (diff | hist) (+571) N TRIGLSYN-PWY (Created page with "Category:pathway == Pathway TRIGLSYN-PWY == * common-name: ** diacylglycerol and triacylglycerol biosynthesis * taxonomic-range: ** tax-2759 == Reaction(s) found == * DI...") (current)
- 10:27, 15 June 2021 (diff | hist) (+531) N PWY-5941 (Created page with "Category:pathway == Pathway PWY-5941 == * common-name: ** glycogen degradation ii * taxonomic-range: ** tax-2157 ** tax-2 ** tax-33154 == Reaction(s) found == * GLYCOPHO...") (current)
- 10:27, 15 June 2021 (diff | hist) (+410) N P641-PWY (Created page with "Category:pathway == Pathway P641-PWY == * common-name: ** phenylmercury acetate degradation * taxonomic-range: ** tax-2 == Reaction(s) found == * MERCURY-II-REDUCTASE-RX...") (current)
- 10:27, 15 June 2021 (diff | hist) (+523) N ARGININE-SYN4-PWY (Created page with "Category:pathway == Pathway ARGININE-SYN4-PWY == * common-name: ** l-ornithine biosynthesis ii * taxonomic-range: ** tax-33208 == Reaction(s) found == * GLUTKIN-RXN *...") (current)
- 10:27, 15 June 2021 (diff | hist) (+417) N PWY-6343 (Created page with "Category:pathway == Pathway PWY-6343 == * common-name: ** ferulate degradation * taxonomic-range: ** tax-2 == Reaction(s) found == * 6.2.1.34-RXN == Reaction(s) not fo...") (current)
- 10:27, 15 June 2021 (diff | hist) (+582) N PWY-5316 (Created page with "Category:pathway == Pathway PWY-5316 == * common-name: ** nicotine biosynthesis * taxonomic-range: ** tax-4070 == Reaction(s) found == * L-ASPARTATE-OXID-RXN * QUINO...") (current)
- 10:27, 15 June 2021 (diff | hist) (+441) N PWY-1881 (Created page with "Category:pathway == Pathway PWY-1881 == * common-name: ** formate oxidation to co2 * taxonomic-range: ** tax-2157 ** tax-4751 ** tax-2 == Reaction(s) found == * 1.2.1.2-...") (current)
- 10:27, 15 June 2021 (diff | hist) (+587) N PANTO-PWY (Created page with "Category:pathway == Pathway PANTO-PWY == * common-name: ** phosphopantothenate biosynthesis i * taxonomic-range: ** tax-4751 ** tax-33090 ** tax-2 == Reaction(s) found ==...") (current)
- 10:27, 15 June 2021 (diff | hist) (+572) N PWY-7517 (Created page with "Category:pathway == Pathway PWY-7517 == * common-name: ** brassicicene c biosynthesis * taxonomic-range: ** tax-4890 ** tax-4751 == Reaction(s) found == * FARNESYLTRANST...") (current)
- 10:27, 15 June 2021 (diff | hist) (+737) N PWY-6969 (Created page with "Category:pathway == Pathway PWY-6969 == * common-name: ** tca cycle v (2-oxoglutarate:ferredoxin oxidoreductase) * taxonomic-range: ** tax-1117 ** tax-3035 ** tax-1224 **...") (current)
- 10:27, 15 June 2021 (diff | hist) (+616) N PWY-6901 (Created page with "Category:pathway == Pathway PWY-6901 == * common-name: ** superpathway of glucose and xylose degradation * taxonomic-range: ** tax-2 == Reaction(s) found == * 2PGADEHYDR...") (current)
- 10:27, 15 June 2021 (diff | hist) (+545) N GLYCOCAT-PWY (Created page with "Category:pathway == Pathway GLYCOCAT-PWY == * common-name: ** glycogen degradation i * taxonomic-range: ** tax-2 == Reaction(s) found == * GLUCOKIN-RXN * GLYCOPHOSPH...") (current)
- 10:27, 15 June 2021 (diff | hist) (+593) N PWY-7659 (Created page with "Category:pathway == Pathway PWY-7659 == * common-name: ** viridicatumtoxin biosynthesis * taxonomic-range: ** tax-4751 == Reaction(s) found == * GPPSYN-RXN == Reaction...") (current)
- 10:27, 15 June 2021 (diff | hist) (+494) N PEPTIDOGLYCANSYN-PWY (Created page with "Category:pathway == Pathway PEPTIDOGLYCANSYN-PWY == * common-name: ** peptidoglycan biosynthesis i (meso-diaminopimelate containing) * taxonomic-range: ** tax-2 == Reactio...") (current)
- 10:27, 15 June 2021 (diff | hist) (+425) N PWY-3621 (Created page with "Category:pathway == Pathway PWY-3621 == * common-name: ** γ-butyrobetaine degradation * taxonomic-range: ** tax-1224 == Reaction(s) found == * 1.14.11.1-RXN == R...") (current)
- 10:27, 15 June 2021 (diff | hist) (+446) N PWY-7285 (Created page with "Category:pathway == Pathway PWY-7285 == * common-name: ** methylwyosine biosynthesis * taxonomic-range: ** tax-2157 == Reaction(s) found == * RXN-14517 == Reaction(s)...") (current)
- 10:27, 15 June 2021 (diff | hist) (+405) N PWY-7752 (Created page with "Category:pathway == Pathway PWY-7752 == * common-name: ** gadusol biosynthesis * taxonomic-range: ** tax-7742 == Reaction(s) found == * RXN-9140 == Reaction(s) not fou...") (current)
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)