User contributions
Jump to navigation
Jump to search
(newest | oldest) View (newer 500 | older 500) (20 | 50 | 100 | 250 | 500)
- 10:32, 15 June 2021 (diff | hist) (+502) N CPD-8052 (Created page with "Category:metabolite == Metabolite CPD-8052 == * common-name: ** 1d-chiro-inositol * molecular-weight: ** 180.157 * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdai...") (current)
- 10:32, 15 June 2021 (diff | hist) (+543) N GLUCONATE (Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * molecular-weight: ** 195.149 * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghn...") (current)
- 10:32, 15 June 2021 (diff | hist) (+559) N LANOSTEROL (Created page with "Category:metabolite == Metabolite LANOSTEROL == * common-name: ** lanosterol * molecular-weight: ** 426.724 * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(c)(cc1)c4(=c(cc2)c3([ch](...") (current)
- 10:32, 15 June 2021 (diff | hist) (+339) N S-Substituted-Glutathione (Created page with "Category:metabolite == Metabolite S-Substituted-Glutathione == * common-name: ** a glutathione-toxin conjugate == Reaction(s) known to consume the compound == * RXN-6641...") (current)
- 10:32, 15 June 2021 (diff | hist) (+347) N Apo-EntB (Created page with "Category:metabolite == Metabolite Apo-EntB == * common-name: ** an apo-[entb isochorismatase/aryl-carrier protein] == Reaction(s) known to consume the compound == * ENTD...") (current)
- 10:32, 15 June 2021 (diff | hist) (+289) N Polysaccharides (Created page with "Category:metabolite == Metabolite Polysaccharides == * common-name: ** a polysaccharide == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...") (current)
- 10:32, 15 June 2021 (diff | hist) (+516) N CPD-14270 (Created page with "Category:metabolite == Metabolite CPD-14270 == * common-name: ** dodecyl icosanoate * molecular-weight: ** 480.856 * smiles: ** cccccccccccccccccccc(occcccccccccc)=o * inc...") (current)
- 10:32, 15 June 2021 (diff | hist) (+525) N FMNH2 (Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * molecular-weight: ** 456.348 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])...") (current)
- 10:32, 15 June 2021 (diff | hist) (+549) N CGMP (Created page with "Category:metabolite == Metabolite CGMP == * common-name: ** cyclic-gmp * molecular-weight: ** 344.2 * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[...") (current)
- 10:32, 15 June 2021 (diff | hist) (+768) N CPD-13757 (Created page with "Category:metabolite == Metabolite CPD-13757 == * common-name: ** 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-hydroxypropanoyl-coa * molecular-w...") (current)
- 10:32, 15 June 2021 (diff | hist) (+556) N CPD-6082 (Created page with "Category:metabolite == Metabolite CPD-6082 == * common-name: ** 3-aminopropanal * molecular-weight: ** 74.102 * smiles: ** c(cc[n+])=o * inchi-key: ** pcxdjqzlddhmgx-uhfff...") (current)
- 10:32, 15 June 2021 (diff | hist) (+487) N AMINO-ACETONE (Created page with "Category:metabolite == Metabolite AMINO-ACETONE == * common-name: ** aminoacetone * molecular-weight: ** 74.102 * smiles: ** cc(c[n+])=o * inchi-key: ** bcdgqxumwhrqcb-uhf...") (current)
- 10:32, 15 June 2021 (diff | hist) (+1,221) N Acceptor (Created page with "Category:metabolite == Metabolite Acceptor == * common-name: ** an oxidized electron acceptor == Reaction(s) known to consume the compound == * 2-HYDROXYGLUTARATE-DEHYDR...") (current)
- 10:32, 15 June 2021 (diff | hist) (+632) N CPD-14273 (Created page with "Category:metabolite == Metabolite CPD-14273 == * common-name: ** 3-oxo-lignoceroyl-coa * molecular-weight: ** 1128.113 * smiles: ** cccccccccccccccccccccc(=o)cc(=o)sccnc(=...") (current)
- 10:31, 15 June 2021 (diff | hist) (+615) N CPD-15370 (Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * molecular-weight: ** 1069.99 * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+560) N CPD1F-138 (Created page with "Category:metabolite == Metabolite CPD1F-138 == * common-name: ** gibberellin a12-aldehyde * molecular-weight: ** 315.431 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+310) N Sialyloligosaccharides (Created page with "Category:metabolite == Metabolite Sialyloligosaccharides == * common-name: ** a sialyloligosaccharide == Reaction(s) known to consume the compound == * 3.2.1.18-RXN ==...") (current)
- 10:31, 15 June 2021 (diff | hist) (+343) N Protein-Phosphoserines (Created page with "Category:metabolite == Metabolite Protein-Phosphoserines == * common-name: ** a [protein] l-serine phosphate == Reaction(s) known to consume the compound == * 2.7.12.1-R...") (current)
- 10:31, 15 June 2021 (diff | hist) (+501) N CPD-14152 (Created page with "Category:metabolite == Metabolite CPD-14152 == * common-name: ** 1,2-benzoquinone monoimine * molecular-weight: ** 107.112 * smiles: ** c1(=cc(=n)c(c=c1)=o) * inchi-key: *...") (current)
- 10:31, 15 June 2021 (diff | hist) (+306) N Cytidine-34-tRNAIle2 (Created page with "Category:metabolite == Metabolite Cytidine-34-tRNAIle2 == * common-name: ** a cytidine34 in trnaile2 == Reaction(s) known to consume the compound == * RXN-1961 == Reac...") (current)
- 10:31, 15 June 2021 (diff | hist) (+546) N CPD-15924 (Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * molecular-weight: ** 432.493 * smiles: ** ccccccccc=ccccccccc(=o)occ...") (current)
- 10:31, 15 June 2021 (diff | hist) (+437) N Sphingomyelins (Created page with "Category:metabolite == Metabolite Sphingomyelins == * common-name: ** a sphingomyelin == Reaction(s) known to consume the compound == * 2.7.8.27-RXN * CERAMIDE-CHOLI...") (current)
- 10:31, 15 June 2021 (diff | hist) (+497) N CPD-578 (Created page with "Category:metabolite == Metabolite CPD-578 == * common-name: ** urea-1-carboxylate * molecular-weight: ** 103.057 * smiles: ** c(n)(nc([o-])=o)=o * inchi-key: ** avwrkzwqty...") (current)
- 10:31, 15 June 2021 (diff | hist) (+657) N METHYLENETETRAHYDROMETHANOPTERIN (Created page with "Category:metabolite == Metabolite METHYLENETETRAHYDROMETHANOPTERIN == * common-name: ** 5,10-methylene-tetrahydromethanopterin * molecular-weight: ** 785.677 * smiles: **...") (current)
- 10:31, 15 June 2021 (diff | hist) (+339) N Histone-N-o-methyl-arginines (Created page with "Category:metabolite == Metabolite Histone-N-o-methyl-arginines == * common-name: ** [histone]-nω-methyl-arginine == Reaction(s) known to consume the compound == == R...") (current)
- 10:31, 15 June 2021 (diff | hist) (+316) N Charged-SEC-tRNAs (Created page with "Category:metabolite == Metabolite Charged-SEC-tRNAs == * common-name: ** an l-selenocysteinyl-[trnasec] == Reaction(s) known to consume the compound == == Reaction(s) know...") (current)
- 10:31, 15 June 2021 (diff | hist) (+589) N CPD-14604 (Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * molecular-weight: ** 494.451 * smiles: ** cc(ccc([o-])=o)=ccc2(=c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+488) N UROCANATE (Created page with "Category:metabolite == Metabolite UROCANATE == * common-name: ** urocanate * molecular-weight: ** 137.118 * smiles: ** c1(nc=nc=1c=cc([o-])=o) * inchi-key: ** loiymiarkyct...") (current)
- 10:31, 15 June 2021 (diff | hist) (+671) N 2-PG (Created page with "Category:metabolite == Metabolite 2-PG == * common-name: ** 2-phospho-d-glycerate * molecular-weight: ** 183.034 * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * inchi-key:...") (current)
- 10:31, 15 June 2021 (diff | hist) (+561) N CYCLOEUCALENOL (Created page with "Category:metabolite == Metabolite CYCLOEUCALENOL == * common-name: ** cycloeucalenol * molecular-weight: ** 426.724 * smiles: ** cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]...") (current)
- 10:31, 15 June 2021 (diff | hist) (+590) N CPD-12321 (Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * molecular-weight: ** 544.946 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(cc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+546) N CYCLOARTENOL (Created page with "Category:metabolite == Metabolite CYCLOARTENOL == * common-name: ** cycloartenol * molecular-weight: ** 426.724 * smiles: ** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+677) N NICOTINATE NUCLEOTIDE (Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * molecular-weight: ** 333.191 * smiles: ** c(op([o-])(=o)[...") (current)
- 10:31, 15 June 2021 (diff | hist) (+544) N CPD-360 (Created page with "Category:metabolite == Metabolite CPD-360 == * common-name: ** d-xylonolactone * molecular-weight: ** 148.115 * smiles: ** c1(c(c(c(co1)o)o)o)=o * inchi-key: ** xxbsuzsono...") (current)
- 10:31, 15 June 2021 (diff | hist) (+380) N Heparan-NAc-Glc-6S (Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc-6S == * common-name: ** [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consume the...") (current)
- 10:31, 15 June 2021 (diff | hist) (+412) N 3-Oxo-Delta-4-Steroids (Created page with "Category:metabolite == Metabolite 3-Oxo-Delta-4-Steroids == * common-name: ** a 3-oxo-δ4-steroid == Reaction(s) known to consume the compound == * 1.3.99.5-RXN *...") (current)
- 10:31, 15 June 2021 (diff | hist) (+347) N O-Long-Chain-Acyl-L-Carnitines (Created page with "Category:metabolite == Metabolite O-Long-Chain-Acyl-L-Carnitines == * common-name: ** an o-long-chain-acyl-l-carnitine == Reaction(s) known to consume the compound == * ...") (current)
- 10:31, 15 June 2021 (diff | hist) (+336) N MRNA-Adenines (Created page with "Category:metabolite == Metabolite mRNA-Adenines == * common-name: ** an adenine in mrna == Reaction(s) known to consume the compound == * RXN-17810 * RXN-17811 ==...") (current)
- 10:31, 15 June 2021 (diff | hist) (+316) N CPD-8581 (Created page with "Category:metabolite == Metabolite CPD-8581 == * common-name: ** a [calmodulin] n6-methyl-l-lysine == Reaction(s) known to consume the compound == == Reaction(s) known to p...") (current)
- 10:31, 15 June 2021 (diff | hist) (+316) N Charged-TYR-tRNAs (Created page with "Category:metabolite == Metabolite Charged-TYR-tRNAs == * common-name: ** an l-tyrosyl-[trnatyr] == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") (current)
- 10:31, 15 June 2021 (diff | hist) (+519) N CPD-10793 (Created page with "Category:metabolite == Metabolite CPD-10793 == * common-name: ** hydroxypyruvaldehyde phosphate * molecular-weight: ** 166.027 * smiles: ** [ch](=o)c(=o)cop(=o)([o-])[o-]...") (current)
- 10:31, 15 June 2021 (diff | hist) (+590) N CPD1F-136 (Created page with "Category:metabolite == Metabolite CPD1F-136 == * common-name: ** ent-7α-hydroxykaur-16-en-19-oate * molecular-weight: ** 317.447 * smiles: ** c=c1(c4(cc[ch]3(c(c1)(c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+375) N NNN-trimethyl-terminal-XPK (Created page with "Category:metabolite == Metabolite NNN-trimethyl-terminal-XPK == * common-name: ** an n terminal n,n,n-trimethyl-(a/s)pk-[protein] == Reaction(s) known to consume the compo...") (current)
- 10:31, 15 June 2021 (diff | hist) (+533) N CPD-713 (Created page with "Category:metabolite == Metabolite CPD-713 == * common-name: ** 6-oxocampestanol * molecular-weight: ** 416.686 * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+554) N CREATINE-P (Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * molecular-weight: ** 209.098 * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=...") (current)
- 10:31, 15 June 2021 (diff | hist) (+220) N MOZUKULIN B (Created page with "Category:metabolite == Metabolite MOZUKULIN_B == == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * [[new_delta24_reduction]...") (current)
- 10:31, 15 June 2021 (diff | hist) (+543) N 2-METHYLMALEATE (Created page with "Category:metabolite == Metabolite 2-METHYLMALEATE == * common-name: ** citraconate * molecular-weight: ** 128.084 * smiles: ** cc(=cc(=o)[o-])c(=o)[o-] * inchi-key: ** hne...") (current)
- 10:31, 15 June 2021 (diff | hist) (+604) N CPD-8614 (Created page with "Category:metabolite == Metabolite CPD-8614 == * common-name: ** 4α-methyl-5α-cholesta-8-en-3-one * molecular-weight: ** 398.671 * smiles: ** cc(c)cccc([ch]4(c1...") (current)
- 10:31, 15 June 2021 (diff | hist) (+346) N 3-Oxo-5-Alpha-Steroids (Created page with "Category:metabolite == Metabolite 3-Oxo-5-Alpha-Steroids == * common-name: ** a 3-oxo-5-α-steroid == Reaction(s) known to consume the compound == * RXN-13682 ==...") (current)
- 10:31, 15 June 2021 (diff | hist) (+478) N CPD-14757 (Created page with "Category:metabolite == Metabolite CPD-14757 == * common-name: ** methylphenylsulfide * molecular-weight: ** 124.2 * smiles: ** csc1(=cc=cc=c1) * inchi-key: ** hnkjadcvzubc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+828) N CPD-315 (Created page with "Category:metabolite == Metabolite CPD-315 == * common-name: ** cyanocob(iii)alamin * molecular-weight: ** 1355.377 * smiles: ** cc4(=c(c)c=c3(n2(c%12(oc(co)c(op(=o)(o[ch](...") (current)
- 10:31, 15 June 2021 (diff | hist) (+510) N CPD-10329 (Created page with "Category:metabolite == Metabolite CPD-10329 == * common-name: ** α-l-fucopyranose * molecular-weight: ** 164.158 * smiles: ** cc1(oc(c(c(c1o)o)o)o) * inchi-key: ** s...") (current)
- 10:31, 15 June 2021 (diff | hist) (+386) N PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS (Created page with "Category:metabolite == Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS == * common-name: ** a protein l-β-isoaspartate α-methyl ester == Reaction(s) known t...") (current)
- 10:31, 15 June 2021 (diff | hist) (+3,623) N GLT (Created page with "Category:metabolite == Metabolite GLT == * common-name: ** l-glutamate * molecular-weight: ** 146.122 * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbjxj...") (current)
- 10:31, 15 June 2021 (diff | hist) (+535) N ERGOSTEROL (Created page with "Category:metabolite == Metabolite ERGOSTEROL == * common-name: ** ergosterol * molecular-weight: ** 396.655 * smiles: ** cc(c)c(c)c=cc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+656) N 2-METHYL-6-SOLANYL-14-BENZOQUINONE (Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * molecular-weight: ** 737.203 *...") (current)
- 10:31, 15 June 2021 (diff | hist) (+497) N CPD-321 (Created page with "Category:metabolite == Metabolite CPD-321 == * common-name: ** 3-aci-nitropropanoate * molecular-weight: ** 117.061 * smiles: ** c(cc([o-])=o)=[n+]([o-])[o-] * inchi-key:...") (current)
- 10:31, 15 June 2021 (diff | hist) (+708) N CPD-18 (Created page with "Category:metabolite == Metabolite CPD-18 == * common-name: ** linoleoyl-coa * molecular-weight: ** 1025.937 * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+294) N Guanine10-in-tRNA (Created page with "Category:metabolite == Metabolite Guanine10-in-tRNA == * common-name: ** a guanine10 in trna == Reaction(s) known to consume the compound == * RXN-12374 == Reaction(s)...") (current)
- 10:31, 15 June 2021 (diff | hist) (+377) N 1-Alkenylglycerophosphoethanolamines (Created page with "Category:metabolite == Metabolite 1-Alkenylglycerophosphoethanolamines == * common-name: ** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine == Reaction(s) known to con...") (current)
- 10:31, 15 June 2021 (diff | hist) (+549) N TRANS-D2-ENOYL-COA (Created page with "Category:metabolite == Metabolite TRANS-D2-ENOYL-COA == * common-name: ** a (2e)-alkan-2-enoyl-coa == Reaction(s) known to consume the compound == * ENOYL-COA-DELTA-ISOM...") (current)
- 10:31, 15 June 2021 (diff | hist) (+337) N Cis-delta19-3-hydroxyC38-ACPs (Created page with "Category:metabolite == Metabolite cis-delta19-3-hydroxyC38-ACPs == * common-name: ** a cis-delta19-3-hydroxyc38:1-[acp] == Reaction(s) known to consume the compound == * [...") (current)
- 10:31, 15 June 2021 (diff | hist) (+632) N CPD-15690 (Created page with "Category:metabolite == Metabolite CPD-15690 == * common-name: ** (3r)-hydroxy-5-trans-dodecenoyl-coa * molecular-weight: ** 959.791 * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+679) N CPD-17347 (Created page with "Category:metabolite == Metabolite CPD-17347 == * common-name: ** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa * molecular-weight: ** 1069.99 * smiles: ** cccccc=ccc=cccc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+497) N CPD-13398 (Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * molecular-weight: ** 202.253 * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-ke...") (current)
- 10:31, 15 June 2021 (diff | hist) (+330) N N-Substituted-Amino-Acids (Created page with "Category:metabolite == Metabolite N-Substituted-Amino-Acids == * common-name: ** an n-modified amino acid == Reaction(s) known to consume the compound == == Reaction(s) kn...") (current)
- 10:31, 15 June 2021 (diff | hist) (+513) N CPD-14596 (Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * molecular-weight: ** 423.416 * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o...") (current)
- 10:31, 15 June 2021 (diff | hist) (+569) N CPD-12175 (Created page with "Category:metabolite == Metabolite CPD-12175 == * common-name: ** (s)-3-hydroxy-isobutanoate * molecular-weight: ** 103.097 * smiles: ** cc(c([o-])=o)co * inchi-key: ** dbx...") (current)
- 10:31, 15 June 2021 (diff | hist) (+527) N DOPAQUINONE (Created page with "Category:metabolite == Metabolite DOPAQUINONE == * common-name: ** dopaquinone * molecular-weight: ** 195.174 * smiles: ** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1) * inchi-...") (current)
- 10:31, 15 June 2021 (diff | hist) (+643) N HYPOXANTHINE (Created page with "Category:metabolite == Metabolite HYPOXANTHINE == * common-name: ** hypoxanthine * molecular-weight: ** 136.113 * smiles: ** c1(nc2(=c(n=1)n=cnc(=o)2)) * inchi-key: ** fdg...") (current)
- 10:31, 15 June 2021 (diff | hist) (+361) N Phosphorylated-receptor-proteins (Created page with "Category:metabolite == Metabolite Phosphorylated-receptor-proteins == * common-name: ** a phosphorylated receptor protein == Reaction(s) known to consume the compound == *...") (current)
- 10:31, 15 June 2021 (diff | hist) (+407) N Protein-N-Nprime-omega-dimethyl-arginine (Created page with "Category:metabolite == Metabolite Protein-N-Nprime-omega-dimethyl-arginine == * common-name: ** [protein]-nω,n'ω-dimethyl-l-arginine == Reaction(s) known to co...") (current)
- 10:31, 15 June 2021 (diff | hist) (+544) N BETAINE ALDEHYDE (Created page with "Category:metabolite == Metabolite BETAINE_ALDEHYDE == * common-name: ** betaine aldehyde * molecular-weight: ** 102.156 * smiles: ** c[n+](c)(c[ch]=o)c * inchi-key: ** sxk...") (current)
- 10:31, 15 June 2021 (diff | hist) (+336) N CPD-14931 (Created page with "Category:metabolite == Metabolite CPD-14931 == * common-name: ** a 10-formyltetrahydrofolate-4a-carbinolamine == Reaction(s) known to consume the compound == * RXN-13908...") (current)
- 10:31, 15 June 2021 (diff | hist) (+643) N UNDECAPRENYL-DIPHOSPHATE (Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * molecular-weight: ** 924.251 * smiles: ** cc(=...") (current)
- 10:31, 15 June 2021 (diff | hist) (+302) N Cis-5-enoyl-CoA (Created page with "Category:metabolite == Metabolite cis-5-enoyl-CoA == * common-name: ** a (5z)-alkan-5-enoyl-coa == Reaction(s) known to consume the compound == * RXN-12518 == Reaction...") (current)
- 10:31, 15 June 2021 (diff | hist) (+509) N CPDQT-29 (Created page with "Category:metabolite == Metabolite CPDQT-29 == * common-name: ** 8-(methylthio)-2-oxooctanoate * molecular-weight: ** 203.276 * smiles: ** csccccccc(=o)c([o-])=o * inchi-ke...") (current)
- 10:31, 15 June 2021 (diff | hist) (+599) N 4-METHYL-824-CHOLESTADIENOL (Created page with "Category:metabolite == Metabolite 4-METHYL-824-CHOLESTADIENOL == * common-name: ** 4α-methyl-zymosterol * molecular-weight: ** 398.671 * smiles: ** cc(c)=cccc(c)[ch]...") (current)
- 10:31, 15 June 2021 (diff | hist) (+589) N ALL-TRANS-HEXAPRENYL-DIPHOSPHATE (Created page with "Category:metabolite == Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-hexaprenyl diphosphate * molecular-weight: ** 583.66 * smiles: ** cc(c)=c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+716) N UROPORPHYRINOGEN-III (Created page with "Category:metabolite == Metabolite UROPORPHYRINOGEN-III == * common-name: ** uroporphyrinogen-iii * molecular-weight: ** 828.742 * smiles: ** c(=o)([o-])ccc3(c(=c2(cc5(nc(c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+540) N CPD-10205 (Created page with "Category:metabolite == Metabolite CPD-10205 == * common-name: ** 4-hydroxy-5-methyl-2-methylene-3(2h)-furanone * molecular-weight: ** 126.112 * smiles: ** c=c1(c(=o)c(o)=c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+352) N FORMYL-L-METHIONYL-PEPTIDE (Created page with "Category:metabolite == Metabolite FORMYL-L-METHIONYL-PEPTIDE == * common-name: ** a [protein] n-terminal-formyl-l-methionine == Reaction(s) known to consume the compound =...") (current)
- 10:31, 15 June 2021 (diff | hist) (+645) N 1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE (Created page with "Category:metabolite == Metabolite 1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE == * common-name: ** 1,2-dipalmitoyl-phosphatidylcholine * molecular-weight: ** 734.048 * smiles: ** c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+612) N K+ (Created page with "Category:metabolite == Metabolite K+ == * common-name: ** k+ * molecular-weight: ** 39.098 * smiles: ** [k+] * inchi-key: ** npypahlbtdxsss-uhfffaoysa-n == Reaction(s) kno...") (current)
- 10:31, 15 June 2021 (diff | hist) (+326) N L-Glutamyl-Peptides (Created page with "Category:metabolite == Metabolite L-Glutamyl-Peptides == * common-name: ** an n-terminal l-glutamyl-[protein] == Reaction(s) known to consume the compound == * RXN-17888...") (current)
- 10:31, 15 June 2021 (diff | hist) (+490) N L-EPINEPHRINE (Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * molecular-weight: ** 184.214 * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key:...") (current)
- 10:31, 15 June 2021 (diff | hist) (+541) N N-ACETYL-SEROTONIN (Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * molecular-weight: ** 218.255 * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)...") (current)
- 10:31, 15 June 2021 (diff | hist) (+531) N CPD-7206 (Created page with "Category:metabolite == Metabolite CPD-7206 == * common-name: ** 8'-apo-β-carotenal * molecular-weight: ** 416.645 * smiles: ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+706) N T2-DECENOYL-COA (Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * molecular-weight: ** 915.738 * smiles: ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o...") (current)
- 10:31, 15 June 2021 (diff | hist) (+376) N Beta-adrenergic-receptors-P (Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors-P == * common-name: ** a phosphorylated β-adrenergic receptor == Reaction(s) known to consume the compound...") (current)
- 10:31, 15 June 2021 (diff | hist) (+463) N CPD-7880 (Created page with "Category:metabolite == Metabolite CPD-7880 == * common-name: ** dodecanal * molecular-weight: ** 184.321 * smiles: ** ccccccccccc[ch]=o * inchi-key: ** hfjrkmmybmwead-uhff...") (current)
- 10:31, 15 June 2021 (diff | hist) (+532) N CPD-4617 (Created page with "Category:metabolite == Metabolite CPD-4617 == * common-name: ** dihydrozeatin-o-glucoside * molecular-weight: ** 383.403 * smiles: ** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+295) N Rhodopsins (Created page with "Category:metabolite == Metabolite Rhodopsins == * common-name: ** a rhodopsin == Reaction(s) known to consume the compound == * 2.7.11.14-RXN == Reaction(s) known to p...") (current)
- 10:31, 15 June 2021 (diff | hist) (+350) N DNA-Ligase-L-lysine-guanylate (Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine-guanylate == * common-name: ** a [dna ligase]-l-lysine-guanylate == Reaction(s) known to consume the compound == * ...") (current)
- 10:31, 15 June 2021 (diff | hist) (+494) N N1-METHYLADENINE (Created page with "Category:metabolite == Metabolite N1-METHYLADENINE == * common-name: ** n1-methyladenine * molecular-weight: ** 149.155 * smiles: ** cn2(c=nc1(c(n=cn=1)=c(n)2)) * inchi-ke...") (current)
- 10:31, 15 June 2021 (diff | hist) (+367) N N-ACETYLNEURAMINATE (Created page with "Category:metabolite == Metabolite N-ACETYLNEURAMINATE == * common-name: ** n-acetylneuraminate == Reaction(s) known to consume the compound == * 2.3.1.45-RXN * RXN-7...") (current)
- 10:31, 15 June 2021 (diff | hist) (+557) N CPD-13713 (Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * molecular-weight: ** 473.174 * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=...") (current)
- 10:31, 15 June 2021 (diff | hist) (+516) N 2-KETO-GLUTARAMATE (Created page with "Category:metabolite == Metabolite 2-KETO-GLUTARAMATE == * common-name: ** 2-oxoglutaramate * molecular-weight: ** 144.107 * smiles: ** c(cc(n)=o)c(=o)c(=o)[o-] * inchi-key...") (current)
- 10:31, 15 June 2021 (diff | hist) (+520) N CPD-7733 (Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * molecular-weight: ** 379.541 * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o)...") (current)
- 10:31, 15 June 2021 (diff | hist) (+616) N GUANOSINE-5DP-3DP (Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * molecular-weight: ** 598.123 * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])...") (current)
- 10:31, 15 June 2021 (diff | hist) (+507) N CPD-6992 (Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * molecular-weight: ** 271.249 * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+310) N 23S-rRNA-guanine-2445 (Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-2445 == * common-name: ** a guanine2445 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11574 == R...") (current)
- 10:31, 15 June 2021 (diff | hist) (+360) N HIF-Alpha (Created page with "Category:metabolite == Metabolite HIF-Alpha == * common-name: ** a hypoxia inducible factor (hif) α subunit == Reaction(s) known to consume the compound == * RXN-1...") (current)
- 10:31, 15 June 2021 (diff | hist) (+610) N DIHYDROKAEMPFEROL-CMPD (Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * molecular-weight: ** 288.256 * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c...") (current)
- 10:31, 15 June 2021 (diff | hist) (+366) N 3-oxo-cis-D7-tetradecenoyl-ACPs (Created page with "Category:metabolite == Metabolite 3-oxo-cis-D7-tetradecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume the compoun...") (current)
- 10:31, 15 June 2021 (diff | hist) (+595) N CPD-12121 (Created page with "Category:metabolite == Metabolite CPD-12121 == * common-name: ** demethylmenaquinol-12 * molecular-weight: ** 977.59 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+493) N CPD-1909 (Created page with "Category:metabolite == Metabolite CPD-1909 == * common-name: ** (-)-menthone * molecular-weight: ** 154.252 * smiles: ** cc(c1(ccc(cc1=o)c))c * inchi-key: ** nflgaxvycfjbm...") (current)
- 10:31, 15 June 2021 (diff | hist) (+368) N 3-Prime-Phosphate-Terminated-RNAs (Created page with "Category:metabolite == Metabolite 3-Prime-Phosphate-Terminated-RNAs == * common-name: ** an [rna]-3'-ribonucleoside-3'-phosphate == Reaction(s) known to consume the compou...") (current)
- 10:31, 15 June 2021 (diff | hist) (+455) N CPD-661 (Created page with "Category:metabolite == Metabolite CPD-661 == * common-name: ** propynoate * molecular-weight: ** 69.04 * smiles: ** c#cc([o-])=o * inchi-key: ** uorvclmrjxcdcp-uhfffaoysa-...") (current)
- 10:31, 15 June 2021 (diff | hist) (+306) N Palmitoyl-proteins (Created page with "Category:metabolite == Metabolite Palmitoyl-proteins == * common-name: ** a palmitoylated protein == Reaction(s) known to consume the compound == * 3.1.2.22-RXN == Rea...") (current)
- 10:31, 15 June 2021 (diff | hist) (+315) N CPD-187 (Created page with "Category:metabolite == Metabolite CPD-187 == * common-name: ** 4-hydroxy-4-methyl-2-oxoglutarate == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") (current)
- 10:31, 15 June 2021 (diff | hist) (+352) N 7Z-3-oxo-hexadec-7-enoyl-ACPs (Created page with "Category:metabolite == Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs == * common-name: ** a (7z)-3-oxo-hexadec-7-enoyl-[acp] == Reaction(s) known to consume the compound == * [...") (current)
- 10:31, 15 June 2021 (diff | hist) (+529) N DETHIOBIOTIN (Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * molecular-weight: ** 213.256 * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** a...") (current)
- 10:31, 15 June 2021 (diff | hist) (+518) N 1-INDANOL (Created page with "Category:metabolite == Metabolite 1-INDANOL == * common-name: ** 1-indanol * molecular-weight: ** 134.177 * smiles: ** c2(c=cc1(=c(ccc1o)c=2)) * inchi-key: ** yiapldfpuuji...") (current)
- 10:31, 15 June 2021 (diff | hist) (+798) N PREPHENATE (Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * molecular-weight: ** 224.17 * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi...") (current)
- 10:31, 15 June 2021 (diff | hist) (+695) N CPD-17386 (Created page with "Category:metabolite == Metabolite CPD-17386 == * common-name: ** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa * molecular-weight: ** 1100.019 * smiles: ** ccc=ccc=cc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+510) N CPDQT-28 (Created page with "Category:metabolite == Metabolite CPDQT-28 == * common-name: ** 7-(methylthio)-2-oxoheptanoate * molecular-weight: ** 189.249 * smiles: ** cscccccc(=o)c([o-])=o * inchi-ke...") (current)
- 10:31, 15 June 2021 (diff | hist) (+309) N Elongation-tRNAMet (Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...") (current)
- 10:31, 15 June 2021 (diff | hist) (+559) N CPD-16016 (Created page with "Category:metabolite == Metabolite CPD-16016 == * common-name: ** lanosteryl oleate * molecular-weight: ** 691.175 * smiles: ** ccccccccc=ccccccccc(=o)oc4(ccc1(c)([ch](ccc2...") (current)
- 10:31, 15 June 2021 (diff | hist) (+644) N CPD-202 (Created page with "Category:metabolite == Metabolite CPD-202 == * common-name: ** choloyl-coa * molecular-weight: ** 1154.064 * smiles: ** cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...") (current)
- 10:31, 15 June 2021 (diff | hist) (+313) N Charged-PRO-tRNAs (Created page with "Category:metabolite == Metabolite Charged-PRO-tRNAs == * common-name: ** an l-prolyl-[trnapro] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") (current)
- 10:31, 15 June 2021 (diff | hist) (+516) N PYRIDOXAMINE (Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * molecular-weight: ** 169.203 * smiles: ** cc1(=nc=c(co)c(c[n+])=c(o)1) * inchi-key: ** n...") (current)
- 10:31, 15 June 2021 (diff | hist) (+723) N CPD-14282 (Created page with "Category:metabolite == Metabolite CPD-14282 == * common-name: ** trans-lignocer-2-enoyl-coa * molecular-weight: ** 1112.113 * smiles: ** cccccccccccccccccccccc=cc(=o)sccnc...") (current)
- 10:31, 15 June 2021 (diff | hist) (+532) N CPD-7014 (Created page with "Category:metabolite == Metabolite CPD-7014 == * common-name: ** chlorophyllide b * molecular-weight: ** 626.95 * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]...") (current)
- 10:31, 15 June 2021 (diff | hist) (+591) N LINOLENIC ACID (Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * molecular-weight: ** 277.426 * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-...") (current)
- 10:31, 15 June 2021 (diff | hist) (+317) N GALACTOSYLCERAMIDE-SULFATE (Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") (current)
- 10:31, 15 June 2021 (diff | hist) (+347) N RNASE-II-DEGRADATION-SUBSTRATE-MRNA (Created page with "Category:metabolite == Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA == * common-name: ** rnase ii degradation substrate mrna == Reaction(s) known to consume the compound...") (current)
- 10:31, 15 June 2021 (diff | hist) (+324) N Adenine57-Adenine58-tRNAs (Created page with "Category:metabolite == Metabolite Adenine57-Adenine58-tRNAs == * common-name: ** an adenine57/adenine58 in trna == Reaction(s) known to consume the compound == * RXN-124...") (current)
- 10:31, 15 June 2021 (diff | hist) (+547) N CPD-12116 (Created page with "Category:metabolite == Metabolite CPD-12116 == * common-name: ** demethylmenaquinol-6 * molecular-weight: ** 568.881 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") (current)
- 10:31, 15 June 2021 (diff | hist) (+350) N 3-Polyrenyl-benzene-1-2-diols (Created page with "Category:metabolite == Metabolite 3-Polyrenyl-benzene-1-2-diols == * common-name: ** a 3-(all-trans-polyrenyl)benzene-1,2-diol == Reaction(s) known to consume the compound...") (current)
- 10:31, 15 June 2021 (diff | hist) (+380) N Gamma-linolenoyl-groups (Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...") (current)
- 10:31, 15 June 2021 (diff | hist) (+508) N CPD-786 (Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * molecular-weight: ** 170.121 * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inch...") (current)
- 10:31, 15 June 2021 (diff | hist) (+613) N LYS (Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * molecular-weight: ** 147.197 * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-y...") (current)
- 10:31, 15 June 2021 (diff | hist) (+508) N GAMMA-BUTYROBETAINE (Created page with "Category:metabolite == Metabolite GAMMA-BUTYROBETAINE == * common-name: ** γ-butyrobetaine * molecular-weight: ** 145.201 * smiles: ** c[n+](cccc([o-])=o)(c)c * inch...") (current)
- 10:31, 15 June 2021 (diff | hist) (+525) N OXIDIZED-DITHIOTHREITOL (Created page with "Category:metabolite == Metabolite OXIDIZED-DITHIOTHREITOL == * common-name: ** oxidized dithiothreitol * molecular-weight: ** 152.226 * smiles: ** c1(sscc(o)c(o)1) * inchi...") (current)
- 10:30, 15 June 2021 (diff | hist) (+291) N Double-helix-DNA (Created page with "Category:metabolite == Metabolite Double-helix-DNA == * common-name: ** a double-helix dna == Reaction(s) known to consume the compound == * RXN-11135 == Reaction(s) k...") (current)
- 10:30, 15 June 2021 (diff | hist) (+587) N CPD-11602 (Created page with "Category:metabolite == Metabolite CPD-11602 == * common-name: ** ergosterol 3-o-β-d-glucoside * molecular-weight: ** 558.797 * smiles: ** cc(c)c(c)c=cc(c)[ch]4(cc[ch]...") (current)
- 10:30, 15 June 2021 (diff | hist) (+738) N INOSITOL-1-4-5-TRISPHOSPHATE (Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * molecular-weight: ** 414.049 * smiles: ** c1(o)(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+502) N D-SERINE (Created page with "Category:metabolite == Metabolite D-SERINE == * common-name: ** d-serine * molecular-weight: ** 105.093 * smiles: ** c(o)c([n+])c([o-])=o * inchi-key: ** mtcfgrxmjlqnbg-uw...") (current)
- 10:30, 15 June 2021 (diff | hist) (+527) N CPD-568 (Created page with "Category:metabolite == Metabolite CPD-568 == * common-name: ** n1-acetylspermidine * molecular-weight: ** 189.3 * smiles: ** cc(=o)nccc[n+]cccc[n+] * inchi-key: ** mqtavjh...") (current)
- 10:30, 15 June 2021 (diff | hist) (+519) N CPD-369 (Created page with "Category:metabolite == Metabolite CPD-369 == * common-name: ** l-iditol * molecular-weight: ** 182.173 * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-u...") (current)
- 10:30, 15 June 2021 (diff | hist) (+653) N CPD-15436 (Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * molecular-weight: ** 971.845 * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+535) N SECOLOGANIN-CPD (Created page with "Category:metabolite == Metabolite SECOLOGANIN-CPD == * common-name: ** secologanin * molecular-weight: ** 388.371 * smiles: ** c=c[ch]1(c(oc=c(c(=o)oc)[ch](cc=o)1)oc2(oc(c...") (current)
- 10:30, 15 June 2021 (diff | hist) (+310) N CPD-11512 (Created page with "Category:metabolite == Metabolite CPD-11512 == * common-name: ** a (2r,3s,4s)-leucoanthocyanidin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") (current)
- 10:30, 15 June 2021 (diff | hist) (+523) N CPD-6991 (Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * molecular-weight: ** 255.249 * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+361) N Sphingoids (Created page with "Category:metabolite == Metabolite Sphingoids == * common-name: ** a sphingoid base == Reaction(s) known to consume the compound == * RXN-11376 * SPHINGOSINE-N-ACYLTR...") (current)
- 10:30, 15 June 2021 (diff | hist) (+526) N 5-HYDROXY-TRYPTOPHAN (Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * molecular-weight: ** 220.227 * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=...") (current)
- 10:30, 15 June 2021 (diff | hist) (+619) N CHOLINE (Created page with "Category:metabolite == Metabolite CHOLINE == * common-name: ** choline * molecular-weight: ** 104.172 * smiles: ** c(co)[n+](c)(c)c * inchi-key: ** oeyiohpdsnjkls-uhfffaoy...") (current)
- 10:30, 15 June 2021 (diff | hist) (+486) N CPD-12481 (Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * molecular-weight: ** 182.138 * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: **...") (current)
- 10:30, 15 June 2021 (diff | hist) (+347) N CELLULOSE (Created page with "Category:metabolite == Metabolite CELLULOSE == * common-name: ** cellulose == Reaction(s) known to consume the compound == * CELLULOSE-SYNTHASE-UDP-FORMING-RXN * RXN...") (current)
- 10:30, 15 June 2021 (diff | hist) (+605) N DIVINYL-PROTOCHLOROPHYLLIDE-A (Created page with "Category:metabolite == Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A == * common-name: ** 3,8-divinyl protochlorophyllide a * molecular-weight: ** 608.935 * smiles: ** c=cc2(c(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+637) N NIACINAMIDE (Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * molecular-weight: ** 122.126 * smiles: ** c1(n=cc(c(=o)n)=cc=1) * inchi-key: ** dfpaksucg...") (current)
- 10:30, 15 June 2021 (diff | hist) (+634) N PHOSPHORIBOSYL-AMP (Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-amp * molecular-weight: ** 555.288 * smiles: ** c(c4(c(c(c(n3(c(c2...") (current)
- 10:30, 15 June 2021 (diff | hist) (+597) N CPD-7526 (Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * molecular-weight: ** 540.914 * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=...") (current)
- 10:30, 15 June 2021 (diff | hist) (+350) N Core-Protein-L-Ser-Xyl (Created page with "Category:metabolite == Metabolite Core-Protein-L-Ser-Xyl == * common-name: ** a [protein]-3-o-(β-d-xylosyl)-l-serine == Reaction(s) known to consume the compound == =...") (current)
- 10:30, 15 June 2021 (diff | hist) (+673) N CPD1G-768 (Created page with "Category:metabolite == Metabolite CPD1G-768 == * common-name: ** 6-o-α-mycolyl-trehalose 6-phosphate * molecular-weight: ** 1540.305 * smiles: ** ccccccccccccccccccc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+608) N CPD-8291 (Created page with "Category:metabolite == Metabolite CPD-8291 == * common-name: ** 1-18:1-2-18:1-phosphatidylethanolamine * molecular-weight: ** 744.043 * smiles: ** ccccccccc=ccccccccc(occ(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+494) N CPD-397 (Created page with "Category:metabolite == Metabolite CPD-397 == * common-name: ** s-methyl-l-methionine * molecular-weight: ** 164.242 * smiles: ** c[s+](ccc([n+])c(=o)[o-])c * inchi-key: **...") (current)
- 10:30, 15 June 2021 (diff | hist) (+615) N CPD-17371 (Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * molecular-weight: ** 1041.936 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+584) N 3-HEXAPRENYL-4-HYDROXYBENZOATE (Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * molecular-weight: ** 545.824 * smiles: ** cc(c)=cccc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+357) N A-radical-of-luteolin-7-iOi-diglucuronid (Created page with "Category:metabolite == Metabolite a-radical-of-luteolin-7-iOi-diglucuronid == * common-name: ** a radical of luteolin-7-o-diglucuronide == Reaction(s) known to consume the...") (current)
- 10:30, 15 June 2021 (diff | hist) (+565) N RS-TETRAHYDROBENZYLISOQUINOLINE (Created page with "Category:metabolite == Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE == * common-name: ** (r,s)-tetrahydrobenzylisoquinoline * molecular-weight: ** 224.325 * smiles: ** c3(c=...") (current)
- 10:30, 15 June 2021 (diff | hist) (+515) N O-UREIDOHOMOSERINE (Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * molecular-weight: ** 177.16 * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * i...") (current)
- 10:30, 15 June 2021 (diff | hist) (+565) N CPD-14705 (Created page with "Category:metabolite == Metabolite CPD-14705 == * common-name: ** 4-hydroxy-2-nonenal-[cys-gly] conjugate * molecular-weight: ** 334.43 * smiles: ** cccccc(o)c(c[ch]=o)scc(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+541) N CPD-708 (Created page with "Category:metabolite == Metabolite CPD-708 == * common-name: ** campest-4-en-3β-ol * molecular-weight: ** 400.687 * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+309) N Poly-beta-D-Mannuronate (Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...") (current)
- 10:30, 15 June 2021 (diff | hist) (+315) N TRNA-Dihydrouridines (Created page with "Category:metabolite == Metabolite tRNA-Dihydrouridines == * common-name: ** a 5,6-dihydrouridine in trna == Reaction(s) known to consume the compound == == Reaction(s) kno...") (current)
- 10:30, 15 June 2021 (diff | hist) (+364) N HEPARIN-GLUCOSAMINE (Created page with "Category:metabolite == Metabolite HEPARIN-GLUCOSAMINE == * common-name: ** a [heparan]-α-d-glucosamine == Reaction(s) known to consume the compound == * 2.8.2.30-R...") (current)
- 10:30, 15 June 2021 (diff | hist) (+292) N Uracil17-in-tRNAs (Created page with "Category:metabolite == Metabolite Uracil17-in-tRNAs == * common-name: ** a uracil17 in trna == Reaction(s) known to consume the compound == * RXN-12455 == Reaction(s)...") (current)
- 10:30, 15 June 2021 (diff | hist) (+411) N Protein-N-acetyl-D-glucosamine-L-thr (Created page with "Category:metabolite == Metabolite Protein-N-acetyl-D-glucosamine-L-thr == * common-name: ** an n-acetyl-β-d-glucosaminyl-l-threonine-[glycoprotein] == Reaction(s) kno...") (current)
- 10:30, 15 June 2021 (diff | hist) (+361) N TRNA-Containing-N7-Methylguanine-46 (Created page with "Category:metabolite == Metabolite tRNA-Containing-N7-Methylguanine-46 == * common-name: ** an n7-methylguanine46 in trna == Reaction(s) known to consume the compound == ==...") (current)
- 10:30, 15 June 2021 (diff | hist) (+540) N CPD-16825 (Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * molecular-weight: ** 321.324 * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o...") (current)
- 10:30, 15 June 2021 (diff | hist) (+534) N D-GLT (Created page with "Category:metabolite == Metabolite D-GLT == * common-name: ** d-glutamate * molecular-weight: ** 146.122 * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbj...") (current)
- 10:30, 15 June 2021 (diff | hist) (+504) N CPD-308 (Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * molecular-weight: ** 303.294 * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=...") (current)
- 10:30, 15 June 2021 (diff | hist) (+310) N Charged-LYS-tRNAs (Created page with "Category:metabolite == Metabolite Charged-LYS-tRNAs == * common-name: ** an l-lysyl-[trnalys] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") (current)
- 10:30, 15 June 2021 (diff | hist) (+578) N CPD1F-766 (Created page with "Category:metabolite == Metabolite CPD1F-766 == * common-name: ** cyanidin-3-o-β-d-glucoside * molecular-weight: ** 447.374 * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+549) N RNA-Holder (Created page with "Category:metabolite == Metabolite RNA-Holder == * common-name: ** a ribonucleic acid == Reaction(s) known to consume the compound == * 3.1.27.5-RXN * DNA-DIRECTED-RN...") (current)
- 10:30, 15 June 2021 (diff | hist) (+343) N R-3-hydroxydodecanoyl-ACPs (Created page with "Category:metabolite == Metabolite R-3-hydroxydodecanoyl-ACPs == * common-name: ** a (3r)-3-hydroxydodecanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-...") (current)
- 10:30, 15 June 2021 (diff | hist) (+320) N L-glutamyl-tRNAGln (Created page with "Category:metabolite == Metabolite L-glutamyl-tRNAGln == * common-name: ** an l-glutamyl-[trnagln] == Reaction(s) known to consume the compound == * 6.3.5.7-RXN == Reac...") (current)
- 10:30, 15 June 2021 (diff | hist) (+498) N CPD-8973 (Created page with "Category:metabolite == Metabolite CPD-8973 == * common-name: ** methyl parathion * molecular-weight: ** 263.204 * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s * inch...") (current)
- 10:30, 15 June 2021 (diff | hist) (+379) N 1-Alpha-Linolenoyl-L-Phosphatidate (Created page with "Category:metabolite == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == * common-name: ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to con...") (current)
- 10:30, 15 June 2021 (diff | hist) (+363) N Cis-D19-37-MOH-38-Me-C57-1-ACPs (Created page with "Category:metabolite == Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs == * common-name: ** a cis-delta19-37-methoxy-38-methyl-c57:1-[acp] == Reaction(s) known to consume the c...") (current)
- 10:30, 15 June 2021 (diff | hist) (+329) N D-Glucopyranuronate (Created page with "Category:metabolite == Metabolite D-Glucopyranuronate == * common-name: ** d-glucopyranuronate == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") (current)
- 10:30, 15 June 2021 (diff | hist) (+683) N GALACTOSE-1P (Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * molecular-weight: ** 258.121 * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])...") (current)
- 10:30, 15 June 2021 (diff | hist) (+505) N DEOXYCYTIDINE (Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * molecular-weight: ** 227.219 * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * i...") (current)
- 10:30, 15 June 2021 (diff | hist) (+373) N D-Gal-NAc--Glycoproteins (Created page with "Category:metabolite == Metabolite D-Gal-NAc--Glycoproteins == * common-name: ** an n-acetyl-α-d-galactosalaminyl-[glycoprotein] == Reaction(s) known to consume the c...") (current)
- 10:30, 15 June 2021 (diff | hist) (+604) N CPD-15366 (Created page with "Category:metabolite == Metabolite CPD-15366 == * common-name: ** lesqueroloyl-coa * molecular-weight: ** 1072.006 * smiles: ** ccccccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o...") (current)
- 10:30, 15 June 2021 (diff | hist) (+310) N Unwound-DNA (Created page with "Category:metabolite == Metabolite Unwound-DNA == * common-name: ** an unwound double-stranded dna == Reaction(s) known to consume the compound == == Reaction(s) known to p...") (current)
- 10:30, 15 June 2021 (diff | hist) (+326) N TRNA-precursors (Created page with "Category:metabolite == Metabolite tRNA-precursors == * common-name: ** a trna precursor == Reaction(s) known to consume the compound == * 3.1.26.11-RXN * TRNA-CYTIDY...") (current)
- 10:30, 15 June 2021 (diff | hist) (+630) N 2K-4CH3-PENTANOATE (Created page with "Category:metabolite == Metabolite 2K-4CH3-PENTANOATE == * common-name: ** 4-methyl-2-oxopentanoate * molecular-weight: ** 129.135 * smiles: ** cc(c)cc(c([o-])=o)=o * inchi...") (current)
- 10:30, 15 June 2021 (diff | hist) (+306) N 23S-rRNA-adenine-2503 (Created page with "Category:metabolite == Metabolite 23S-rRNA-adenine-2503 == * common-name: ** adenine2503 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11586 == Rea...") (current)
- 10:30, 15 June 2021 (diff | hist) (+290) N Steryl-Esters (Created page with "Category:metabolite == Metabolite Steryl-Esters == * common-name: ** a steryl-ester == Reaction(s) known to consume the compound == * STEROL-ESTERASE-RXN == Reaction(s...") (current)
- 10:30, 15 June 2021 (diff | hist) (+283) N Octapeptides (Created page with "Category:metabolite == Metabolite Octapeptides == * common-name: ** an octapeptide == Reaction(s) known to consume the compound == == Reaction(s) known to produce the comp...") (current)
- 10:30, 15 June 2021 (diff | hist) (+439) N ACYL-ACP (Created page with "Category:metabolite == Metabolite ACYL-ACP == * common-name: ** an acyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1-ACYLGLYCEROL-3-P-ACYLT...") (current)
- 10:30, 15 June 2021 (diff | hist) (+300) N Phospholipids (Created page with "Category:metabolite == Metabolite Phospholipids == * common-name: ** a phospholipid == Reaction(s) known to consume the compound == * 3.6.3.1-RXN == Reaction(s) known...") (current)
- 10:30, 15 June 2021 (diff | hist) (+316) N Sugar-1-Phosphate (Created page with "Category:metabolite == Metabolite Sugar-1-Phosphate == * common-name: ** a sugar 1-phosphate == Reaction(s) known to consume the compound == * 2.7.7.64-RXN == Reaction...") (current)
- 10:30, 15 June 2021 (diff | hist) (+334) N 3-terminal-unsaturated-sugars (Created page with "Category:metabolite == Metabolite 3-terminal-unsaturated-sugars == * common-name: ** a 3'-terminal unsaturated sugar == Reaction(s) known to consume the compound == == Rea...") (current)
- 10:30, 15 June 2021 (diff | hist) (+378) N Lipoyl-Protein-L-Lysine (Created page with "Category:metabolite == Metabolite Lipoyl-Protein-L-Lysine == * common-name: ** a [lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * RXN-...") (current)
- 10:30, 15 June 2021 (diff | hist) (+392) N 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu (Created page with "Category:metabolite == Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu == * common-name: ** a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu == Reaction(s) known...") (current)
- 10:30, 15 June 2021 (diff | hist) (+404) N N-Ac-L-methionyl-L-glutaminyl-Protein (Created page with "Category:metabolite == Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein == * common-name: ** an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein] == Reaction(s...") (current)
- 10:30, 15 June 2021 (diff | hist) (+397) N CPD-6242 (Created page with "Category:metabolite == Metabolite CPD-6242 == * common-name: ** a protein-o-(n-acetyl-d-glucosaminyl)-trans-4-hydroxy-l-proline == Reaction(s) known to consume the compoun...") (current)
- 10:30, 15 June 2021 (diff | hist) (+315) N Cytosine2278-in-25S-rRNA (Created page with "Category:metabolite == Metabolite Cytosine2278-in-25S-rRNA == * common-name: ** a cytosine2278 in 25s rrna == Reaction(s) known to consume the compound == * RXN-15844...") (current)
- 10:30, 15 June 2021 (diff | hist) (+507) N VANILLYL MANDELATE (Created page with "Category:metabolite == Metabolite VANILLYL_MANDELATE == * common-name: ** vanillyl mandelate * molecular-weight: ** 197.167 * smiles: ** coc1(c(o)=cc=c(c=1)c(o)c(=o)[o-])...") (current)
- 10:30, 15 June 2021 (diff | hist) (+399) N All-trans-Retinyl-Esters (Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RETINOL-O-FA...") (current)
- 10:30, 15 June 2021 (diff | hist) (+324) N Lipid-hydroxy-fatty-acids (Created page with "Category:metabolite == Metabolite Lipid-hydroxy-fatty-acids == * common-name: ** a hydroxy-fatty-acyl-[lipid] == Reaction(s) known to consume the compound == == Reaction(s...") (current)
- 10:30, 15 June 2021 (diff | hist) (+809) N 3-HYDROXY-3-METHYL-GLUTARYL-COA (Created page with "Category:metabolite == Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA == * common-name: ** (s)-3-hydroxy-3-methylglutaryl-coa * molecular-weight: ** 906.621 * smiles: ** cc(c)...") (current)
- 10:30, 15 June 2021 (diff | hist) (+702) N CARBOXYMETHYL-HYDROXYPHENYLPROPCOA (Created page with "Category:metabolite == Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA == * common-name: ** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa * molecular-weight: ** 968.692 * smi...") (current)
- 10:30, 15 June 2021 (diff | hist) (+527) N CPD-6993 (Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * molecular-weight: ** 256.257 * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+513) N CPD-7367 (Created page with "Category:metabolite == Metabolite CPD-7367 == * common-name: ** 3-amino-4-hydroxybenzaldehyde * molecular-weight: ** 137.138 * smiles: ** [ch](=o)c1(=cc=c(o)c(n)=c1) * inc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+793) N CPD-5167 (Created page with "Category:metabolite == Metabolite CPD-5167 == * common-name: ** α-d-man-a-(1→2)-α-d-man-(1→2)-α-d-man-(1→3)-[α-d-man-(1→2)-&alp...") (current)
- 10:30, 15 June 2021 (diff | hist) (+644) N Red-NADPH-Hemoprotein-Reductases (Created page with "Category:metabolite == Metabolite Red-NADPH-Hemoprotein-Reductases == * common-name: ** a reduced [nadph-hemoprotein reductase] == Reaction(s) known to consume the compoun...") (current)
- 10:30, 15 June 2021 (diff | hist) (+592) N 1-CARBOXYVINYL-CARBOXYPHOSPHONATE (Created page with "Category:metabolite == Metabolite 1-CARBOXYVINYL-CARBOXYPHOSPHONATE == * common-name: ** 1-carboxyvinyl carboxyphosphonate * molecular-weight: ** 193.029 * smiles: ** c=c(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+292) N Uracil47-in-tRNAs (Created page with "Category:metabolite == Metabolite Uracil47-in-tRNAs == * common-name: ** a uracil47 in trna == Reaction(s) known to consume the compound == * RXN-12457 == Reaction(s)...") (current)
- 10:30, 15 June 2021 (diff | hist) (+532) N CPD-13172 (Created page with "Category:metabolite == Metabolite CPD-13172 == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * molecular-weight: ** 155.13 * smiles: ** c(=o)(c1(o)(c=cccc(=o)1)...") (current)
- 10:30, 15 June 2021 (diff | hist) (+689) N CPD1G-774 (Created page with "Category:metabolite == Metabolite CPD1G-774 == * common-name: ** 6-o-trans-keto-mycolyl-trehalose 6-phosphate * molecular-weight: ** 1668.519 * smiles: ** cccccccccccccccc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+755) N FORMALDEHYDE (Created page with "Category:metabolite == Metabolite FORMALDEHYDE == * common-name: ** formaldehyde * molecular-weight: ** 30.026 * smiles: ** [ch2]=o * inchi-key: ** wsfssnumvmoomr-uhfffaoy...") (current)
- 10:30, 15 June 2021 (diff | hist) (+753) N CPD-11700 (Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * molecular-weight: ** 726.913 * smiles: ** c1(o...") (current)
- 10:30, 15 June 2021 (diff | hist) (+485) N CPD-7671 (Created page with "Category:metabolite == Metabolite CPD-7671 == * common-name: ** methanethiol * molecular-weight: ** 48.103 * smiles: ** cs * inchi-key: ** lsdpwzhwypcbbb-uhfffaoysa-n == R...") (current)
- 10:30, 15 June 2021 (diff | hist) (+488) N CPD-11875 (Created page with "Category:metabolite == Metabolite CPD-11875 == * common-name: ** normetanephrine * molecular-weight: ** 184.214 * smiles: ** coc1(=c(o)c=cc(c(o)c[n+])=c1) * inchi-key: **...") (current)
- 10:30, 15 June 2021 (diff | hist) (+392) N Odd-Straight-Chain-234-Sat-FALD (Created page with "Category:metabolite == Metabolite Odd-Straight-Chain-234-Sat-FALD == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty aldehyde == Reaction(s) known t...") (current)
- 10:30, 15 June 2021 (diff | hist) (+598) N CPD-11876 (Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * molecular-weight: ** 182.176 * smiles: ** coc1(=c(o)c=cc(c(o)c=o...") (current)
- 10:30, 15 June 2021 (diff | hist) (+653) N CPD1G-1345 (Created page with "Category:metabolite == Metabolite CPD1G-1345 == * common-name: ** trehalose-cis-methoxy-mono-mycolate * molecular-weight: ** 1578.544 * smiles: ** cccccccccccccccccccccccc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+356) N N-methyl-terminal-XPK (Created page with "Category:metabolite == Metabolite N-methyl-terminal-XPK == * common-name: ** an n terminal n-methyl-(a/s)pk-[protein] == Reaction(s) known to consume the compound == * R...") (current)
- 10:30, 15 June 2021 (diff | hist) (+633) N CPD-15365 (Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * molecular-weight: ** 1041.936 * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c...") (current)
- 10:30, 15 June 2021 (diff | hist) (+577) N CPD-8343 (Created page with "Category:metabolite == Metabolite CPD-8343 == * common-name: ** 1-16:0-2-lysophosphatidylcholine * molecular-weight: ** 495.635 * smiles: ** cccccccccccccccc(occ(o)cop([o-...") (current)
- 10:30, 15 June 2021 (diff | hist) (+494) N COUMARYL-ALCOHOL (Created page with "Category:metabolite == Metabolite COUMARYL-ALCOHOL == * common-name: ** 4-coumaryl alcohol * molecular-weight: ** 150.177 * smiles: ** c(=cc1(=cc=c(o)c=c1))co * inchi-key:...") (current)
- 10:30, 15 June 2021 (diff | hist) (+303) N Carboxylic-esters (Created page with "Category:metabolite == Metabolite Carboxylic-esters == * common-name: ** a carboxylic ester == Reaction(s) known to consume the compound == * CARBOXYLESTERASE-RXN == R...") (current)
- 10:30, 15 June 2021 (diff | hist) (+673) N 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE (Created page with "Category:metabolite == Metabolite 5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE == * common-name: ** n2-formyl-n1-(5-phospho-β-d-ribosyl)glycinamide * molecular-weight: ** 312.172...") (current)
- 10:30, 15 June 2021 (diff | hist) (+531) N CPD-12676 (Created page with "Category:metabolite == Metabolite CPD-12676 == * common-name: ** 5'-chloro-5'-deoxyadenosine * molecular-weight: ** 285.689 * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c...") (current)
- 10:30, 15 June 2021 (diff | hist) (+342) N N6-Methyladenine-containing-mRNAs (Created page with "Category:metabolite == Metabolite N6-Methyladenine-containing-mRNAs == * common-name: ** an n6-methyladenine in mrna == Reaction(s) known to consume the compound == * RX...") (current)
- 10:30, 15 June 2021 (diff | hist) (+633) N RETINAL (Created page with "Category:metabolite == Metabolite RETINAL == * common-name: ** all-trans-retinal * molecular-weight: ** 284.441 * smiles: ** cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o *...") (current)
- 10:30, 15 June 2021 (diff | hist) (+726) N DPG (Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * molecular-weight: ** 262.006 * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([...") (current)
- 10:30, 15 June 2021 (diff | hist) (+481) N L-CANALINE (Created page with "Category:metabolite == Metabolite L-CANALINE == * common-name: ** l-canaline * molecular-weight: ** 134.135 * smiles: ** c(cc([n+])c(=o)[o-])on * inchi-key: ** fqpgmqabjnq...") (current)
- 10:30, 15 June 2021 (diff | hist) (+625) N L-DELTA1-PYRROLINE 5-CARBOXYLATE (Created page with "Category:metabolite == Metabolite L-DELTA1-PYRROLINE_5-CARBOXYLATE == * common-name: ** (s)-1-pyrroline-5-carboxylate * molecular-weight: ** 112.108 * smiles: ** c1(=nc(cc...") (current)
- 10:30, 15 June 2021 (diff | hist) (+498) N CPD-8050 (Created page with "Category:metabolite == Metabolite CPD-8050 == * common-name: ** scyllo-inositol * molecular-weight: ** 180.157 * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaism...") (current)
- 10:30, 15 June 2021 (diff | hist) (+360) N LC-alcohol-LC-acyl-ester (Created page with "Category:metabolite == Metabolite LC-alcohol-LC-acyl-ester == * common-name: ** a long-chain alcohol--long-chain acyl wax ester == Reaction(s) known to consume the compoun...") (current)
- 10:30, 15 June 2021 (diff | hist) (+328) N PROTEIN-L-CITRULLINE (Created page with "Category:metabolite == Metabolite PROTEIN-L-CITRULLINE == * common-name: ** a [protein]-l-citrulline == Reaction(s) known to consume the compound == == Reaction(s) known t...") (current)
- 10:30, 15 June 2021 (diff | hist) (+733) N FARNESYL-PP (Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * molecular-weight: ** 379.306 * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=...") (current)
- 10:30, 15 June 2021 (diff | hist) (+675) N 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE (Created page with "Category:metabolite == Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE == * common-name: ** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine * molecular-wei...") (current)
- 10:30, 15 June 2021 (diff | hist) (+344) N BCCP-L-lysine (Created page with "Category:metabolite == Metabolite BCCP-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * BIOTI...") (current)
- 10:30, 15 June 2021 (diff | hist) (+570) N CPD-13576 (Created page with "Category:metabolite == Metabolite CPD-13576 == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * molecular-weight: ** 264.169 * smiles: ** cc1(=c(ccop(...") (current)
- 10:30, 15 June 2021 (diff | hist) (+6,312) N PPI (Created page with "Category:metabolite == Metabolite PPI == * common-name: ** diphosphate * molecular-weight: ** 174.951 * smiles: ** o=p(o)(op([o-])([o-])=o)[o-] * inchi-key: ** xppkvpweqaf...") (current)
- 10:30, 15 June 2021 (diff | hist) (+439) N 1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP (Created page with "Category:metabolite == Metabolite 1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP == * common-name: ** 1-organyl-2-acetyl-sn-glycero-3-phospholipid * smiles: ** cc(=o)oc(co[r1])c...") (current)
- 10:30, 15 June 2021 (diff | hist) (+577) N LL-DIAMINOPIMELATE (Created page with "Category:metabolite == Metabolite LL-DIAMINOPIMELATE == * common-name: ** l,l-diaminopimelate * molecular-weight: ** 190.199 * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-...") (current)
- 10:30, 15 June 2021 (diff | hist) (+726) N CDP-CHOLINE (Created page with "Category:metabolite == Metabolite CDP-CHOLINE == * common-name: ** cdp-choline * molecular-weight: ** 487.319 * smiles: ** c[n+](c)(c)ccop([o-])(=o)op([o-])(=o)occ1(oc(c(o...") (current)
- 10:30, 15 June 2021 (diff | hist) (+373) N Proteins-with-incorrect-disulfides (Created page with "Category:metabolite == Metabolite Proteins-with-incorrect-disulfides == * common-name: ** a protein with incorrect disulfide bonds == Reaction(s) known to consume the comp...") (current)
- 10:30, 15 June 2021 (diff | hist) (+672) N CPD-17403 (Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * molecular-weight: ** 1067.974 * smiles: ** ccc=cccc(o)...") (current)
- 10:30, 15 June 2021 (diff | hist) (+497) N CPD-12483 (Created page with "Category:metabolite == Metabolite CPD-12483 == * common-name: ** 1,7-dimethylurate * molecular-weight: ** 196.165 * smiles: ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) * inchi-k...") (current)
- 10:30, 15 June 2021 (diff | hist) (+321) N Lipoprotein-signal-peptide (Created page with "Category:metabolite == Metabolite Lipoprotein-signal-peptide == * common-name: ** a lipoprotein signal peptide == Reaction(s) known to consume the compound == * RXN0-320...") (current)
- 10:30, 15 June 2021 (diff | hist) (+859) N ETF-Oxidized (Created page with "Category:metabolite == Metabolite ETF-Oxidized == * common-name: ** an oxidized electron-transfer flavoprotein == Reaction(s) known to consume the compound == * 1.5.5.1-...") (current)
- 10:30, 15 June 2021 (diff | hist) (+362) N Hexanoyl-ACPs (Created page with "Category:metabolite == Metabolite Hexanoyl-ACPs == * common-name: ** a hexanoyl-[acyl-carrier-protein] == Reaction(s) known to consume the compound == * RXN-9523 * R...") (current)
- 10:30, 15 June 2021 (diff | hist) (+341) N Hypoxanthine-37-In-tRNA-Alanines (Created page with "Category:metabolite == Metabolite Hypoxanthine-37-In-tRNA-Alanines == * common-name: ** a hypoxanthine37 in trnaala == Reaction(s) known to consume the compound == * RXN...") (current)
- 10:30, 15 June 2021 (diff | hist) (+522) N CPD-5162 (Created page with "Category:metabolite == Metabolite CPD-5162 == * common-name: ** α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-&al...") (current)
- 10:30, 15 June 2021 (diff | hist) (+552) N PYRIDOXINE-5P (Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * molecular-weight: ** 247.144 * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o...") (current)
- 10:30, 15 June 2021 (diff | hist) (+536) N CPD1F-96 (Created page with "Category:metabolite == Metabolite CPD1F-96 == * common-name: ** gibberellin a19 * molecular-weight: ** 360.406 * smiles: ** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](...") (current)
- 10:30, 15 June 2021 (diff | hist) (+543) N ANTHRANILATE (Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * molecular-weight: ** 136.13 * smiles: ** c(c1(c(=cc=cc=1)n))(=o)[o-] * inchi-key: ** rwz...") (current)
- 10:29, 15 June 2021 (diff | hist) (+334) N CPD-17399 (Created page with "Category:metabolite == Metabolite CPD-17399 == * common-name: ** a [glycerolipid]-auricolate == Reaction(s) known to consume the compound == * RXN-16157 == Reaction(s)...") (current)
- 10:29, 15 June 2021 (diff | hist) (+604) N DEHYDROSPHINGANINE (Created page with "Category:metabolite == Metabolite DEHYDROSPHINGANINE == * common-name: ** 3-dehydrosphinganine * molecular-weight: ** 300.504 * smiles: ** cccccccccccccccc(c(co)[n+])=o *...") (current)
- 10:29, 15 June 2021 (diff | hist) (+340) N SS-Oligoribonucleotides (Created page with "Category:metabolite == Metabolite SS-Oligoribonucleotides == * common-name: ** a single-stranded oligoribonucleotide == Reaction(s) known to consume the compound == == Rea...") (current)
- 10:29, 15 June 2021 (diff | hist) (+474) N CPD-7036 (Created page with "Category:metabolite == Metabolite CPD-7036 == * common-name: ** 3-methylthiopropanal * molecular-weight: ** 104.167 * smiles: ** csccc=o * inchi-key: ** cluwowrthnnbbu-uhf...") (current)
- 10:29, 15 June 2021 (diff | hist) (+571) N CPD-18312 (Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * molecular-weight: ** 201.182 * smiles: ** c([o-])(=o)c=cc(=o)ncc(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+451) N HG+2 (Created page with "Category:metabolite == Metabolite HG+2 == * common-name: ** hg2+ * molecular-weight: ** 200.59 * smiles: ** [hg++] * inchi-key: ** bqpiggfysbelgy-uhfffaoysa-n == Reaction(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+592) N CARBAMYUL-L-ASPARTATE (Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * molecular-weight: ** 174.113 * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o...") (current)
- 10:29, 15 June 2021 (diff | hist) (+689) N 2-OXOBUTANOATE (Created page with "Category:metabolite == Metabolite 2-OXOBUTANOATE == * common-name: ** 2-oxobutanoate * molecular-weight: ** 101.082 * smiles: ** ccc(=o)c(=o)[o-] * inchi-key: ** tyeybosbb...") (current)
- 10:29, 15 June 2021 (diff | hist) (+675) N CPD-13699 (Created page with "Category:metabolite == Metabolite CPD-13699 == * common-name: ** 3,22-dioxochol-4-en-24-oyl-coa * molecular-weight: ** 1132.017 * smiles: ** cc(c(=o)cc(=o)sccnc(=o)ccnc(=o...") (current)
- 10:29, 15 June 2021 (diff | hist) (+533) N CPD-3710 (Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * molecular-weight: ** 321.183 * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+403) N N-ACETYL-D-GLUCOSAMINE-6-P (Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-6-P == * common-name: ** n-acetyl-d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * PH...") (current)
- 10:29, 15 June 2021 (diff | hist) (+555) N 5-HYDROXYISOURATE (Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * molecular-weight: ** 184.111 * smiles: ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o...") (current)
- 10:29, 15 June 2021 (diff | hist) (+356) N Ribonucleoside-Monophosphates (Created page with "Category:metabolite == Metabolite Ribonucleoside-Monophosphates == * common-name: ** a ribonucleoside 5'-monophosphate == Reaction(s) known to consume the compound == * ...") (current)
- 10:29, 15 June 2021 (diff | hist) (+515) N L-XYLULOSE (Created page with "Category:metabolite == Metabolite L-XYLULOSE == * common-name: ** l-xylulose * molecular-weight: ** 150.131 * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte...") (current)
- 10:29, 15 June 2021 (diff | hist) (+318) N Mannosyl5-N-acetyl-glucosamine2-R (Created page with "Category:metabolite == Metabolite Mannosyl5-N-acetyl-glucosamine2-R == * common-name: ** man5glcnac3-[protein] == Reaction(s) known to consume the compound == == Reaction(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+686) N L-DEHYDRO-ASCORBATE (Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * molecular-weight: ** 174.11 * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * i...") (current)
- 10:29, 15 June 2021 (diff | hist) (+558) N CPD-3707 (Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * molecular-weight: ** 328.201 * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)...") (current)
- 10:29, 15 June 2021 (diff | hist) (+635) N Alcohols (Created page with "Category:metabolite == Metabolite Alcohols == * common-name: ** an alcohol == Reaction(s) known to consume the compound == * ALCOHOL-DEHYDROGENASE-NADP+-RXN == Reactio...") (current)
- 10:29, 15 June 2021 (diff | hist) (+462) N AMINOMETHYLDIHYDROLIPOYL-GCVH (Created page with "Category:metabolite == Metabolite AMINOMETHYLDIHYDROLIPOYL-GCVH == * common-name: ** a [glycine-cleavage complex h protein] n6-aminomethyldihydrolipoyl-l-lysine == Reactio...") (current)
- 10:29, 15 June 2021 (diff | hist) (+327) N VibB (Created page with "Category:metabolite == Metabolite VibB == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reaction(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+829) N FAD (Created page with "Category:metabolite == Metabolite FAD == * common-name: ** fad * molecular-weight: ** 782.533 * smiles: ** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])...") (current)
- 10:29, 15 June 2021 (diff | hist) (+611) N CPD0-1422 (Created page with "Category:metabolite == Metabolite CPD0-1422 == * common-name: ** dipalmitoyl phosphatidate * molecular-weight: ** 646.883 * smiles: ** cccccccccccccccc(=o)occ(cop(=o)([o-]...") (current)
- 10:29, 15 June 2021 (diff | hist) (+276) N MALTOSE (Created page with "Category:metabolite == Metabolite MALTOSE == * common-name: ** maltose == Reaction(s) known to consume the compound == * RXN-15910 == Reaction(s) known to produce the...") (current)
- 10:29, 15 June 2021 (diff | hist) (+534) N CPD1F-120 (Created page with "Category:metabolite == Metabolite CPD1F-120 == * common-name: ** gibberellin a24 * molecular-weight: ** 344.407 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+638) N METHYL-GLYOXAL (Created page with "Category:metabolite == Metabolite METHYL-GLYOXAL == * common-name: ** methylglyoxal * molecular-weight: ** 72.063 * smiles: ** cc([ch]=o)=o * inchi-key: ** aijulsrzwuxgpq-...") (current)
- 10:29, 15 June 2021 (diff | hist) (+395) N Mitogen-Activated-Protein-Kinase-L-Thr (Created page with "Category:metabolite == Metabolite Mitogen-Activated-Protein-Kinase-L-Thr == * common-name: ** a [mitogen-activated protein kinase]-l-threonine == Reaction(s) known to cons...") (current)
- 10:29, 15 June 2021 (diff | hist) (+643) N CPD-19160 (Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * molecular-weight: ** 1041.936 * smiles: ** ccccccc=ccccccccc(=o)cc(=o)sccnc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+555) N CPDQT-38 (Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * molecular-weight: ** 248.293 * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-...") (current)
- 10:29, 15 June 2021 (diff | hist) (+648) N CPD-15687 (Created page with "Category:metabolite == Metabolite CPD-15687 == * common-name: ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa * molecular-weight: ** 983.813 * smiles: ** ccccccc=cc=ccc(=o)cc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+606) N CPD-9867 (Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * molecular-weight: ** 791.294 * smiles: ** cc(=cccc(=cccc(=cccc(=...") (current)
- 10:29, 15 June 2021 (diff | hist) (+409) N Charged-ARG-tRNAs (Created page with "Category:metabolite == Metabolite Charged-ARG-tRNAs == * common-name: ** an l-arginyl-[trnaarg] == Reaction(s) known to consume the compound == * [[ARGINYLTRANSFERASE-RXN]...") (current)
- 10:29, 15 June 2021 (diff | hist) (+523) N CPD-596 (Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * molecular-weight: ** 203.264 * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * in...") (current)
- 10:29, 15 June 2021 (diff | hist) (+306) N 23S-rRNA-uridine-2552 (Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine-2552 == * common-name: ** uridine2552 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11845 == Rea...") (current)
- 10:29, 15 June 2021 (diff | hist) (+628) N RIBOFLAVIN (Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * molecular-weight: ** 375.36 * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-...") (current)
- 10:29, 15 June 2021 (diff | hist) (+643) N 4-CYTIDINE-5-DIPHOSPHO-2-C (Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * molecular-weight: ** 519.295 * smiles...") (current)
- 10:29, 15 June 2021 (diff | hist) (+310) N Demethylated-Ubiquinols (Created page with "Category:metabolite == Metabolite Demethylated-Ubiquinols == * common-name: ** a demethylated ubiquinol == Reaction(s) known to consume the compound == * RXN-11758 ==...") (current)
- 10:29, 15 June 2021 (diff | hist) (+321) N 5-P-purine-mRNAs (Created page with "Category:metabolite == Metabolite 5-P-purine-mRNAs == * common-name: ** a 5'-phosphopurine-[mrna] == Reaction(s) known to consume the compound == * RXN-12817 == Reacti...") (current)
- 10:29, 15 June 2021 (diff | hist) (+604) N 5-P-BETA-D-RIBOSYL-AMINE (Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * molecular-weight: ** 228.118 * smiles: ** c(op([o-])(=o)[...") (current)
- 10:29, 15 June 2021 (diff | hist) (+600) N CHLOROPHYLLIDE-A (Created page with "Category:metabolite == Metabolite CHLOROPHYLLIDE-A == * common-name: ** chlorophyllide a * molecular-weight: ** 612.967 * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c...") (current)
- 10:29, 15 June 2021 (diff | hist) (+349) N VERY-LONG-CHAIN-FATTY-ACYL-COA (Created page with "Category:metabolite == Metabolite VERY-LONG-CHAIN-FATTY-ACYL-COA == * common-name: ** a very long chain fatty acyl-coa == Reaction(s) known to consume the compound == * ...") (current)
- 10:29, 15 June 2021 (diff | hist) (+597) N CPD-14925 (Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * molecular-weight: ** 915.738 * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)c...") (current)
- 10:29, 15 June 2021 (diff | hist) (+538) N CPD-712 (Created page with "Category:metabolite == Metabolite CPD-712 == * common-name: ** 6-deoxocathasterone * molecular-weight: ** 418.702 * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]...") (current)
- 10:29, 15 June 2021 (diff | hist) (+417) N S-ubiquitinyl-HECT-E3-UCP-L-cysteine (Created page with "Category:metabolite == Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine == * common-name: ** a [hect-type e3 ubiquitin transferase]-s-ubiquitinyl-l-cysteine == Reaction(s)...") (current)
- 10:29, 15 June 2021 (diff | hist) (+330) N Cis-21-CP-39-keto-40-Me-C60-ACPs (Created page with "Category:metabolite == Metabolite cis-21-CP-39-keto-40-Me-C60-ACPs == * common-name: ** a cis-keto-c60-meroacyl-[acp] == Reaction(s) known to consume the compound == == Re...") (current)
- 10:29, 15 June 2021 (diff | hist) (+606) N CPD-8166 (Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * molecular-weight: ** 777.089 * smiles: ** cccccc=ccc=ccccccccc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+327) N 23S-rRNA-pseudouridine1915 (Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine1915 == * common-name: ** a pseudouridine1915 in 23s rrna == Reaction(s) known to consume the compound == * RXN-1...") (current)
- 10:29, 15 June 2021 (diff | hist) (+542) N CPD-9091 (Created page with "Category:metabolite == Metabolite CPD-9091 == * common-name: ** bacteriochlorophyll b * molecular-weight: ** 908.494 * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)...") (current)
- 10:29, 15 June 2021 (diff | hist) (+332) N TRNA-Containing-N1-MethylAdenine-58 (Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-MethylAdenine-58 == * common-name: ** an n1-methyladenine58 in trna == Reaction(s) known to consume the compound == ==...") (current)
- 10:29, 15 June 2021 (diff | hist) (+641) N CPD-17815 (Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * molecular-weight: ** 1013.883 * smiles: ** ccccc=ccccccccc(=o)cc(=o)sccnc(=...") (current)
- 10:29, 15 June 2021 (diff | hist) (+222) N CPD-24185 (Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...") (current)
- 10:29, 15 June 2021 (diff | hist) (+513) N CPDQT-41 (Created page with "Category:metabolite == Metabolite CPDQT-41 == * common-name: ** 10-(methylthio)-2-oxodecanoate * molecular-weight: ** 231.329 * smiles: ** csccccccccc(=o)c([o-])=o * inchi...") (current)
- 10:29, 15 June 2021 (diff | hist) (+658) N PHE (Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * molecular-weight: ** 165.191 * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** col...") (current)
- 10:29, 15 June 2021 (diff | hist) (+521) N CPD-11020 (Created page with "Category:metabolite == Metabolite CPD-11020 == * common-name: ** 5-chloro-4-hydroxy-2-oxopentanoate * molecular-weight: ** 165.553 * smiles: ** c(=o)([o-])c(=o)cc(o)ccl *...") (current)
- 10:29, 15 June 2021 (diff | hist) (+748) N CPD-1107 (Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * molecular-weight: ** 569.977 * smiles: ** c1(o)(c(op([o-])([o-...") (current)
- 10:29, 15 June 2021 (diff | hist) (+547) N CPD-318 (Created page with "Category:metabolite == Metabolite CPD-318 == * common-name: ** monodehydroascorbate radical * molecular-weight: ** 175.118 * smiles: ** c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1) * i...") (current)
- 10:29, 15 June 2021 (diff | hist) (+548) N SINAPALDEHYDE (Created page with "Category:metabolite == Metabolite SINAPALDEHYDE == * common-name: ** sinapaldehyde * molecular-weight: ** 208.213 * smiles: ** coc1(c=c(c=cc=o)c=c(oc)c(o)=1) * inchi-key:...") (current)
- 10:29, 15 June 2021 (diff | hist) (+329) N Type-4-H-Antigen (Created page with "Category:metabolite == Metabolite Type-4-H-Antigen == * common-name: ** an h type 4 histo-blood group antigen == Reaction(s) known to consume the compound == == Reaction(s...") (current)
- 10:29, 15 June 2021 (diff | hist) (+359) N D-Glc-NAc--Glycoproteins (Created page with "Category:metabolite == Metabolite D-Glc-NAc--Glycoproteins == * common-name: ** an n-acetyl-β-d-glucosaminyl-[glycoprotein] == Reaction(s) known to consume the compou...") (current)
- 10:29, 15 June 2021 (diff | hist) (+781) N C3 (Created page with "Category:metabolite == Metabolite C3 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine * molecular-weight: ** 114...") (current)
- 10:29, 15 June 2021 (diff | hist) (+286) N Alpha-tubulins (Created page with "Category:metabolite == Metabolite Alpha-tubulins == * common-name: ** α-tubulin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") (current)
- 10:29, 15 June 2021 (diff | hist) (+314) N Very-Long-Chain-Alcohols (Created page with "Category:metabolite == Metabolite Very-Long-Chain-Alcohols == * common-name: ** a very long chain alcohol == Reaction(s) known to consume the compound == * RXNQT-4193...") (current)
- 10:29, 15 June 2021 (diff | hist) (+462) N PROPIONAMIDE (Created page with "Category:metabolite == Metabolite PROPIONAMIDE == * common-name: ** propionamide * molecular-weight: ** 73.094 * smiles: ** ccc(n)=o * inchi-key: ** qlnjfjadrcogbj-uhfffao...") (current)
- 10:29, 15 June 2021 (diff | hist) (+349) N L-methionyl-glycyl-Protein (Created page with "Category:metabolite == Metabolite L-methionyl-glycyl-Protein == * common-name: ** an n-terminal-l-methionyl-glycyl-[protein] == Reaction(s) known to consume the compound =...") (current)
- 10:29, 15 June 2021 (diff | hist) (+494) N CPD-17640 (Created page with "Category:metabolite == Metabolite CPD-17640 == * common-name: ** 18-hydroxystearate * molecular-weight: ** 299.473 * smiles: ** c(o)ccccccccccccccccc([o-])=o * inchi-key:...") (current)
- 10:29, 15 June 2021 (diff | hist) (+478) N ARSENATE (Created page with "Category:metabolite == Metabolite ARSENATE == * common-name: ** arsenate * molecular-weight: ** 139.927 * smiles: ** [as](=o)(o)([o-])[o-] * inchi-key: ** djhgafsjwgloiv-u...") (current)
- 10:29, 15 June 2021 (diff | hist) (+502) N MELIBIOSE (Created page with "Category:metabolite == Metabolite MELIBIOSE == * common-name: ** melibiose * molecular-weight: ** 342.299 * smiles: ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o * inch...") (current)
- 10:29, 15 June 2021 (diff | hist) (+634) N PROTOPORPHYRINOGEN (Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * molecular-weight: ** 566.699 * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n...") (current)
- 10:29, 15 June 2021 (diff | hist) (+364) N Thyroglobulin-3-iodotyrosines (Created page with "Category:metabolite == Metabolite Thyroglobulin-3-iodotyrosines == * common-name: ** a [thyroglobulin]-3-iodotyrosine == Reaction(s) known to consume the compound == * R...") (current)
- 10:29, 15 June 2021 (diff | hist) (+499) N CPD-12724 (Created page with "Category:metabolite == Metabolite CPD-12724 == * common-name: ** baicalein * molecular-weight: ** 270.241 * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))...") (current)
- 10:29, 15 June 2021 (diff | hist) (+560) N CPD-12365 (Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * molecular-weight: ** 361.207 * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+532) N MG-PROTOPORPHYRIN (Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN == * common-name: ** mg-protoporphyrin * molecular-weight: ** 582.94 * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-]...") (current)
- 10:29, 15 June 2021 (diff | hist) (+523) N CPD-7214 (Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * molecular-weight: ** 303.248 * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=c...") (current)
- 10:29, 15 June 2021 (diff | hist) (+512) N CPD-7025 (Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * molecular-weight: ** 374.499 * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])...") (current)
- 10:29, 15 June 2021 (diff | hist) (+639) N CPD-2182 (Created page with "Category:metabolite == Metabolite CPD-2182 == * common-name: ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine * molecular-weight: ** 782.092 * smiles: ** cccccc=ccc=cccccccc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+305) N CHITIN (Created page with "Category:metabolite == Metabolite CHITIN == * common-name: ** chitin == Reaction(s) known to consume the compound == * 3.2.1.14-RXN * CHITIN-DEACETYLASE-RXN * RX...") (current)
- 10:29, 15 June 2021 (diff | hist) (+584) N CPD-465 (Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * molecular-weight: ** 583.66 * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)...") (current)
- 10:29, 15 June 2021 (diff | hist) (+469) N CPD-10490 (Created page with "Category:metabolite == Metabolite CPD-10490 == * common-name: ** n-ethylglycine * molecular-weight: ** 102.113 * smiles: ** ccncc(=o)[o-] * inchi-key: ** ypiggyhfmkjnkv-uh...") (current)
- 10:29, 15 June 2021 (diff | hist) (+440) N BR- (Created page with "Category:metabolite == Metabolite BR- == * common-name: ** bromide * molecular-weight: ** 79.904 * smiles: ** [br-] * inchi-key: ** cpelxlsauqhcox-uhfffaoysa-m == Reaction...") (current)
- 10:29, 15 June 2021 (diff | hist) (+585) N CPD-208 (Created page with "Category:metabolite == Metabolite CPD-208 == * common-name: ** (s)-malyl-coa * molecular-weight: ** 878.568 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop...") (current)
- 10:29, 15 June 2021 (diff | hist) (+625) N CPD-12905 (Created page with "Category:metabolite == Metabolite CPD-12905 == * common-name: ** 3-hydroxy-5-methylhex-4-enoyl-coa * molecular-weight: ** 889.657 * smiles: ** cc(c)=cc(o)cc(=o)sccnc(=o)cc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+644) N CPD0-2253 (Created page with "Category:metabolite == Metabolite CPD0-2253 == * common-name: ** (s)-3-hydroxy-stearoyl-coa * molecular-weight: ** 1045.968 * smiles: ** cccccccccccccccc(o)cc(=o)sccnc(=o)...") (current)
- 10:29, 15 June 2021 (diff | hist) (+478) N L-GULONATE (Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * molecular-weight: ** 195.149 * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghn...") (current)
- 10:29, 15 June 2021 (diff | hist) (+664) N COPROPORPHYRINOGEN III (Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * molecular-weight: ** 656.734 * smiles: ** cc1(=c2(cc5(=c(c)c(ccc([o-...") (current)
- 10:29, 15 June 2021 (diff | hist) (+567) N SHIKIMATE (Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * molecular-weight: ** 173.145 * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxoh...") (current)
- 10:29, 15 June 2021 (diff | hist) (+483) N PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA (Created page with "Category:metabolite == Metabolite PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 4,5-bisphosphate == Reaction(s) known to co...") (current)
- 10:29, 15 June 2021 (diff | hist) (+647) N CPD-4577 (Created page with "Category:metabolite == Metabolite CPD-4577 == * common-name: ** 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol * molecular-weight: ** 441.673 * smi...") (current)
- 10:29, 15 June 2021 (diff | hist) (+514) N ETR-Quinones (Created page with "Category:metabolite == Metabolite ETR-Quinones == * common-name: ** an electron-transfer quinone == Reaction(s) known to consume the compound == * DIHYDROOROTATE-DEHYDRO...") (current)
- 10:29, 15 June 2021 (diff | hist) (+626) N CPD-7064 (Created page with "Category:metabolite == Metabolite CPD-7064 == * common-name: ** primary fluorescent chlorophyll catabolite * molecular-weight: ** 626.708 * smiles: ** ccc1(c(c)=c(nc=1cc4(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+2,702) N UDP (Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * molecular-weight: ** 401.14 * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2...") (current)
- 10:29, 15 June 2021 (diff | hist) (+495) N 3-7-DIMETHYLXANTHINE (Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * molecular-weight: ** 180.166 * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+383) N N-TETRADECANOYLGLYCYL-PEPTIDE (Created page with "Category:metabolite == Metabolite N-TETRADECANOYLGLYCYL-PEPTIDE == * common-name: ** n-tetradecanoylglycyl-peptide * smiles: ** cccccccccccccc(=o)c(n)c(=o)nc([r])c(=o)o ==...") (current)
- 10:29, 15 June 2021 (diff | hist) (+310) N Supercoiled-Duplex-DNAs (Created page with "Category:metabolite == Metabolite Supercoiled-Duplex-DNAs == * common-name: ** a supercoiled duplex dna == Reaction(s) known to consume the compound == * RXN0-4261 ==...") (current)
- 10:29, 15 June 2021 (diff | hist) (+736) N 2-KETO-3-METHYL-VALERATE (Created page with "Category:metabolite == Metabolite 2-KETO-3-METHYL-VALERATE == * common-name: ** (s)-3-methyl-2-oxopentanoate * molecular-weight: ** 129.135 * smiles: ** ccc(c)c(=o)c([o-])...") (current)
- 10:29, 15 June 2021 (diff | hist) (+565) N 44-DIMETHYL-824-CHOLESTADIENOL (Created page with "Category:metabolite == Metabolite 44-DIMETHYL-824-CHOLESTADIENOL == * common-name: ** 4,4-dimethylzymosterol * molecular-weight: ** 412.698 * smiles: ** cc(c)=cccc(c)[ch]3...") (current)
- 10:29, 15 June 2021 (diff | hist) (+700) N GLYCERALD (Created page with "Category:metabolite == Metabolite GLYCERALD == * common-name: ** d-glyceraldehyde * molecular-weight: ** 90.079 * smiles: ** [ch](=o)c(o)co * inchi-key: ** mnqzxjomywmbou-...") (current)
- 10:29, 15 June 2021 (diff | hist) (+281) N GLY-tRNAs (Created page with "Category:metabolite == Metabolite GLY-tRNAs == * common-name: ** a trnagly == Reaction(s) known to consume the compound == * GLYCINE--TRNA-LIGASE-RXN == Reaction(s) kn...") (current)
- 10:29, 15 June 2021 (diff | hist) (+514) N 2-3-DIHYDROXYBENZOATE (Created page with "Category:metabolite == Metabolite 2-3-DIHYDROXYBENZOATE == * common-name: ** 2,3-dihydroxybenzoate * molecular-weight: ** 153.114 * smiles: ** c(c1(=cc=cc(=c1o)o))([o-])=o...") (current)
- 10:29, 15 June 2021 (diff | hist) (+497) N CPD-10330 (Created page with "Category:metabolite == Metabolite CPD-10330 == * common-name: ** α-d-ribofuranose * molecular-weight: ** 150.131 * smiles: ** c(c1(c(c(c(o1)o)o)o))o * inchi-key: **...") (current)
- 10:29, 15 June 2021 (diff | hist) (+563) N CPD-1803 (Created page with "Category:metabolite == Metabolite CPD-1803 == * common-name: ** n-acetyl-7-o-acetylneuraminate * molecular-weight: ** 350.302 * smiles: ** cc(=o)nc1(c(cc(c(=o)[o-])(o)o[ch...") (current)
- 10:29, 15 June 2021 (diff | hist) (+585) N CPD-8077 (Created page with "Category:metabolite == Metabolite CPD-8077 == * common-name: ** 1-18:1-2-16:2-monogalactosyldiacylglycerol * molecular-weight: ** 753.067 * smiles: ** ccccccccc=ccccccccc(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+356) N 23S-rRNA-N3-methylpseudouridine1915 (Created page with "Category:metabolite == Metabolite 23S-rRNA-N3-methylpseudouridine1915 == * common-name: ** an n3-methylpseudouridine1915 in 23s rrna == Reaction(s) known to consume the co...") (current)
- 10:29, 15 June 2021 (diff | hist) (+747) N TETRACOSANOATE (Created page with "Category:metabolite == Metabolite TETRACOSANOATE == * common-name: ** lignocerate * molecular-weight: ** 367.634 * smiles: ** cccccccccccccccccccccccc([o-])=o * inchi-key:...") (current)
- 10:29, 15 June 2021 (diff | hist) (+665) N 1-L-MYO-INOSITOL-1-P (Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * molecular-weight: ** 258.121 * smiles: ** c1(o)(c(o)c(o)c(op(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+632) N CPD-9451 (Created page with "Category:metabolite == Metabolite CPD-9451 == * common-name: ** 2-isopropylmaleate * molecular-weight: ** 156.138 * smiles: ** cc(c(c(=o)[o-])=cc(=o)[o-])c * inchi-key: **...") (current)
- 10:29, 15 June 2021 (diff | hist) (+607) N MALTOTETRAOSE (Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * smiles: ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o...") (current)
- 10:29, 15 June 2021 (diff | hist) (+615) N COPROPORPHYRIN III (Created page with "Category:metabolite == Metabolite COPROPORPHYRIN_III == * common-name: ** coproporphyrin iii * molecular-weight: ** 650.687 * smiles: ** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+327) N 23S-rRNA-pseudouridine2605 (Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine2605 == * common-name: ** a pseudouridine2605 in 23s rrna == Reaction(s) known to consume the compound == == Reacti...") (current)
- 10:29, 15 June 2021 (diff | hist) (+634) N LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE (Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * molecular-weight: ** 636.476 * smiles: ** c(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+390) N OH-ACYL-ACP (Created page with "Category:metabolite == Metabolite OH-ACYL-ACP == * common-name: ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 3-HYDROX...") (current)
- 10:29, 15 June 2021 (diff | hist) (+335) N DIHYDROFOLATE-GLU-N (Created page with "Category:metabolite == Metabolite DIHYDROFOLATE-GLU-N == * common-name: ** a 7,8-dihydrofolate == Reaction(s) known to consume the compound == * [[DIHYDROFOLATEREDUCT-RXN]...") (current)
- 10:29, 15 June 2021 (diff | hist) (+486) N CPD-8773 (Created page with "Category:metabolite == Metabolite CPD-8773 == * common-name: ** 4-methylbenzaldehyde * molecular-weight: ** 120.151 * smiles: ** cc1(c=cc(c=o)=cc=1) * inchi-key: ** fxlovs...") (current)
- 10:29, 15 June 2021 (diff | hist) (+508) N INDOLEYL-CPD (Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * molecular-weight: ** 156.187 * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inc...") (current)
- 10:29, 15 June 2021 (diff | hist) (+336) N N-Acylphosphatidylethanolamines (Created page with "Category:metabolite == Metabolite N-Acylphosphatidylethanolamines == * common-name: ** an n-acylphosphatidylethanolamine == Reaction(s) known to consume the compound == *...") (current)
- 10:29, 15 June 2021 (diff | hist) (+552) N DMPBQ (Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 416.686 * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(...") (current)
- 10:29, 15 June 2021 (diff | hist) (+525) N CPD-674 (Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * molecular-weight: ** 147.153 * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1) * inchi-key: ** wbyw...") (current)
- 10:29, 15 June 2021 (diff | hist) (+487) N CPD-19042 (Created page with "Category:metabolite == Metabolite CPD-19042 == * common-name: ** 2-hydroxyisobutyramide * molecular-weight: ** 103.121 * smiles: ** cc(o)(c)c(=o)n * inchi-key: ** drymmxub...") (current)
- 10:29, 15 June 2021 (diff | hist) (+503) N CPD-13403 (Created page with "Category:metabolite == Metabolite CPD-13403 == * common-name: ** l-alanyl-l-glutamine * molecular-weight: ** 217.224 * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inch...") (current)
- 10:29, 15 June 2021 (diff | hist) (+320) N 5-Methylcytosine-48-tRNAs (Created page with "Category:metabolite == Metabolite 5-Methylcytosine-48-tRNAs == * common-name: ** a 5-methylcytosine48 in trna == Reaction(s) known to consume the compound == == Reaction(s...") (current)
- 10:28, 15 June 2021 (diff | hist) (+654) N CPD-19168 (Created page with "Category:metabolite == Metabolite CPD-19168 == * common-name: ** (s)-3-hydroxy-(7z)-hexadecenoyl-coa * molecular-weight: ** 1015.898 * smiles: ** ccccccccc=ccccc(o)cc(=o)s...") (current)
- 10:28, 15 June 2021 (diff | hist) (+604) N B-ALANINE (Created page with "Category:metabolite == Metabolite B-ALANINE == * common-name: ** β-alanine * molecular-weight: ** 89.094 * smiles: ** c(c[n+])c([o-])=o * inchi-key: ** ucmirnveixfbks...") (current)
- 10:28, 15 June 2021 (diff | hist) (+619) N CREATINE (Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * molecular-weight: ** 131.134 * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxh...") (current)
- 10:28, 15 June 2021 (diff | hist) (+530) N DIHYDROXYNAPHTHOATE (Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * molecular-weight: ** 203.174 * smiles: ** c([o-])(=o)c1(=c(o)c2(=c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+596) N SHIKIMATE-5P (Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * common-name: ** shikimate 3-phosphate * molecular-weight: ** 251.109 * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+371) N Ubiquitin-C-Terminal-Glycine (Created page with "Category:metabolite == Metabolite Ubiquitin-C-Terminal-Glycine == * common-name: ** a [ubiquitin] c-terminal glycine == Reaction(s) known to consume the compound == * UB...") (current)
- 10:28, 15 June 2021 (diff | hist) (+537) N CPD-374 (Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * molecular-weight: ** 237.218 * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key...") (current)
- 10:28, 15 June 2021 (diff | hist) (+328) N Aryl-Dialkyl-Phosphate (Created page with "Category:metabolite == Metabolite Aryl-Dialkyl-Phosphate == * common-name: ** an aryl dialkyl phosphate == Reaction(s) known to consume the compound == * ARYLDIALKYLPHOS...") (current)
- 10:28, 15 June 2021 (diff | hist) (+515) N EPISTEROL (Created page with "Category:metabolite == Metabolite EPISTEROL == * common-name: ** episterol * molecular-weight: ** 398.671 * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+552) N DIETHYLTHIOPHOSPHATE (Created page with "Category:metabolite == Metabolite DIETHYLTHIOPHOSPHATE == * common-name: ** diethylthiophosphate * molecular-weight: ** 169.155 * smiles: ** ccop(=s)([o-])occ * inchi-key:...") (current)
- 10:28, 15 June 2021 (diff | hist) (+667) N GLC (Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * molecular-weight: ** 180.157 * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wq...") (current)
- 10:28, 15 June 2021 (diff | hist) (+433) N L-Cysteine-Desulfurase-persulfide (Created page with "Category:metabolite == Metabolite L-Cysteine-Desulfurase-persulfide == * common-name: ** an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine == Reaction(s) known to consume...") (current)
- 10:28, 15 June 2021 (diff | hist) (+480) N CPD-4441 (Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * molecular-weight: ** 219.246 * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) * inchi-key: ** uz...") (current)
- 10:28, 15 June 2021 (diff | hist) (+623) N CPD-9859 (Created page with "Category:metabolite == Metabolite CPD-9859 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol * molecular-weight: ** 630.993 * smiles: ** cc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+603) N CPD-10260 (Created page with "Category:metabolite == Metabolite CPD-10260 == * common-name: ** 3-oxo-stearoyl-coa * molecular-weight: ** 1043.952 * smiles: ** cccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+352) N Cis-Delta7-tetradecenoyl-ACPs (Created page with "Category:metabolite == Metabolite Cis-Delta7-tetradecenoyl-ACPs == * common-name: ** a cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume the compound == * [...") (current)
- 10:28, 15 June 2021 (diff | hist) (+342) N Double-Stranded-DNAs (Created page with "Category:metabolite == Metabolite Double-Stranded-DNAs == * common-name: ** a double stranded dna == Reaction(s) known to consume the compound == * 3.1.21.4-RXN * 5....") (current)
- 10:28, 15 June 2021 (diff | hist) (+258) N DNA-Holder (Created page with "Category:metabolite == Metabolite DNA-Holder == * common-name: ** dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 3...") (current)
- 10:28, 15 June 2021 (diff | hist) (+697) N CPD-11521 (Created page with "Category:metabolite == Metabolite CPD-11521 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-hexanoyl-coa * molecular-weight: ** 1011.867 * smiles: ** ccc=ccc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+392) N Reduced-flavodoxins (Created page with "Category:metabolite == Metabolite Reduced-flavodoxins == * common-name: ** a reduced flavodoxin == Reaction(s) known to consume the compound == * FLAVONADPREDUCT-RXN *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+538) N CPD-474 (Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * molecular-weight: ** 303.248 * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+335) N Trans-delta2-behenoyl-ACPs (Created page with "Category:metabolite == Metabolite trans-delta2-behenoyl-ACPs == * common-name: ** a trans-docos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-488...") (current)
- 10:28, 15 June 2021 (diff | hist) (+309) N TRNA-pseudouridine13 (Created page with "Category:metabolite == Metabolite tRNA-pseudouridine13 == * common-name: ** a pseudouridine13 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...") (current)
- 10:28, 15 June 2021 (diff | hist) (+512) N SEROTONIN (Created page with "Category:metabolite == Metabolite SEROTONIN == * common-name: ** serotonin * molecular-weight: ** 177.225 * smiles: ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) * inchi-key: ** qza...") (current)
- 10:28, 15 June 2021 (diff | hist) (+291) N TRNA-uridine65 (Created page with "Category:metabolite == Metabolite tRNA-uridine65 == * common-name: ** a uridine65 in trna == Reaction(s) known to consume the compound == * RXN-11840 == Reaction(s) kn...") (current)
- 10:28, 15 June 2021 (diff | hist) (+465) N CPD-678 (Created page with "Category:metabolite == Metabolite CPD-678 == * common-name: ** hydrogen selenide * molecular-weight: ** 80.976 * smiles: ** [seh2] * inchi-key: ** spvxkvoxsxtjoy-uhfffaoys...") (current)
- 10:28, 15 June 2021 (diff | hist) (+590) N CPD-11401 (Created page with "Category:metabolite == Metabolite CPD-11401 == * common-name: ** l-thyroxine acyl β-d-glucuronide * molecular-weight: ** 951.992 * smiles: ** c([o-])(=o)c1(oc(c(o)c(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+363) N 3-oxo-cis-D9-hexadecenoyl-ACPs (Created page with "Category:metabolite == Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume the compound...") (current)
- 10:28, 15 June 2021 (diff | hist) (+398) N Odd-Straight-Chain-234-Sat-FA (Created page with "Category:metabolite == Metabolite Odd-Straight-Chain-234-Sat-FA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acid == Reaction(s) known to cons...") (current)
- 10:28, 15 June 2021 (diff | hist) (+909) N SUC-COA (Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * molecular-weight: ** 862.568 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+636) N 2-OCTAPRENYL-6-METHOXYPHENOL (Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * molecular-weight: ** 669.085 * smiles: ** cc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+419) N Long-Chain-Fatty-Acids (Created page with "Category:metabolite == Metabolite Long-Chain-Fatty-Acids == * common-name: ** a long-chain fatty acid == Reaction(s) known to consume the compound == * [[ACYLACPSYNTH-RXN]...") (current)
- 10:28, 15 June 2021 (diff | hist) (+295) N Reduced-Quinones (Created page with "Category:metabolite == Metabolite Reduced-Quinones == * common-name: ** a quinol == Reaction(s) known to consume the compound == * 1.10.99.2-RXN == Reaction(s) known t...") (current)
- 10:28, 15 June 2021 (diff | hist) (+620) N CPD-12897 (Created page with "Category:metabolite == Metabolite CPD-12897 == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * molecular-weight: ** 915.695 * smiles: ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccn...") (current)
- 10:28, 15 June 2021 (diff | hist) (+484) N CPD-17637 (Created page with "Category:metabolite == Metabolite CPD-17637 == * common-name: ** 7-hydroxylaurate * molecular-weight: ** 215.312 * smiles: ** cccccc(o)cccccc([o-])=o * inchi-key: ** bnwkm...") (current)
- 10:28, 15 June 2021 (diff | hist) (+701) N PUTRESCINE (Created page with "Category:metabolite == Metabolite PUTRESCINE == * common-name: ** putrescine * molecular-weight: ** 90.168 * smiles: ** c([n+])ccc[n+] * inchi-key: ** kidhwzjucrjvml-uhfff...") (current)
- 10:28, 15 June 2021 (diff | hist) (+467) N CPD-1113 (Created page with "Category:metabolite == Metabolite CPD-1113 == * common-name: ** 6-(α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol * smiles: ** c(o)c2(c(c(o)c([n+])c(oc1(c(c(o)c(o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+397) N MAP-Kinase-L-Phosphotyrosine (Created page with "Category:metabolite == Metabolite MAP-Kinase-L-Phosphotyrosine == * common-name: ** a [mitogen-activated protein kinase] l-tyrosine phosphate == Reaction(s) known to consu...") (current)
- 10:28, 15 June 2021 (diff | hist) (+985) N CROTONYL-COA (Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * molecular-weight: ** 831.577 * smiles: ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+654) N CPD-19155 (Created page with "Category:metabolite == Metabolite CPD-19155 == * common-name: ** (s)-3-hydroxy-(9z)-hexadecenoyl-coa * molecular-weight: ** 1015.898 * smiles: ** ccccccc=ccccccc(o)cc(=o)s...") (current)
- 10:28, 15 June 2021 (diff | hist) (+339) N 23S-rRNA-N7-methylguanine-2069 (Created page with "Category:metabolite == Metabolite 23S-rRNA-N7-methylguanine-2069 == * common-name: ** an n7-methylguanine2069 in 23s rrna == Reaction(s) known to consume the compound == =...") (current)
- 10:28, 15 June 2021 (diff | hist) (+524) N CPD-271 (Created page with "Category:metabolite == Metabolite CPD-271 == * common-name: ** testosterone acetate * molecular-weight: ** 330.466 * smiles: ** cc(oc4(cc[ch]3([ch]2(ccc1(=cc(ccc1([ch]2ccc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+539) N CPD-590 (Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * molecular-weight: ** 306.271 * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+299) N Cytosine-38-in-tRNAs (Created page with "Category:metabolite == Metabolite Cytosine-38-in-tRNAs == * common-name: ** a cytosine38 in trna == Reaction(s) known to consume the compound == * RXN-11855 == Reactio...") (current)
- 10:28, 15 June 2021 (diff | hist) (+370) N Hepta-oxo-hexadecanoyl-ACPs (Created page with "Category:metabolite == Metabolite Hepta-oxo-hexadecanoyl-ACPs == * common-name: ** a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp] == Reaction(s) known to consume the...") (current)
- 10:28, 15 June 2021 (diff | hist) (+453) N IODINE-MOLECULE (Created page with "Category:metabolite == Metabolite IODINE-MOLECULE == * common-name: ** i2 * molecular-weight: ** 253.809 * smiles: ** ii * inchi-key: ** pndpgzbmcmupri-uhfffaoysa-n == Rea...") (current)
- 10:28, 15 June 2021 (diff | hist) (+663) N CPD-17331 (Created page with "Category:metabolite == Metabolite CPD-17331 == * common-name: ** (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa * molecular-weight: ** 1104.05 * smiles: ** ccc=ccc=ccc=ccc=c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+322) N Aromatic-Oxoacids (Created page with "Category:metabolite == Metabolite Aromatic-Oxoacids == * common-name: ** an aromatic 2-oxo-acid == Reaction(s) known to consume the compound == * 2.6.1.57-RXN == React...") (current)
- 10:28, 15 June 2021 (diff | hist) (+381) N Medium-Chain-234-Saturated-acyl-CoAs (Created page with "Category:metabolite == Metabolite Medium-Chain-234-Saturated-acyl-CoAs == * common-name: ** a medium-chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to consume t...") (current)
- 10:28, 15 June 2021 (diff | hist) (+568) N CPD-68 (Created page with "Category:metabolite == Metabolite CPD-68 == * common-name: ** 1-aminocyclopropane-1-carboxylate * molecular-weight: ** 101.105 * smiles: ** c([o-])(=o)c1(cc1)[n+] * inchi-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+263) N CPD-10198 (Created page with "Category:metabolite == Metabolite CPD-10198 == * common-name: ** furaneol == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+699) N CPD-17387 (Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * molecular-weight: ** 1118.034 * smiles: ** c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+471) N 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- (Created page with "Category:metabolite == Metabolite 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- == * common-name: ** a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongatio...") (current)
- 10:28, 15 June 2021 (diff | hist) (+338) N CPD-160 (Created page with "Category:metabolite == Metabolite CPD-160 == * common-name: ** a phosphatidyl-n-dimethylethanolamine == Reaction(s) known to consume the compound == * RXN4FS-2 == Reac...") (current)
- 10:28, 15 June 2021 (diff | hist) (+299) N Guanosine-34-tRNAs (Created page with "Category:metabolite == Metabolite guanosine-34-tRNAs == * common-name: ** a guanosine34 in trna == Reaction(s) known to consume the compound == * RXN-11868 == Reaction...") (current)
- 10:28, 15 June 2021 (diff | hist) (+587) N CPD-535 (Created page with "Category:metabolite == Metabolite CPD-535 == * common-name: ** β-d-fructose 2,6-bisphosphate * molecular-weight: ** 336.085 * smiles: ** c(c1(oc(c(c1o)o)(co)op([o-])(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+338) N Long-Chain-oxoacyl-CoAs (Created page with "Category:metabolite == Metabolite Long-Chain-oxoacyl-CoAs == * common-name: ** a long-chain 3-oxoacyl-coa == Reaction(s) known to consume the compound == * 1.1.1.211-RXN...") (current)
- 10:28, 15 June 2021 (diff | hist) (+381) N Secondary-Alcohols (Created page with "Category:metabolite == Metabolite Secondary-Alcohols == * common-name: ** a secondary alcohol == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+1,458) N PAPS (Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * molecular-weight: ** 503.23 * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+711) N CPD-11528 (Created page with "Category:metabolite == Metabolite CPD-11528 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa * molecular-weight: ** 997.797 * smiles: ** c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+325) N Sugar-alcohols (Created page with "Category:metabolite == Metabolite Sugar-alcohols == * common-name: ** a sugar alcohol == Reaction(s) known to consume the compound == * ALDEHYDE-REDUCTASE-RXN == React...") (current)
- 10:28, 15 June 2021 (diff | hist) (+576) N CPD-15834 (Created page with "Category:metabolite == Metabolite CPD-15834 == * common-name: ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol * molecular-weight: ** 410.639 * smiles: ** cc(=cccc(c)=cccc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+479) N CPD-7418 (Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * molecular-weight: ** 163.152 * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * inchi-key: ** pmow...") (current)
- 10:28, 15 June 2021 (diff | hist) (+554) N CPD-20693 (Created page with "Category:metabolite == Metabolite CPD-20693 == * common-name: ** diatoxanthin * molecular-weight: ** 566.865 * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+527) N CPD-309 (Created page with "Category:metabolite == Metabolite CPD-309 == * common-name: ** d-octopine * molecular-weight: ** 246.266 * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] * inchi-ke...") (current)
- 10:28, 15 June 2021 (diff | hist) (+539) N PALMITALDEHYDE (Created page with "Category:metabolite == Metabolite PALMITALDEHYDE == * common-name: ** palmitaldehyde * molecular-weight: ** 240.428 * smiles: ** ccccccccccccccc[ch]=o * inchi-key: ** nioy...") (current)
- 10:28, 15 June 2021 (diff | hist) (+543) N CPD-12935 (Created page with "Category:metabolite == Metabolite CPD-12935 == * common-name: ** 4'-apo-β-carotenal * molecular-weight: ** 482.748 * smiles: ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+611) N Cytochromes-C-Oxidized (Created page with "Category:metabolite == Metabolite Cytochromes-C-Oxidized == * common-name: ** an oxidized c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RX...") (current)
- 10:28, 15 June 2021 (diff | hist) (+759) N CPD-13758 (Created page with "Category:metabolite == Metabolite CPD-13758 == * common-name: ** 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa * molecular-weigh...") (current)
- 10:28, 15 June 2021 (diff | hist) (+266) N Wound-RNA (Created page with "Category:metabolite == Metabolite Wound-RNA == * common-name: ** wound rna == Reaction(s) known to consume the compound == * RXN-11109 == Reaction(s) known to produce...") (current)
- 10:28, 15 June 2021 (diff | hist) (+329) N Type-2-H-Antigen (Created page with "Category:metabolite == Metabolite Type-2-H-Antigen == * common-name: ** an h type 2 histo-blood group antigen == Reaction(s) known to consume the compound == * RXN-18249...") (current)
- 10:28, 15 June 2021 (diff | hist) (+340) N Non-Glycosylated-sugar-Acceptors (Created page with "Category:metabolite == Metabolite Non-Glycosylated-sugar-Acceptors == * common-name: ** a non glycosylated sugar acceptor == Reaction(s) known to consume the compound == =...") (current)
- 10:28, 15 June 2021 (diff | hist) (+672) N BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE (Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * molecular-weight: **...") (current)
- 10:28, 15 June 2021 (diff | hist) (+639) N CPD-10600 (Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * molecular-weight: ** 925.647 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+542) N CPD1F-134 (Created page with "Category:metabolite == Metabolite CPD1F-134 == * common-name: ** gibberellin a9 * molecular-weight: ** 315.388 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc2)([ch](c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+587) N CPD0-1028 (Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * molecular-weight: ** 447.424 * smiles: ** cc(=cccc(c)=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+448) N Alkyl-acetyl-glycero-phosphocholines (Created page with "Category:metabolite == Metabolite Alkyl-acetyl-glycero-phosphocholines == * common-name: ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume...") (current)
- 10:28, 15 June 2021 (diff | hist) (+685) N CPD-18346 (Created page with "Category:metabolite == Metabolite CPD-18346 == * common-name: ** cis-vaccenoyl-coa * molecular-weight: ** 1027.953 * smiles: ** ccccccc=ccccccccccc(=o)sccnc(=o)ccnc(c(o)c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+542) N BENZALDEHYDE (Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * molecular-weight: ** 106.124 * smiles: ** c(=o)c1(=cc=cc=c1) * inchi-key: ** humnylrzrpp...") (current)
- 10:28, 15 June 2021 (diff | hist) (+10,094) N ATP (Created page with "Category:metabolite == Metabolite ATP == * common-name: ** atp * molecular-weight: ** 503.152 * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])op(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+732) N TRP (Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * molecular-weight: ** 204.228 * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+290) N Beta-Lactams (Created page with "Category:metabolite == Metabolite Beta-Lactams == * common-name: ** a β-lactam == Reaction(s) known to consume the compound == * BETA-LACTAMASE-RXN == Reaction(s)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+526) N CPD-14123 (Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * molecular-weight: ** 162.165 * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+587) N CPD-18666 (Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * molecular-weight: ** 606.677 * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+660) N CPD-13004 (Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * molecular-weight: ** 1296.491 * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+287) N PHE-tRNAs (Created page with "Category:metabolite == Metabolite PHE-tRNAs == * common-name: ** a trnaphe == Reaction(s) known to consume the compound == * PHENYLALANINE--TRNA-LIGASE-RXN == Reaction...") (current)
- 10:28, 15 June 2021 (diff | hist) (+358) N L-arginyl-L-Glutamyl-Peptides (Created page with "Category:metabolite == Metabolite L-arginyl-L-Glutamyl-Peptides == * common-name: ** an n-terminal l-arginiyl-l-glutamyl-[protein] == Reaction(s) known to consume the comp...") (current)
- 10:28, 15 June 2021 (diff | hist) (+676) N CPD0-2123 (Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * molecular-weight: ** 931.738 * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+43,945) N PROTON (Created page with "Category:metabolite == Metabolite PROTON == * common-name: ** h+ * molecular-weight: ** 1.008 * smiles: ** [h+] * inchi-key: ** gprlsgonyqirfk-uhfffaoysa-n == Reaction(s)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+612) N CPD-9090 (Created page with "Category:metabolite == Metabolite CPD-9090 == * common-name: ** phyta-2,14-dienyl bacteriochlorophyllide a * molecular-weight: ** 908.494 * smiles: ** ccc5(c(c)c9(n6([mg]2...") (current)
- 10:28, 15 June 2021 (diff | hist) (+328) N Charged-TRP-tRNAs (Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...") (current)
- 10:28, 15 June 2021 (diff | hist) (+536) N ENT-KAUR-16-EN-19-OL (Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-OL == * common-name: ** ent-kaurenol * molecular-weight: ** 288.472 * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(co)cccc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+518) N CPD-257 (Created page with "Category:metabolite == Metabolite CPD-257 == * common-name: ** 4-sulfobenzoate * molecular-weight: ** 200.166 * smiles: ** c([o-])(=o)c1(c=cc(=cc=1)s([o-])(=o)=o) * inchi-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+621) N CPD-8089 (Created page with "Category:metabolite == Metabolite CPD-8089 == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * molecular-weight: ** 782.092 * smiles: ** ccc=ccc=ccc=c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+332) N CPD-17404 (Created page with "Category:metabolite == Metabolite CPD-17404 == * common-name: ** a [glycerolipid]-(11z)-eicosenoate == Reaction(s) known to consume the compound == * RXN-16158 == Reac...") (current)
- 10:28, 15 June 2021 (diff | hist) (+511) N CPD-8120 (Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * molecular-weight: ** 305.479 * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * in...") (current)
- 10:28, 15 June 2021 (diff | hist) (+505) N CPD-471 (Created page with "Category:metabolite == Metabolite CPD-471 == * common-name: ** (r)-3-amino-2-methylpropanoate * molecular-weight: ** 103.121 * smiles: ** cc(c[n+])c([o-])=o * inchi-key: *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+522) N CPD-591 (Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * molecular-weight: ** 285.232 * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+599) N NITRIC-OXIDE (Created page with "Category:metabolite == Metabolite NITRIC-OXIDE == * common-name: ** nitric oxide * molecular-weight: ** 30.006 * smiles: ** n=o * inchi-key: ** mwuxshhqayifbg-uhfffaoysa-n...") (current)
- 10:28, 15 June 2021 (diff | hist) (+298) N CYS-tRNAs (Created page with "Category:metabolite == Metabolite CYS-tRNAs == * common-name: ** a trnacys == Reaction(s) known to consume the compound == * CYSTEINE--TRNA-LIGASE-RXN == Reaction(s) k...") (current)
- 10:28, 15 June 2021 (diff | hist) (+605) N CPD-8163 (Created page with "Category:metabolite == Metabolite CPD-8163 == * common-name: ** 1-16:0-2-18:2-digalactosyldiacylglycerol * molecular-weight: ** 917.225 * smiles: ** cccccc=ccc=ccccccccc(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+634) N CPD-10809 (Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * molecular-weight: ** 353.228 * smiles: ** c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+514) N SN-GLYCEROL-1-PHOSPHATE (Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * molecular-weight: ** 170.058 * smiles: ** c(op([o-])(=o)[o-])c(o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+339) N R-3-hydroxycerotoyl-ACPs (Created page with "Category:metabolite == Metabolite R-3-hydroxycerotoyl-ACPs == * common-name: ** a (3r)-3-hydroxycerotoyl-[acp] == Reaction(s) known to consume the compound == * RXN-1006...") (current)
- 10:28, 15 June 2021 (diff | hist) (+698) N SIROHYDROCHLORIN (Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * molecular-weight: ** 854.779 * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+341) N MRNA-Containing-N1-Methyladenine (Created page with "Category:metabolite == Metabolite mRNA-Containing-N1-Methyladenine == * common-name: ** an n1-methyladenine in mrna == Reaction(s) known to consume the compound == * RXN...") (current)
- 10:28, 15 June 2021 (diff | hist) (+343) N Saturated-2-Lysophosphatidates (Created page with "Category:metabolite == Metabolite Saturated-2-Lysophosphatidates == * common-name: ** a 2,3,4-saturated 2-lysophosphatidate == Reaction(s) known to consume the compound ==...") (current)
- 10:28, 15 June 2021 (diff | hist) (+419) N 5-Phospho-terminated-DNAs (Created page with "Category:metabolite == Metabolite 5-Phospho-terminated-DNAs == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * [[DNA-LIGASE-ATP-RXN]...") (current)
- 10:28, 15 June 2021 (diff | hist) (+681) N CPD-11517 (Created page with "Category:metabolite == Metabolite CPD-11517 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa * molecular-weight: ** 1039.92 * smiles: ** ccc=ccc1...") (current)
- 10:28, 15 June 2021 (diff | hist) (+606) N CPD-8162 (Created page with "Category:metabolite == Metabolite CPD-8162 == * common-name: ** 1-18:3-2-16:0-digalactosyldiacylglycerol * molecular-weight: ** 915.209 * smiles: ** ccc=ccc=ccc=ccccccccc(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+320) N 2-hydroxyacyl-glutathiones (Created page with "Category:metabolite == Metabolite 2-hydroxyacyl-glutathiones == * common-name: ** s-(2-hydroxyacyl)glutathione == Reaction(s) known to consume the compound == * RXN-7919...") (current)
- 10:28, 15 June 2021 (diff | hist) (+417) N Beta-L-arabinosides (Created page with "Category:metabolite == Metabolite Beta-L-arabinosides == * common-name: ** an oligosaccharide with β-l-arabinopyranose at the non-reducing end == Reaction(s) known to...") (current)
- 10:28, 15 June 2021 (diff | hist) (+580) N BENZOYLCOA (Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * molecular-weight: ** 867.61 * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+567) N CPD-193 (Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * molecular-weight: ** 336.085 * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+655) N CPD0-2117 (Created page with "Category:metabolite == Metabolite CPD0-2117 == * common-name: ** trans-hexadec-2-enoyl-coa * molecular-weight: ** 999.899 * smiles: ** cccccccccccccc=cc(=o)sccnc(=o)ccnc(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+371) N 2-Me-Branched-234-Sat-FA (Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-FA == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound...") (current)
- 10:28, 15 June 2021 (diff | hist) (+265) N RX (Created page with "Category:metabolite == Metabolite RX == * common-name: ** rx * smiles: ** [r]x == Reaction(s) known to consume the compound == * GSHTRAN-RXN == Reaction(s) known to pr...") (current)
- 10:28, 15 June 2021 (diff | hist) (+273) N D-Hexoses (Created page with "Category:metabolite == Metabolite D-Hexoses == * common-name: ** a d-hexose == Reaction(s) known to consume the compound == * HEXOKINASE-RXN == Reaction(s) known to pr...") (current)
- 10:28, 15 June 2021 (diff | hist) (+722) N Ox-Thioredoxin (Created page with "Category:metabolite == Metabolite Ox-Thioredoxin == * common-name: ** an oxidized thioredoxin == Reaction(s) known to consume the compound == * 1.8.4.12-RXN * 1.8.4....") (current)
- 10:28, 15 June 2021 (diff | hist) (+316) N N-Acetyl-Peptides (Created page with "Category:metabolite == Metabolite N-Acetyl-Peptides == * common-name: ** an n-acylated peptide == Reaction(s) known to consume the compound == * ACYLAMINOACYL-PEPTIDASE-...") (current)
- 10:27, 15 June 2021 (diff | hist) (+583) N CPD-11412 (Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * molecular-weight: ** 797.054 * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o...") (current)
- 10:27, 15 June 2021 (diff | hist) (+279) N ALLO-THR (Created page with "Category:metabolite == Metabolite ALLO-THR == * common-name: ** dl-allothreonine == Reaction(s) known to consume the compound == * RXN0-5234 == Reaction(s) known to pr...") (current)
- 10:27, 15 June 2021 (diff | hist) (+280) N Drugs (Created page with "Category:metabolite == Metabolite Drugs == * common-name: ** a drug == Reaction(s) known to consume the compound == * TRANS-RXN-311 == Reaction(s) known to produce the...") (current)
- 10:27, 15 June 2021 (diff | hist) (+641) N THIAMINE (Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * molecular-weight: ** 265.352 * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key...") (current)
- 10:27, 15 June 2021 (diff | hist) (+535) N CPD-9955 (Created page with "Category:metabolite == Metabolite CPD-9955 == * common-name: ** ubiquinol-7 * molecular-weight: ** 661.019 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") (current)
- 10:27, 15 June 2021 (diff | hist) (+350) N 2-Acyl-sn-glycerol-3-phosphates (Created page with "Category:metabolite == Metabolite 2-Acyl-sn-glycerol-3-phosphates == * common-name: ** a 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * [...") (current)
(newest | oldest) View (newer 500 | older 500) (20 | 50 | 100 | 250 | 500)