Difference between revisions of "SJ11289"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == * common-name: ** phytate * smiles: ** c1(op([o-])(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] ==
 
* common-name:
 
* common-name:
** phytate
+
** udp-α-d-galactose
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
* inchi-key:
 
* inchi-key:
** imqlkjbteoyosi-gpivlxjgsa-b
+
** hscjrczfdfqwrp-abvwguqpsa-l
 
* molecular-weight:
 
* molecular-weight:
** 647.942
+
** 564.289
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.152-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[RXN-10971]]
+
* [[2.4.1.122-RXN]]
* [[RXN-10972]]
+
* [[2.4.1.123-RXN]]
* [[RXN-10977]]
+
* [[2.4.1.134-RXN]]
* [[RXN-10978]]
+
* [[2.4.1.151-RXN]]
* [[RXN-7186]]
+
* [[2.4.1.38-RXN]]
* [[RXN-7241]]
+
* [[2.4.1.46-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[LACTOSE-SYNTHASE-RXN]]
 +
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 +
* [[RXN-1225]]
 +
* [[RXN-14561]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-18266]]
 +
* [[RXN-18302]]
 +
* [[UDPGALtg]]
 +
* [[UDPGALth]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UG4E]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10964]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
* [[RXN-10977]]
+
* [[RXN-16027]]
* [[RXN-10978]]
+
* [[UDPGALtg]]
* [[RXN-7163]]
+
* [[UDPGALth]]
* [[RXN-7186]]
+
* [[UDPGLUCEPIM-RXN]]
 +
* [[UG4E]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytate}}
+
{{#set: common-name=udp-&alpha;-d-galactose}}
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
+
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
{{#set: molecular-weight=647.942}}
+
{{#set: molecular-weight=564.289}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-14553

  • common-name:
    • udp-α-d-galactose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • inchi-key:
    • hscjrczfdfqwrp-abvwguqpsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality