Difference between revisions of "LEUSYN-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
+== Pathway LEUSYN-PWY ==
+* taxonomic-range:
+** tax-2157
+** tax-2
+** tax-4751
+** tax-33090
 * common-name:
-** cellotetraose
+** l-leucine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
+* [[2-ISOPROPYLMALATESYN-RXN]]
-* inchi-key:
+* [[3-ISOPROPYLMALDEHYDROG-RXN]]
-** uyqjcpnsavwafu-zeuiethysa-n
+* [[3-ISOPROPYLMALISOM-RXN]]
-* molecular-weight:
+* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
-** 666.583
+* [[RXN-8991]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-* [[RXN-12305]]
+* [NoneRXN-7800 RXN-7800]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-4751|tax-2|tax-2157|tax-33090}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=l-leucine biosynthesis}}
-{{#set: common-name=cellotetraose}}
+{{#set: nb reaction found=5}}
-{{#set: inchi-key=inchikey=uyqjcpnsavwafu-zeuiethysa-n}}
+{{#set: completion rate=0.83}}
-{{#set: molecular-weight=666.583}}
+{{#set: nb total reaction=6}}