Difference between revisions of "PWY3O-246"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] == * common-name: ** 3-chlorobenzaldehyde * smiles: ** c(=o)c1(c=cc=c(cl)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * common-name: ** udp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] ==
 
* common-name:
 
* common-name:
** 3-chlorobenzaldehyde
+
** udp
 
* smiles:
 
* smiles:
** c(=o)c1(c=cc=c(cl)c=1)
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
* inchi-key:
** srwilaksarhzpr-uhfffaoysa-n
+
** xcctyiawtasojw-xvfcmesisa-k
 
* molecular-weight:
 
* molecular-weight:
** 140.569
+
** 401.14
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9910]]
+
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[ATUD]]
 +
* [[ATUDm]]
 +
* [[DUDT]]
 +
* [[R00157]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-12197]]
 +
* [[RXN-14841]]
 +
* [[RXN-16027]]
 +
* [[RXN-7873]]
 +
* [[RXN0-722]]
 +
* [[UDPGth]]
 +
* [[UDPKIN-RXN]]
 +
* [[UDPREDUCT-RXN]]
 +
* [[UMPU]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[2.4.1.101-RXN]]
 +
* [[2.4.1.117-RXN]]
 +
* [[2.4.1.122-RXN]]
 +
* [[2.4.1.123-RXN]]
 +
* [[2.4.1.134-RXN]]
 +
* [[2.4.1.141-RXN]]
 +
* [[2.4.1.145-RXN]]
 +
* [[2.4.1.151-RXN]]
 +
* [[2.4.1.155-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.212-RXN]]
 +
* [[2.4.1.223-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.225-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.38-RXN]]
 +
* [[2.4.1.46-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.4.2.26-RXN]]
 +
* [[2.4.2.38-RXN]]
 +
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 +
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[LACTOSE-SYNTHASE-RXN]]
 +
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[R00157]]
 +
* [[RXN-10606]]
 +
* [[RXN-10607]]
 +
* [[RXN-10608]]
 +
* [[RXN-10609]]
 +
* [[RXN-10616]]
 +
* [[RXN-10617]]
 +
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-12002]]
 +
* [[RXN-12123]]
 +
* [[RXN-12125]]
 +
* [[RXN-12126]]
 +
* [[RXN-12127]]
 +
* [[RXN-12128]]
 +
* [[RXN-12196]]
 +
* [[RXN-1225]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-14561]]
 +
* [[RXN-14841]]
 +
* [[RXN-15117]]
 +
* [[RXN-15205]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-16975]]
 +
* [[RXN-18266]]
 +
* [[RXN-18302]]
 +
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-6501]]
 +
* [[RXN-7667]]
 +
* [[RXN-7828]]
 +
* [[RXN-7873]]
 +
* [[RXN-8228]]
 +
* [[RXN-9000]]
 +
* [[RXN-9104]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
* [[UDPGth]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UTCY]]
 +
* [[UTUP]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-chlorobenzaldehyde}}
+
{{#set: common-name=udp}}
{{#set: inchi-key=inchikey=srwilaksarhzpr-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
{{#set: molecular-weight=140.569}}
+
{{#set: molecular-weight=401.14}}

Revision as of 09:22, 27 August 2019

Metabolite UDP

  • common-name:
    • udp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • xcctyiawtasojw-xvfcmesisa-k
  • molecular-weight:
    • 401.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality