Difference between revisions of "2-KETOGLUTARATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14214 RXN-14214] == * direction: ** left-to-right == Reaction formula == * 1 DATP[c] '''+''...") |
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-465 == |
| − | * | + | * common-name: |
| − | ** | + | ** presqualene diphosphate |
| − | == | + | * smiles: |
| − | + | ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c | |
| − | = | + | * inchi-key: |
| − | * | + | ** atzkauggnmsccy-qlydttawsa-k |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 583.66 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-13724]] | |
| − | * | + | * [[RXN66-281]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-12263]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=presqualene diphosphate}} | |
| − | + | {{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}} | |
| − | {{#set: | + | {{#set: molecular-weight=583.66}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-465
- common-name:
- presqualene diphosphate
- smiles:
- cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
- inchi-key:
- atzkauggnmsccy-qlydttawsa-k
- molecular-weight:
- 583.66
