Difference between revisions of "3-CARBOXY-3-HYDROXY-ISOCAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Fe3-siderophores == * common-name: ** an fe(iii)-siderophore == Reaction(s) known to consume the compound == * FERRIC-CHELATE-REDUCTASE...")
(Created page with "Category:metabolite == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == * common-name: ** (2s)-2-isopropylmalate * smiles: ** cc(c)c(o)(cc(=o)[o-])c([o-])=o * inchi-key: ** b...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Fe3-siderophores ==
+
== Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE ==
 
* common-name:
 
* common-name:
** an fe(iii)-siderophore
+
** (2s)-2-isopropylmalate
 +
* smiles:
 +
** cc(c)c(o)(cc(=o)[o-])c([o-])=o
 +
* inchi-key:
 +
** bityxlxucsktjs-zetcqymhsa-l
 +
* molecular-weight:
 +
** 174.153
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
+
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[RXN-13163]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2-ISOPROPYLMALATESYN-RXN]]
 +
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[IPMS]]
 +
* [[RXN-13163]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an fe(iii)-siderophore}}
+
{{#set: common-name=(2s)-2-isopropylmalate}}
 +
{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
 +
{{#set: molecular-weight=174.153}}

Latest revision as of 11:12, 18 March 2021

Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE

  • common-name:
    • (2s)-2-isopropylmalate
  • smiles:
    • cc(c)c(o)(cc(=o)[o-])c([o-])=o
  • inchi-key:
    • bityxlxucsktjs-zetcqymhsa-l
  • molecular-weight:
    • 174.153

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality