Difference between revisions of "PWY-6692"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] == * common-name: ** isopentenyl phosphate * smiles: ** c=c(ccop(=o)([o-])...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == |
* common-name: | * common-name: | ||
− | ** | + | ** presqualene diphosphate |
* smiles: | * smiles: | ||
− | ** c=c( | + | ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** atzkauggnmsccy-qlydttawsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 583.66 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13724]] |
+ | * [[RXN66-281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12263]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=presqualene diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=583.66}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-465
- common-name:
- presqualene diphosphate
- smiles:
- cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
- inchi-key:
- atzkauggnmsccy-qlydttawsa-k
- molecular-weight:
- 583.66