Difference between revisions of "PWY-6906"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12677 CPD-12677] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] ==
 * common-name:
-** 5-chloro-5-deoxyribose 1-phosphate
+** (2e,6e)-farnesyl diphosphate
 * smiles:
-** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
+** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
 * inchi-key:
-** dgviesznpvjdpq-soofdhnksa-l
+** vwfjdquyciwhtn-yfvjmotdsa-k
 * molecular-weight:
-** 246.541
+** 379.306
 == Reaction(s) known to consume the compound ==
+* [[2.5.1.58-RXN]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[GGPS]]
+* [[HEMEOSYN-RXN]]
+* [[RXN-11963]]
+* [[RXN-12263]]
+* [[RXN-13162]]
+* [[RXN-17573]]
+* [[RXN-8999]]
+* [[RXN-9969]]
+* [[RXN0-5180]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11715]]
+* [[2.5.1.58-RXN]]
+* [[FPPS]]
+* [[FPPSYN-RXN]]
+* [[RXN-11963]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
+{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
-{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
+{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
-{{#set: molecular-weight=246.541}}
+{{#set: molecular-weight=379.306}}