Difference between revisions of "SJ15200"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * common-name: ** 5-cis, 7-trans-tetradecadienoyl-coa * smiles: ** cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * common-name: ** 2-isopropylmaleate * smiles: ** cc(c(c(=o)[o-])=cc(=o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] ==
 
* common-name:
 
* common-name:
** 5-cis, 7-trans-tetradecadienoyl-coa
+
** 2-isopropylmaleate
 
* smiles:
 
* smiles:
** ccccccc=cc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c(c(=o)[o-])=cc(=o)[o-])c
 
* inchi-key:
 
* inchi-key:
** amanzgdvbadzlh-qtjplklfsa-j
+
** njmgrjlqrlfqqx-hyxafxhysa-l
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 156.138
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14796]]
+
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 +
* [[RXN-8991]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
 +
* [[RXN-8991]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-cis, 7-trans-tetradecadienoyl-coa}}
+
{{#set: common-name=2-isopropylmaleate}}
{{#set: inchi-key=inchikey=amanzgdvbadzlh-qtjplklfsa-j}}
+
{{#set: inchi-key=inchikey=njmgrjlqrlfqqx-hyxafxhysa-l}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=156.138}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-9451

  • common-name:
    • 2-isopropylmaleate
  • smiles:
    • cc(c(c(=o)[o-])=cc(=o)[o-])c
  • inchi-key:
    • njmgrjlqrlfqqx-hyxafxhysa-l
  • molecular-weight:
    • 156.138

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality