Difference between revisions of "CPD-13852"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...")
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TRP ==
+
== Metabolite CPD-465 ==
 
* common-name:
 
* common-name:
** l-tryptophan
+
** presqualene diphosphate
 
* smiles:
 
* smiles:
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
+
** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
 
* inchi-key:
 
* inchi-key:
** qivbcdijiajpqs-vifpvbqesa-n
+
** atzkauggnmsccy-qlydttawsa-k
 
* molecular-weight:
 
* molecular-weight:
** 204.228
+
** 583.66
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
+
* [[RXN-13724]]
* [[RXN-8665]]
+
* [[RXN66-281]]
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
 
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2382]]
+
* [[RXN-12263]]
* [[TRYPSYN-RXN]]
 
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-tryptophan}}
+
{{#set: common-name=presqualene diphosphate}}
{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
+
{{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}}
{{#set: molecular-weight=204.228}}
+
{{#set: molecular-weight=583.66}}

Revision as of 15:00, 5 January 2021

Metabolite CPD-465

  • common-name:
    • presqualene diphosphate
  • smiles:
    • cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
  • inchi-key:
    • atzkauggnmsccy-qlydttawsa-k
  • molecular-weight:
    • 583.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality