Difference between revisions of "1CMET2-PWY"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-ATP PHOSPHORIBOSYL-ATP] ==
+== Pathway 1CMET2-PWY ==
+* taxonomic-range:
+** tax-4751
+** tax-33208
+** tax-2
 * common-name:
-** 1-(5-phospho-&beta;-d-ribosyl)-atp
+** n10-formyl-tetrahydrofolate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
+* [[1.5.1.20-RXN]]
-* inchi-key:
+* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
-** rknhjbvbfhdxgr-keohhstqsa-i
+* [[DIHYDROFOLATEREDUCT-RXN]]
-* molecular-weight:
+* [[GLYOHMETRANS-RXN]]
-** 714.24
+* [[HOMOCYSMETB12-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[METHENYLTHFCYCLOHYDRO-RXN]]
-* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+* [[METHYLENETHFDEHYDROG-NADP-RXN]]
-* [[HISTPRATPHYD-RXN]]
+* [[THYMIDYLATESYN-RXN]]
-== Reaction(s) known to produce the compound ==
+== Reaction(s) not found ==
-* [[ADPART]]
+* [NoneGCVMULTI-RXN GCVMULTI-RXN]
-* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+{{#set: taxonomic-range=tax-4751|tax-33208|tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=n10-formyl-tetrahydrofolate biosynthesis}}
-{{#set: common-name=1-(5-phospho-&beta;-d-ribosyl)-atp}}
+{{#set: nb reaction found=8}}
-{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
+{{#set: completion rate=0.89}}
-{{#set: molecular-weight=714.24}}
+{{#set: nb total reaction=9}}