Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...")
(Created page with "Category:metabolite == Metabolite BETA-ACETYLGLUCOSAMINIDE == * common-name: ** an n-acetyl-β-d-glucosaminyl-r == Reaction(s) known to consume the compound == * 2.4...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23-DIPHOSPHOGLYCERATE ==
+
== Metabolite BETA-ACETYLGLUCOSAMINIDE ==
 
* common-name:
 
* common-name:
** 2,3-diphospho-d-glycerate
+
** an n-acetyl-β-d-glucosaminyl-r
* smiles:
 
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
 
* inchi-key:
 
** xohueycvluuejj-uwtatzphsa-i
 
* molecular-weight:
 
** 260.998
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15509]]
+
* [[2.4.1.38-RXN]]
* [[RXN-15510]]
 
* [[RXN-15511]]
 
* [[RXN-15512]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
 
* [[RXN-15509]]
 
* [[RXN-15510]]
 
* [[RXN-15511]]
 
* [[RXN-15512]]
 
* [[RXN-17276]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-diphospho-d-glycerate}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-r}}
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
 
{{#set: molecular-weight=260.998}}
 

Revision as of 15:25, 5 January 2021

Metabolite BETA-ACETYLGLUCOSAMINIDE

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality