Difference between revisions of "23S-rRNA-pseudouridine2605"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.3.37-RXN 1.1.3.37-RXN] == * direction: ** left-to-right * common-name: ** d-arabinono-1,4-lacto...")
(Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** xcctyiawtas...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.3.37-RXN 1.1.3.37-RXN] ==
+
== Metabolite UDP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** d-arabinono-1,4-lactone oxidase
+
** udp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.3.37 ec-1.1.3.37]
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-356]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-1789]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
** xcctyiawtasojw-xvfcmesisa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ14473]]
+
** 401.14
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.4.1.198-RXN]]
−
* Gene: [[SJ03315]]
+
* [[2.4.1.229-RXN]]
−
** Category: [[annotation]]
+
* [[2.4.1.94-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ATUD]]
−
* Gene: [[SJ03311]]
+
* [[ATUDm]]
−
** Category: [[annotation]]
+
* [[DUDT]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[R00157]]
−
* Gene: [[SJ14480]]
+
* [[RXN-11627]]
−
** Category: [[annotation]]
+
* [[RXN-11889]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-11890]]
−
* Gene: [[SJ14476]]
+
* [[RXN-12197]]
−
** Category: [[annotation]]
+
* [[RXN-14841]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-16027]]
−
== Pathway(s)  ==
+
* [[RXN-7873]]
−
* [[PWY3O-6]], dehydro-D-arabinono-1,4-lactone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-6 PWY3O-6]
+
* [[RXN0-722]]
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[UDPGth]]
−
== Reconstruction information  ==
+
* [[UDPKIN-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[UDPREDUCT-RXN]]
−
== External links  ==
+
* [[UMPU]]
−
* RHEA:
+
== Reaction(s) known to produce the compound ==
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23756 23756]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* LIGAND-RXN:
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R02715 R02715]
+
* [[2.4.1.101-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[2.4.1.117-RXN]]
−
{{#set: common-name=d-arabinono-1,4-lactone oxidase}}
+
* [[2.4.1.122-RXN]]
−
{{#set: ec-number=ec-1.1.3.37}}
+
* [[2.4.1.123-RXN]]
−
{{#set: nb gene associated=5}}
+
* [[2.4.1.134-RXN]]
−
{{#set: nb pathway associated=1}}
+
* [[2.4.1.141-RXN]]
−
{{#set: reconstruction category=annotation}}
+
* [[2.4.1.145-RXN]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[2.4.1.151-RXN]]
−
{{#set: reconstruction comment=n.a}}
+
* [[2.4.1.155-RXN]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.212-RXN]]
 +
* [[2.4.1.223-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.225-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.38-RXN]]
 +
* [[2.4.1.46-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.4.2.26-RXN]]
 +
* [[2.4.2.38-RXN]]
 +
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 +
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[LACTOSE-SYNTHASE-RXN]]
 +
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[R00157]]
 +
* [[RXN-10606]]
 +
* [[RXN-10607]]
 +
* [[RXN-10608]]
 +
* [[RXN-10609]]
 +
* [[RXN-10616]]
 +
* [[RXN-10617]]
 +
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-12002]]
 +
* [[RXN-12123]]
 +
* [[RXN-12125]]
 +
* [[RXN-12126]]
 +
* [[RXN-12127]]
 +
* [[RXN-12128]]
 +
* [[RXN-12196]]
 +
* [[RXN-1225]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-14561]]
 +
* [[RXN-14841]]
 +
* [[RXN-15117]]
 +
* [[RXN-15205]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-16975]]
 +
* [[RXN-18266]]
 +
* [[RXN-18302]]
 +
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-6501]]
 +
* [[RXN-7667]]
 +
* [[RXN-7828]]
 +
* [[RXN-7873]]
 +
* [[RXN-8228]]
 +
* [[RXN-9000]]
 +
* [[RXN-9104]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
* [[UDPGth]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UTCY]]
 +
* [[UTUP]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp}}
 +
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
 +
{{#set: molecular-weight=401.14}}

Revision as of 20:34, 18 December 2020

Metabolite UDP

  • common-name:
    • udp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • xcctyiawtasojw-xvfcmesisa-k
  • molecular-weight:
    • 401.14

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=23S-rRNA-pseudouridine2605&oldid=47139"