Difference between revisions of "BETA-ACETYLGLUCOSAMINIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-key: ** dtosiqbpprvqhs-pdbxooch...") |
(Created page with "Category:metabolite == Metabolite BETA-ACETYLGLUCOSAMINIDE == * common-name: ** an n-acetyl-β-d-glucosaminyl-r == Reaction(s) known to consume the compound == * 2.4...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BETA-ACETYLGLUCOSAMINIDE == |
* common-name: | * common-name: | ||
| − | ** & | + | ** an n-acetyl-β-d-glucosaminyl-r |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.4.1.38-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=an n-acetyl-β-d-glucosaminyl-r}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite BETA-ACETYLGLUCOSAMINIDE
- common-name:
- an n-acetyl-β-d-glucosaminyl-r
