Difference between revisions of "BETA-ACETYLGLUCOSAMINIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7280 == * common-name: ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(c=cc=c(c)c=cc12(oc...")
(Created page with "Category:metabolite == Metabolite BETA-ACETYLGLUCOSAMINIDE == * common-name: ** an n-acetyl-β-d-glucosaminyl-r == Reaction(s) known to consume the compound == * 2.4...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7280 ==
+
== Metabolite BETA-ACETYLGLUCOSAMINIDE ==
 
* common-name:
 
* common-name:
** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** an n-acetyl-β-d-glucosaminyl-r
* smiles:
 
** cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
 
* inchi-key:
 
** fyydcjdefsyvoy-wenurhbksa-n
 
* molecular-weight:
 
** 382.542
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.38-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
{{#set: common-name=an n-acetyl-β-d-glucosaminyl-r}}
{{#set: inchi-key=inchikey=fyydcjdefsyvoy-wenurhbksa-n}}
 
{{#set: molecular-weight=382.542}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite BETA-ACETYLGLUCOSAMINIDE

  • common-name:
    • an n-acetyl-β-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality