Difference between revisions of "CPD-14553"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15492 == * transcription-direction: ** negative * right-end-position: ** 153387 * left-end-position: ** 148628 * centisome-position: ** 50.38613...")
(Created page with "Category:metabolite == Metabolite CPD-14553 == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)n...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15492 ==
+
== Metabolite CPD-14553 ==
* transcription-direction:
+
* common-name:
** negative
+
** udp-α-d-galactose
* right-end-position:
+
* smiles:
** 153387
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
* left-end-position:
+
* inchi-key:
** 148628
+
** hscjrczfdfqwrp-abvwguqpsa-l
* centisome-position:
+
* molecular-weight:
** 50.38613   
+
** 564.289
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[2.4.1.122-RXN]]
* [[2.1.1.34-RXN]]
+
* [[2.4.1.123-RXN]]
** Category: [[annotation]]
+
* [[2.4.1.134-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.4.1.151-RXN]]
{{#set: transcription-direction=negative}}
+
* [[2.4.1.38-RXN]]
{{#set: right-end-position=153387}}
+
* [[2.4.1.46-RXN]]
{{#set: left-end-position=148628}}
+
* [[GALACTURIDYLYLTRANS-RXN]]
{{#set: centisome-position=50.38613    }}
+
* [[LACTOSE-SYNTHASE-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
{{#set: nb reaction associated=1}}
+
* [[RXN-1225]]
 +
* [[RXN-14561]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-18266]]
 +
* [[RXN-18302]]
 +
* [[UDPGALtg]]
 +
* [[UDPGALth]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UG4E]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[RXN-16027]]
 +
* [[UDPGALtg]]
 +
* [[UDPGALth]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UG4E]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-&alpha;-d-galactose}}
 +
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
 +
{{#set: molecular-weight=564.289}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14553

  • common-name:
    • udp-α-d-galactose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • inchi-key:
    • hscjrczfdfqwrp-abvwguqpsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality