Difference between revisions of "CPD-14553"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14300 == * common-name: ** 3-oxo-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
(Created page with "Category:metabolite == Metabolite CPD-14553 == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)n...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14300 ==
+
== Metabolite CPD-14553 ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z)-eicos-11-enoyl-coa
+
** udp-α-d-galactose
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
* inchi-key:
 
* inchi-key:
** askkpqkscfyppp-fvldfciysa-j
+
** hscjrczfdfqwrp-abvwguqpsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1069.99
+
** 564.289
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14484]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.4.1.122-RXN]]
 +
* [[2.4.1.123-RXN]]
 +
* [[2.4.1.134-RXN]]
 +
* [[2.4.1.151-RXN]]
 +
* [[2.4.1.38-RXN]]
 +
* [[2.4.1.46-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[LACTOSE-SYNTHASE-RXN]]
 +
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 +
* [[RXN-1225]]
 +
* [[RXN-14561]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-18266]]
 +
* [[RXN-18302]]
 +
* [[UDPGALtg]]
 +
* [[UDPGALth]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UG4E]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13322]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[RXN-16027]]
 +
* [[UDPGALtg]]
 +
* [[UDPGALth]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UG4E]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z)-eicos-11-enoyl-coa}}
+
{{#set: common-name=udp-&alpha;-d-galactose}}
{{#set: inchi-key=inchikey=askkpqkscfyppp-fvldfciysa-j}}
+
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
{{#set: molecular-weight=1069.99}}
+
{{#set: molecular-weight=564.289}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14553

  • common-name:
    • udp-α-d-galactose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • inchi-key:
    • hscjrczfdfqwrp-abvwguqpsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality