Difference between revisions of "CPD-14553"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16371 == * transcription-direction: ** negative * right-end-position: ** 192166 * left-end-position: ** 161076 * centisome-position: ** 56.96643...")
(Created page with "Category:metabolite == Metabolite CPD-14553 == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)n...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16371 ==
+
== Metabolite CPD-14553 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** udp-α-d-galactose
−
* right-end-position:
+
* smiles:
−
** 192166
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 161076
+
** hscjrczfdfqwrp-abvwguqpsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 56.96643   
+
** 564.289
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Reaction(s) associated ==
+
* [[2.4.1.122-RXN]]
−
* [[ATPASE-RXN]]
+
* [[2.4.1.123-RXN]]
−
** Category: [[annotation]]
+
* [[2.4.1.134-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.4.1.151-RXN]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[2.4.1.38-RXN]]
−
** Category: [[annotation]]
+
* [[2.4.1.46-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
* [[RXN-12195]]
+
* [[LACTOSE-SYNTHASE-RXN]]
−
** Category: [[annotation]]
+
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-1225]]
−
* [[RXN-12196]]
+
* [[RXN-14561]]
−
** Category: [[annotation]]
+
* [[RXN-15276]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15277]]
−
* [[RXN0-5462]]
+
* [[RXN-15278]]
−
** Category: [[annotation]]
+
* [[RXN-16027]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-18266]]
−
== Pathway(s) associated ==
+
* [[RXN-18302]]
−
* [[PWY-7210]]
+
* [[UDPGALtg]]
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[UDPGALth]]
−
* [[PWY-7198]]
+
* [[UDPGLUCEPIM-RXN]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[UG4E]]
−
* [[PWY-7184]]
+
* [[UTPHEXPURIDYLYLTRANS-RXN]]
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
</div>
−
* [[PWY-6545]]
+
== Reaction(s) known to produce the compound ==
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN-16027]]
−
{{#set: right-end-position=192166}}
+
* [[UDPGALtg]]
−
{{#set: left-end-position=161076}}
+
* [[UDPGALth]]
−
{{#set: centisome-position=56.96643    }}
+
* [[UDPGLUCEPIM-RXN]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[UG4E]]
−
{{#set: nb reaction associated=5}}
+
* [[UTPHEXPURIDYLYLTRANS-RXN]]
−
{{#set: nb pathway associated=4}}
+
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-&alpha;-d-galactose}}
 +
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
 +
{{#set: molecular-weight=564.289}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-14553

  • common-name:
    • udp-α-d-galactose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • inchi-key:
    • hscjrczfdfqwrp-abvwguqpsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-14553&oldid=138185"