Difference between revisions of "CPD-3061"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE-GLU-N == * common-name: ** a 7,8-dihydrofolate == Reaction(s) known to consume the compound == * [[DIHYDROFOLATEREDUCT-RXN]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite T2-DECENOYL-COA ==
+
== Metabolite DIHYDROFOLATE-GLU-N ==
 
* common-name:
 
* common-name:
** (2e)-dec-2-enoyl-coa
+
** a 7,8-dihydrofolate
* smiles:
 
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** mgnbgcrqqfmnbm-yjhhllfwsa-j
 
* molecular-weight:
 
** 915.738
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH4h]]
+
* [[DIHYDROFOLATEREDUCT-RXN]]
* [[RXN-13616]]
 
* [[RXN-14805]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIENOYLCOAREDUCT-RXN]]
+
* [[THYMIDYLATESYN-RXN]]
* [[ECOAH4h]]
 
* [[RXN-13615]]
 
* [[RXN-14805]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
+
{{#set: common-name=a 7,8-dihydrofolate}}
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
 
{{#set: molecular-weight=915.738}}
 

Revision as of 08:29, 15 March 2021

Metabolite DIHYDROFOLATE-GLU-N

  • common-name:
    • a 7,8-dihydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality