Difference between revisions of "CPD-465"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phos-G-protein-coupled-receptors == * common-name: ** a phosphorylated g protein-coupled receptor == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-465 == |
* common-name: | * common-name: | ||
− | ** | + | ** presqualene diphosphate |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c | ||
+ | * inchi-key: | ||
+ | ** atzkauggnmsccy-qlydttawsa-k | ||
+ | * molecular-weight: | ||
+ | ** 583.66 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13724]] |
+ | * [[RXN66-281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12263]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=presqualene diphosphate}} |
+ | {{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}} | ||
+ | {{#set: molecular-weight=583.66}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-465
- common-name:
- presqualene diphosphate
- smiles:
- cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
- inchi-key:
- atzkauggnmsccy-qlydttawsa-k
- molecular-weight:
- 583.66