Difference between revisions of "CPD-465"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15776 RXN-15776] == * direction: ** left-to-right * common-name: ** methylated diphthine methyl...")
 
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15776 RXN-15776] ==
+
== Metabolite CPD-465 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** methylated diphthine methylhydrolase
+
** presqualene diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.1.97 ec-3.1.1.97]
+
** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Diphthine-methyl-ester-EF2]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DIPHTINE]][c] '''+''' 1 [[METOH]][c] '''+''' 1 [[PROTON]][c]
+
** atzkauggnmsccy-qlydttawsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ18450]]
+
** 583.66
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13724]]
−
== Pathway(s) ==
+
* [[RXN66-281]]
−
* [[PWY-7546]], diphthamide biosynthesis II (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7546 PWY-7546]
+
== Reaction(s) known to produce the compound ==
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-12263]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=presqualene diphosphate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}}
−
* RHEA:
+
{{#set: molecular-weight=583.66}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42657 42657]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=methylated diphthine methylhydrolase}}
 
−
{{#set: ec-number=ec-3.1.1.97}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-465

  • common-name:
    • presqualene diphosphate
  • smiles:
    • cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
  • inchi-key:
    • atzkauggnmsccy-qlydttawsa-k
  • molecular-weight:
    • 583.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-465&oldid=139619"