Difference between revisions of "CPD-465"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PADH G6PADH] == * direction: ** left-to-right * common-name: ** glucose-6-phosphate-1-dehydrogena...") |
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-465 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** presqualene diphosphate |
− | == | + | * smiles: |
− | + | ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c | |
− | == | + | * inchi-key: |
− | * | + | ** atzkauggnmsccy-qlydttawsa-k |
− | * | + | * molecular-weight: |
− | + | ** 583.66 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13724]] | |
− | * | + | * [[RXN66-281]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12263]] | |
− | {{#set: common-name= | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=presqualene diphosphate}} |
− | + | {{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}} | |
− | {{#set: | + | {{#set: molecular-weight=583.66}} |
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-465
- common-name:
- presqualene diphosphate
- smiles:
- cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
- inchi-key:
- atzkauggnmsccy-qlydttawsa-k
- molecular-weight:
- 583.66