Difference between revisions of "CPD0-2015"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
(Created page with "Category:metabolite == Metabolite B-Gal-14-NacGlc-R == * common-name: ** a type 2 histo-blood group antigen precursor disaccharide == Reaction(s) known to consume the comp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite B-Gal-14-NacGlc-R == |
* common-name: | * common-name: | ||
| − | ** | + | ** a type 2 histo-blood group antigen precursor disaccharide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.4.1.151-RXN]] | ||
| + | * [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.4.1.38-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a type 2 histo-blood group antigen precursor disaccharide}} |
| − | |||
| − | |||
Revision as of 18:57, 14 January 2021
Contents
Metabolite B-Gal-14-NacGlc-R
- common-name:
- a type 2 histo-blood group antigen precursor disaccharide
