Difference between revisions of "CU+"

Revision as of 18:57, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-248 ==
+== Metabolite FARNESYL-PP ==
 * common-name:
-** 2-formylaminobenzaldehyde
+** (2e,6e)-farnesyl diphosphate
 * smiles:
-** c(c1(c(=cc=cc=1)nc=o))=o
+** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
 * inchi-key:
-** pvimspyddgdctg-uhfffaoysa-n
+** vwfjdquyciwhtn-yfvjmotdsa-k
 * molecular-weight:
-** 149.149
+** 379.306
 == Reaction(s) known to consume the compound ==
+* [[2.5.1.58-RXN]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[GGPS]]
+* [[HEMEOSYN-RXN]]
+* [[RXN-11963]]
+* [[RXN-12263]]
+* [[RXN-13162]]
+* [[RXN-17573]]
+* [[RXN-8999]]
+* [[RXN-9969]]
+* [[RXN0-5180]]
 == Reaction(s) known to produce the compound ==
-* [[INDOLE-23-DIOXYGENASE-RXN]]
+* [[2.5.1.58-RXN]]
+* [[FPPS]]
+* [[FPPSYN-RXN]]
+* [[RXN-11963]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-formylaminobenzaldehyde}}
+{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
-{{#set: inchi-key=inchikey=pvimspyddgdctg-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
-{{#set: molecular-weight=149.149}}
+{{#set: molecular-weight=379.306}}