Difference between revisions of "DIHYDROFOLATE-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9857 == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE-GLU-N == * common-name: ** a 7,8-dihydrofolate == Reaction(s) known to consume the compound == * [[DIHYDROFOLATEREDUCT-RXN]...")
 
(5 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9857 ==
+
== Metabolite DIHYDROFOLATE-GLU-N ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
+
** a 7,8-dihydrofolate
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
 
* inchi-key:
 
** ywvpprxiddchcq-cuhbluqcsa-n
 
* molecular-weight:
 
** 600.966
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DIHYDROFOLATEREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9225]]
+
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
+
{{#set: common-name=a 7,8-dihydrofolate}}
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
 
{{#set: molecular-weight=600.966}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DIHYDROFOLATE-GLU-N

  • common-name:
    • a 7,8-dihydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality