Difference between revisions of "GLYCOLATEMET-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiopurine-Methylethers Thiopurine-Methylethers] == * common-name: ** a thiopurine s-methylethe...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == * common-name: ** (2s)-2-is...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiopurine-Methylethers Thiopurine-Methylethers] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] ==
 
* common-name:
 
* common-name:
** a thiopurine s-methylether
+
** (2s)-2-isopropylmalate
 +
* smiles:
 +
** cc(c)c(o)(cc(=o)[o-])c([o-])=o
 +
* inchi-key:
 +
** bityxlxucsktjs-zetcqymhsa-l
 +
* molecular-weight:
 +
** 174.153
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[RXN-13163]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
+
* [[2-ISOPROPYLMALATESYN-RXN]]
 +
* [[3-ISOPROPYLMALISOM-RXN]]
 +
* [[IPMS]]
 +
* [[RXN-13163]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a thiopurine s-methylether}}
+
{{#set: common-name=(2s)-2-isopropylmalate}}
 +
{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
 +
{{#set: molecular-weight=174.153}}

Revision as of 14:19, 26 August 2019

Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE

  • common-name:
    • (2s)-2-isopropylmalate
  • smiles:
    • cc(c)c(o)(cc(=o)[o-])c([o-])=o
  • inchi-key:
    • bityxlxucsktjs-zetcqymhsa-l
  • molecular-weight:
    • 174.153

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality