Difference between revisions of "HEME C"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE == * common-name: ** 2-dehydro-3-deoxy-d-galactonate 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)...")
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEHYDRO-DEOXY-GALACTONATE-PHOSPHATE ==
+
== Metabolite FARNESYL-PP ==
 
* common-name:
 
* common-name:
** 2-dehydro-3-deoxy-d-galactonate 6-phosphate
+
** (2e,6e)-farnesyl diphosphate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(o)cc(=o)c([o-])=o
+
** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
 
* inchi-key:
 
* inchi-key:
** ovprppovaxrced-nqxxgfsbsa-k
+
** vwfjdquyciwhtn-yfvjmotdsa-k
 
* molecular-weight:
 
* molecular-weight:
** 255.098
+
** 379.306
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
+
* [[2.5.1.58-RXN]]
 +
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 +
* [[GGPS]]
 +
* [[HEMEOSYN-RXN]]
 +
* [[RXN-11963]]
 +
* [[RXN-12263]]
 +
* [[RXN-13162]]
 +
* [[RXN-17573]]
 +
* [[RXN-8999]]
 +
* [[RXN-9969]]
 +
* [[RXN0-5180]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
+
* [[2.5.1.58-RXN]]
 +
* [[FPPS]]
 +
* [[FPPSYN-RXN]]
 +
* [[RXN-11963]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-dehydro-3-deoxy-d-galactonate 6-phosphate}}
+
{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
{{#set: inchi-key=inchikey=ovprppovaxrced-nqxxgfsbsa-k}}
+
{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
{{#set: molecular-weight=255.098}}
+
{{#set: molecular-weight=379.306}}

Revision as of 11:17, 15 January 2021

Metabolite FARNESYL-PP

  • common-name:
    • (2e,6e)-farnesyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
  • inchi-key:
    • vwfjdquyciwhtn-yfvjmotdsa-k
  • molecular-weight:
    • 379.306

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality