Difference between revisions of "HEME C"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7813 RXN-7813] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7813 RXN-7813] ==
+
== Metabolite FARNESYL-PP ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (2e,6e)-farnesyl diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.137 ec-2.5.1.137]
+
** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[4-PRENYLPHLORISOBUTYROPHENONE]][c] '''+''' 1 [[CPD-4211]][c] '''=>''' 1 [[CPD-7107]][c] '''+''' 1 [[PPI]][c]
+
** vwfjdquyciwhtn-yfvjmotdsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09945]]
+
** 379.306
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.5.1.58-RXN]]
−
== Pathway(s) ==
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
−
* [[PWY-5808]], hyperforin and adhyperforin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5808 PWY-5808]
+
* [[GGPS]]
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
* [[HEMEOSYN-RXN]]
−
* [[PWY-5133]], colupulone and cohumulone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5133 PWY-5133]
+
* [[RXN-11963]]
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-12263]]
−
== Reconstruction information  ==
+
* [[RXN-13162]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-17573]]
−
== External links  ==
+
* [[RXN-8999]]
−
* RHEA:
+
* [[RXN-9969]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=51777 51777]
+
* [[RXN0-5180]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: ec-number=ec-2.5.1.137}}
+
* [[2.5.1.58-RXN]]
−
{{#set: nb gene associated=1}}
+
* [[FPPS]]
−
{{#set: nb pathway associated=2}}
+
* [[FPPSYN-RXN]]
−
{{#set: reconstruction category=orthology}}
+
* [[RXN-11963]]
−
{{#set: reconstruction tool=pantograph}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction comment=n.a}}
+
{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
+
{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
 +
{{#set: molecular-weight=379.306}}

Revision as of 20:35, 18 December 2020

Metabolite FARNESYL-PP

  • common-name:
    • (2e,6e)-farnesyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
  • inchi-key:
    • vwfjdquyciwhtn-yfvjmotdsa-k
  • molecular-weight:
    • 379.306

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=HEME_C&oldid=47483"